@font-face {
  font-family: "Modern Gothic";
  font-display: swap;
  src: url(/media/home/admin-use-only/css/fonts/ModernGothic-Regular.woff2) format("woff2");
}
a, abbr, acronym, address, applet, article, aside, audio, b, big, blockquote, body, canvas, caption, center, cite, code, dd, del, details, dfn, div, dl, dt, em, embed, fieldset, figcaption, figure, footer, form, h1, h2, h3, h4, h5, h6, header, hgroup, html, i, iframe, img, ins, kbd, label, legend, li, mark, menu, nav, object, ol, output, p, pre, q, ruby, s, samp, section, small, span, strike, strong, sub, summary, sup, table, tbody, td, tfoot, th, thead, time, tr, tt, u, ul, var, video {
  margin: 0;
  padding: 0;
  border: 0;
  font-size: 100%;
  font: inherit;
  vertical-align: baseline
}
article, aside, details, figcaption, figure, footer, header, hgroup, menu, nav, section {
  display: block
}
body {
  line-height: 1
}
ol, ul {
  list-style: none
}
blockquote, q {
  quotes: none
}
blockquote:after, blockquote:before, q:after, q:before {
  content: "";
  content: none
}
table {
  border-spacing: 0
}
body, html {
  overflow-x: hidden
}
button {
  border: none;
  background-color: transparent
}
p {
  font-size: 1rem;
  line-height: 1.6;
  letter-spacing: 0;
  padding: 0;
  margin-bottom: 1.25rem !important
}
a:focus, button:focus, input[type]:focus, select:focus, textarea:focus {
  outline: 3px solid #0dbdf2 !important
}
em {
  font-style: italic
}
strong {
  font-weight: 600
}
hr {
  border: solid #e7ebe7;
  border-width: 1px 0 0;
  margin: 1.75rem 0
}
code {
  background-color: #e5f0f4;
  border: 1px solid #b0bcb0;
  border-radius: 4px;
  color: #006e97 !important
}
address {
  font-style: italic !important
}
small {
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem
}
table {
  display: block;
  overflow-x: auto
}
table tr th {
  background-color: #7e072a;
  color: #fff !important;
  font-weight: 600;
  padding: 1rem 1.5rem;
  border-left: 2px solid #fff
}
table tr th:first-of-type {
  border-left: none
}
table tbody tr:nth-of-type(odd) {
  background-color: #e7ebe7;
  color: #333 !important
}
table tbody tr:nth-of-type(2n) {
  background-color: #fff;
  color: #333 !important
}
table tbody tr td {
  display: table-cell;
  padding: 1rem 1.5rem;
  border-left: 2px solid #fff
}
table tbody tr td:first-of-type {
  border-left: none
}
table tfoot tr th {
  background-color: #fff;
  color: #333 !important;
  font-weight: 600;
  padding: 1rem 1.5rem
}
table caption {
  caption-side: inherit
}
input[type=search]::-ms-clear, input[type=search]::-ms-reveal {
  display: none;
  width: 0;
  height: 0
}
input[type=search]::-webkit-search-cancel-button, input[type=search]::-webkit-search-decoration, input[type=search]::-webkit-search-results-button, input[type=search]::-webkit-search-results-decoration {
  display: none
}
.no-scroll {
  overflow: hidden
}
.hide {
  display: none
}
.body-blackout {
  position: fixed;
  z-index: 2200;
  left: 0;
  top: 0;
  bottom: 0;
  width: 100%;
  background-color: rgba(0, 0, 0, .8);
  display: none
}
.body-blackout.is-blacked-out, .body-blackout.is-blacked-out--notification {
  display: block
}
.skip-links {
  position: relative;
  z-index: 20000
}
.skip-links .off-screen {
  left: -100vw;
  position: absolute
}
.skip-links .off-screen .skip-link {
  background-color: #333;
  color: #fff;
  left: 0;
  padding: .5rem 1rem;
  position: fixed;
  opacity: 0;
  top: 0;
  white-space: normal;
  word-break: break-word;
  transform: translateY(-10rem);
  transition: all .3s ease-in-out
}
.skip-links .off-screen .skip-link:focus {
  opacity: 1;
  transform: translateY(0)
}
.svg-md-18px {
  width: 18px;
  height: 18px
}
.svg-md-24px {
  width: 24px;
  height: 24px
}
.svg-md-36px {
  width: 36px;
  height: 36px
}
.svg-md-48px {
  width: 48px;
  height: 48px
}
.body-regular-font {
  font-size: 1rem;
  line-height: 1.6;
  letter-spacing: 0;
  padding: 0;
  margin-bottom: 1.25rem !important
}
.body-lead-font {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5
}
.body-small-font {
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem
}
.overline-font {
  font-weight: 600;
  text-transform: uppercase
}
.caption-font, .overline-font {
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem
}
.caption-font {
  font-weight: 400
}
.button-font {
  font-weight: 600;
  font-size: 1.125rem;
  line-height: 1.25rem
}
.cta-link-font {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase
}
.h1-font {
  font-size: 3.125rem;
  letter-spacing: -.03rem
}
.h1-font, .h2-font {
  font-weight: 300;
  line-height: 1.2;
  word-break: break-word;
  margin-bottom: 1rem;
  margin-top: 0;
  margin-bottom: .5rem
}
.h2-font {
  font-size: 2.5rem;
  letter-spacing: -.01rem
}
.h3-font {
  font-size: 2rem;
  line-height: 1.3
}
.h3-font, .h4-font {
  font-weight: 400;
  word-break: break-word;
  margin-bottom: 1rem;
  margin-top: 0;
  margin-bottom: .5rem
}
.h4-font {
  font-size: 1.625rem;
  line-height: 1.5
}
.h5-font {
  font-size: 1.25rem;
  line-height: 1.5
}
.h5-font, .h6-font {
  font-weight: 600;
  word-break: break-word;
  margin-bottom: 1rem;
  margin-top: 0;
  margin-bottom: .5rem
}
.h6-font {
  letter-spacing: .01rem
}
.italic, .italic-bold {
  font-style: italic !important
}
.bold, .italic-bold {
  font-weight: 600 !important
}
.text-white {
  color: #fff;
}
.text-primary {
  color: #7e072a;
}
.text-dark-grey {
  color: #707070;
}
.text-black {
  color: #282220;
}

.bg-primary {
  background-color: #7e072a;
  color: #fff !important
}
.bg-secondary-blue {
  background-color: #006e97;
  color: #fff !important
}
.bg-secondary-blue-65 {
  background-color: #61a5be;
  color: #333 !important
}
.bg-secondary-blue-30 {
  background-color: #b2d3e0;
  color: #333 !important
}
.bg-secondary-blue-10 {
  background-color: #e5f0f4;
  color: #333 !important
}
.bg-secondary-grey-65 {
  background-color: #cbd3cb;
  color: #333 !important
}
.bg-secondary-grey-30 {
  background-color: #b2d3e0;
  color: #333 !important
}
.bg-secondary-grey-10 {
  background-color: #e7ebe7;
  color: #333 !important
}
.bg-black {
  background-color: #333;
  color: #fff !important
}
.bg-white {
  background-color: #fff;
  color: #333 !important
}
.top-position {
  top: 0
}
.bottom-position {
  bottom: 0
}
.left-position {
  left: 0
}
.right-position {
  right: 0
}
.flex-row-right {
  flex-direction: row-reverse
}
.flex-row-left {
  flex-direction: row
}
@keyframes a {
  0% {
    transform: scaleX(.5)
  }
  to {
    transform: scaleX(1)
  }
}
@keyframes b {
  0% {
    transform: translateX(100%);
    transition-timing-function: ease-in
  }
  to {
    transform: translateX(0);
    transition-timing-function: ease-out
  }
}
@keyframes c {
  0% {
    transform: translateX(0);
    transition-timing-function: ease-in
  }
  to {
    transform: translateX(100%);
    transition-timing-function: ease-out
  }
}
@keyframes d {
  0% {
    opacity: 0;
    transition-timing-function: ease-in
  }
  to {
    opacity: 1;
    transition-timing-function: ease-out
  }
}
@keyframes e {
  0% {
    opacity: 1;
    transition-timing-function: ease-out
  }
  to {
    opacity: 0;
    transition-timing-function: ease-in
  }
}
.no-margin-divider {
  margin-top: 0;
  margin-bottom: 0
}
.no-margin-divider-top {
  margin-top: 0
}
.no-margin-divider-bottom {
  margin-bottom: 0
}
.sm-margin-divider-top {
  margin-top: 2rem
}
.sm-margin-divider-bottom {
  margin-bottom: 2rem
}
.sm-margin-divider {
  margin-top: 2rem;
  margin-bottom: 2rem
}
.md-margin-divider-top {
  margin-top: 4rem
}
.md-margin-divider-bottom {
  margin-bottom: 4rem
}
.md-margin-divider {
  margin-top: 4rem;
  margin-bottom: 4rem
}
.lg-margin-divider-top {
  margin-top: 6rem
}
.lg-margin-divider-bottom {
  margin-bottom: 6rem
}
.lg-margin-divider {
  margin-top: 6rem;
  margin-bottom: 6rem
}
.side-divider {
  max-width: 1200px;
  margin-left: auto;
  margin-right: auto
}
.btn {
  font-weight: 600;
  font-size: 1.125rem;
  line-height: 1.25rem;
  display: inline-block;
  text-align: center;
  vertical-align: middle;
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  background-color: transparent;
  border: 2px solid transparent;
  padding: .5rem 1.5rem;
  border-radius: 2px;
  text-decoration: none !important;
  transition: color .3s ease-in-out, background-color .3s ease-in-out
}
.btn-primary, .timepicker .timepicker-picker .btn-primary {
  background-color: #7e072a;
  color: #fff !important
}
.btn-primary:hover, .timepicker .timepicker-picker .btn-primary:hover {
  background-color: #ad0031 !important
}
.btn-primary:active, .btn-primary:focus, .timepicker .timepicker-picker .btn-primary:active, .timepicker .timepicker-picker .btn-primary:focus {
  background-color: #b52b52 !important
}
.btn-primary:visited, .timepicker .timepicker-picker .btn-primary:visited {
  background-color: #8c0027
}
.btn-primary:disabled, .timepicker .timepicker-picker .btn-primary:disabled {
  background-color: #b05a72
}
.btn-primary[disabled], .timepicker .timepicker-picker [disabled].btn-primary {
  background-color: #b05a72;
  cursor: auto;
  pointer-events: none
}
.btn-secondary {
  border-radius: 10px;
  border: 2px solid var(--Red, #dd3224) !important;
  background: #fff;
  color: var(--Red, #dd3224) !important;
  line-height: normal;
  background-color: #b0bcb0;
  color: #333 !important
}
.btn-secondary:hover {
  border: 2px solid var(--Maroon, #7E072A) !important;
  background: #FFF !important
}
.btn-secondary:active, .btn-secondary:focus {
  background-color: #cdc9c5 !important
}
.btn-secondary:visited {
  background-color: #aebaae
}
.btn-secondary:disabled {
  background-color: #d9d9d9
}
.btn-secondary[disabled] {
  background-color: #d9d9d9;
  opacity: .7;
  cursor: auto;
  pointer-events: none
}
.btn-white {
  background-color: #fff;
  color: #7e072a
}
.btn-white:hover {
  background-color: #eff0f4 !important;
  color: #ad0031 !important
}
.btn-white:active, .btn-white:focus {
  background-color: #eff0f4 !important;
  color: #b52b52 !important
}
.btn-white:visited {
  color: #8c0027
}
.btn-white:disabled > svg {
  fill: #d9d9d9
}
.btn-white[disabled] {
  cursor: auto;
  pointer-events: none
}
.btn-white[disabled] > svg {
  fill: #d9d9d9
}
.btn-left-add-icon > svg {
  margin-top: -.15rem;
  margin-right: .5rem;
  margin-left: -.5rem
}
.btn-left-add-icon.btn-primary > svg, .timepicker .timepicker-picker .btn-left-add-icon.btn-primary > svg {
  fill: #fff
}
.btn-left-add-icon.btn-secondary > svg {
  fill: #333
}
.btn-left-add-icon.btn-white > svg {
  fill: #7e072a
}
.btn-right-arrow-icon > svg {
  margin-top: -.15rem;
  margin-right: -.5rem;
  margin-left: .5rem
}
.btn-right-arrow-icon.btn-primary > svg, .timepicker .timepicker-picker .btn-right-arrow-icon.btn-primary > svg {
  fill: #fff
}
.btn-right-arrow-icon.btn-secondary > svg {
  fill: #333
}
.btn-right-arrow-icon.btn-white > svg {
  fill: #7e072a
}
.btn-directional-left {
  padding: .15rem .25rem !important;
  border-radius: 2px
}
.btn-directional-left[disabled] {
  background-color: #d9d9d9;
  opacity: .7;
  cursor: auto;
  pointer-events: none
}
.btn-directional-left.btn-primary > svg, .timepicker .timepicker-picker .btn-directional-left.btn-primary > svg {
  fill: #fff
}
.btn-directional-left.btn-white > svg {
  fill: #7e072a
}
.btn-directional-right {
  padding: .15rem .25rem !important;
  border-radius: 2px;
  margin-left: -.3rem
}
.btn-directional-right[disabled] {
  background-color: #d9d9d9;
  opacity: .7;
  cursor: auto;
  pointer-events: none
}
.btn-directional-right.btn-primary, .timepicker .timepicker-picker .btn-directional-right.btn-primary {
  border-left: 1px solid #fff
}
.btn-directional-right.btn-primary > svg, .timepicker .timepicker-picker .btn-directional-right.btn-primary > svg {
  fill: #fff
}
.btn-directional-right.btn-white > svg {
  fill: #7e072a
}
.link-icon {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase
}
.link-icon > svg {
  fill: #7e072a;
  margin-top: -.15rem
}
.button {
  font-weight: 600;
  font-size: 1.125rem;
  line-height: 1.25rem;
  display: inline-block;
  text-align: center;
  vertical-align: middle;
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  border: 2px solid transparent;
  padding: .5rem 1.5rem;
  border-radius: 2px;
  text-decoration: none !important;
  transition: color .3s ease-in-out, background-color .3s ease-in-out;
  background-color: #7e072a;
  color: #fff !important
}
.button:hover {
  background-color: #ad0031 !important
}
.button:active, .button:focus {
  background-color: #b52b52 !important
}
.button:visited {
  background-color: #8c0027
}
.button:disabled, .button[disabled] {
  background-color: #b05a72
}
.button[disabled] {
  cursor: auto;
  pointer-events: none
}
.expand {
  width: 100%
}
.btn-tab.is__active svg:first-child, .btn-tab svg:last-child {
  display: none
}
.btn-tab.is__active svg:last-child {
  display: block
}
.js .js-t4form-container {
  opacity: 0
}
.js.js-ready .js-t4form-container {
  opacity: 1
}
.js-t4form-container {
  font-family: "Modern Gothic", Arial, sans-serif !important;
  position: relative
}
.js-t4form-container .js-submit.btn {
  font-weight: 600 !important;
  font-size: 1.125rem !important;
  line-height: 1.25rem !important;
  display: inline-block;
  text-align: center;
  vertical-align: middle;
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  background-color: transparent;
  border: 2px solid transparent !important;
  padding: .5rem 1.5rem !important;
  border-radius: 2px !important;
  text-decoration: none !important;
  transition: color .3s ease-in-out, background-color .3s ease-in-out
}
.js-t4form-container .js-submit.btn-primary {
  background-color: #7e072a !important
}
.js-t4form-container .js-submit.btn-primary:hover {
  background-color: #ad0031 !important
}
.js-t4form-container .js-submit.btn-primary:active, .js-t4form-container .js-submit.btn-primary:focus {
  background-color: #b52b52 !important
}
.js-t4form-container .js-submit.btn-primary:visited {
  background-color: #8c0027
}
.js-t4form-container .js-submit.btn-primary:disabled {
  background-color: #b05a72
}
.form-group {
  position: relative;
  margin-bottom: 2rem !important
}
.form-group.has-error .form-control {
  border: 1px solid #7e072a !important
}
.form-group.has-error label.control-label {
  top: -.75rem;
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem;
  color: #7e072a;
  padding: 0 .5rem
}
.form-group.has-error .help-block {
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem;
  margin-top: .5rem;
  margin-left: 1rem
}
.form-group.has-error .input-group .date-picker {
  border-right: none !important
}
.form-group.has-error .input-group .input-group-addon {
  color: #7e072a !important;
  border-color: #7e072a !important
}
.form-group.list-options {
  margin-bottom: 0 !important
}
textarea.form-control {
  height: auto !important;
  min-height: 200px;
  padding: .75rem !important
}
.form-control {
  height: 45px !important;
  border-radius: 2px !important;
  border: 1px solid #333 !important
}
.form-control:focus {
  border: 1px solid #006e97 !important;
  box-shadow: none !important
}
.col-sm-6 label.control-label {
  left: 1.75rem
}
.col-sm-6:first-child {
  margin-bottom: 1rem
}
.preview-span {
  margin-bottom: 1rem !important;
  font-weight: 400 !important
}
label.control-label {
  position: absolute;
  top: .65rem;
  left: .75rem;
  padding: 0 .5rem;
  background-color: #fff;
  font-size: 1rem;
  line-height: 1.6;
  letter-spacing: 0;
  padding: 0;
  margin-bottom: 1.25rem !important;
  font-weight: 400 !important;
  cursor: auto;
  z-index: 100;
  transition: top .3s ease-in-out, font-size .3s ease-in-out
}
label.control-label--active, label.control-label--change {
  top: -.75rem;
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem;
  color: #006e97
}
label.control-label--active + .date-picker {
  border: 1px solid #006e97 !important
}
.input-group .date-picker {
  border-right: none !important;
  border-bottom-right-radius: 0 !important;
  border-top-right-radius: 0 !important
}
.input-group .date-picker--change {
  border: 1px solid #006e97 !important;
  border-right: none !important
}
.input-group .input-group-addon {
  color: #333 !important;
  background-color: transparent !important;
  border: 1px solid #333 !important;
  border-left: none !important;
  border-radius: 2px !important;
  border-bottom-left-radius: 0 !important;
  border-top-left-radius: 0 !important
}
.input-group--change .input-group-addon {
  color: #006e97 !important;
  border-color: #006e97 !important
}
.js-progress-bar {
  margin-top: 1rem !important
}
input[type=file] {
  margin-bottom: .5rem !important
}
legend.control-label {
  font-size: 1rem;
  line-height: 1.6;
  letter-spacing: 0;
  padding: 0;
  margin-bottom: 1.25rem !important;
  font-weight: 400 !important
}
select {
  -moz-appearance: none;
  -webkit-appearance: none
}
select::-ms-expand {
  display: none
}
input[name=form-field-checkbox] {
  display: none
}
.checkbox {
  position: relative !important
}
.checkbox input[type=checkbox] {
  display: none
}
.checkbox > label {
  cursor: pointer;
  display: block;
  position: relative;
  padding-left: 0 !important
}
.checkbox > label, .checkbox > label:before {
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  vertical-align: middle
}
.checkbox > label:before {
  width: 20px;
  height: 20px;
  border: 1px solid #333;
  content: "";
  display: inline-block;
  will-change: background-color, border-color;
  border-radius: 2px;
  background-color: #fff;
  transition: all .3s ease-in-out
}
.checkbox > label:after {
  top: .75rem;
  left: .5rem;
  width: 10px;
  height: 5px;
  border: 2px solid #fff;
  border-top-style: none;
  border-right-style: none;
  content: "";
  position: absolute;
  will-change: transform;
  transform-origin: bottom left;
  transform: scale(0) rotate(-90deg) translateZ(0);
  transition: all .2s ease-in-out
}
.checkbox > label:focus {
  box-shadow: 0 0 5px #006e97;
  outline: 1px solid rgba(229, 240, 244, .1) !important
}
.checkbox > label > span {
  margin-left: .5rem
}
.checkbox--active > label:before {
  background-color: #7e072a;
  border-color: #7e072a
}
.checkbox--active > label:after {
  transform: scale(1) rotate(-45deg) translateZ(0)
}
input[name=form-field-radio-32538] {
  display: none
}
.radio {
  position: relative !important
}
.radio > label {
  cursor: pointer;
  display: block;
  position: relative;
  padding-left: 0 !important
}
.radio > label, .radio > label:before {
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none;
  vertical-align: middle
}
.radio > label:before {
  width: 20px;
  border: 1px solid #333;
  height: 20px;
  content: "";
  display: inline-block;
  will-change: background-color, border-color;
  border-radius: 50%;
  background-color: #fff;
  transition: all .3s ease-in-out
}
.radio > label:after {
  top: .8rem;
  left: .6rem;
  width: 12px;
  height: 12px;
  content: "";
  position: absolute;
  transform: translate(-50%, -50%) scale(0) translateZ(0);
  will-change: transform;
  border-radius: 50%;
  background-color: #7e072a;
  transition: all .2s ease-in-out
}
.radio > label:focus {
  box-shadow: 0 0 5px #006e97;
  outline: 1px solid rgba(229, 240, 244, .1) !important
}
.radio > label > span {
  margin-left: .5rem
}
.radio--active > label:before {
  border-color: #7e072a
}
.radio--active > label:after {
  transform: translate(-50%, -50%) scale(1) translateZ(0);
  background-color: #7e072a
}
.bootstrap-datetimepicker-widget {
  border-radius: 2px !important;
  padding: .5rem !important
}
.bootstrap-datetimepicker-widget table {
  display: table;
  border-collapse: initial;
  overflow-x: initial
}
.datepicker {
  color: #006e97
}
.datepicker table thead tr {
  font-weight: 700
}
.datepicker table thead tr th {
  background-color: #fff;
  color: #333 !important;
  border: none;
  border-radius: 0
}
.datepicker table thead tr th:hover {
  background-color: #e7ebe7 !important
}
.datepicker table tbody tr {
  background-color: #fff
}
.datepicker table tbody tr td {
  border: 1px solid #fff;
  border-radius: 2px
}
.datepicker table tbody tr td:hover {
  background-color: #e7ebe7 !important
}
.datepicker table tbody tr td.today {
  background-color: #fff;
  color: #7e072a;
  font-weight: 700
}
.datepicker table tbody tr td.today:before {
  border-bottom-color: #7e072a !important
}
.datepicker table tbody tr td.today:hover {
  background-color: #fff
}
.datepicker table tbody tr td.today.active {
  background-color: #7e072a
}
.datepicker table tbody tr td.active {
  background-color: #7e072a;
  color: #fff !important
}
.datepicker table tbody tr td.active:hover {
  background-color: #7e072a !important
}
.datepicker .datepicker-months table tbody tr td:hover, .datepicker .datepicker-years table tbody tr td:hover {
  background-color: #fff !important
}
.datepicker .datepicker-months table tbody tr td span:hover, .datepicker .datepicker-years table tbody tr td span:hover {
  background-color: #e7ebe7 !important
}
.datepicker .datepicker-months table tbody tr td span.active, .datepicker .datepicker-years table tbody tr td span.active {
  background-color: #7e072a !important;
  color: #fff !important
}
.picker-switch table tbody tr td {
  border-radius: 2px;
  background-color: #e7ebe7
}
.picker-switch table tbody tr td:hover {
  background-color: #e7ebe7
}
.picker-switch table tbody tr td a span {
  color: #006e97
}
.picker-switch table tbody tr td a span:hover {
  background-color: transparent
}
.timepicker .timepicker-picker {
  margin-top: .5rem
}
.timepicker .timepicker-picker table tbody tr td {
  border-radius: 2px
}
.timepicker .timepicker-picker table tbody tr td a:hover {
  color: #006e97
}
.timepicker .timepicker-picker table tbody tr td span:hover {
  background-color: #e7ebe7
}
.timepicker .timepicker-picker .btn-primary {
  border: none
}
.timepicker .timepicker-hours, .timepicker .timepicker-minutes {
  margin-top: .5rem
}
.timepicker .timepicker-hours table tbody tr td, .timepicker .timepicker-minutes table tbody tr td {
  background-color: #fff
}
.timepicker .timepicker-hours table tbody tr td:hover, .timepicker .timepicker-minutes table tbody tr td:hover {
  background-color: #e7ebe7
}
.tabs {
  list-style: none
}
.tabs__nav-link {
  cursor: pointer;
  text-decoration: none;
  position: relative;
  z-index: 1
}
.tabs__nav-link > span {
  pointer-events: none
}
.tabs__content {
  display: block;
  transition: opacity .3s ease-in-out
}
.style__horizontal .tabs__content.is__active, .style__vertical .tabs__content.is__active, .tabs__content.is__active {
  opacity: 1;
  height: auto;
  visibility: visible
}
.style__horizontal .tabs__content, .style__vertical .tabs__content {
  height: 0;
  overflow: hidden;
  opacity: 0;
  visibility: hidden
}
.tabs__content-wrapper {
  padding: 2rem
}
.tabs__icon {
  margin-left: 1rem;
  z-index: -1;
  pointer-events: none
}
.style__horizontal .tabs__icon--add {
  fill: #7e072a;
  display: none
}
.style__accordion .tabs__icon--add {
  fill: #7e072a
}
.style__accordion .tabs__icon--remove, .style__horizontal .tabs__icon--remove {
  fill: #7e072a;
  display: none
}
.tabs.style__horizontal .tabs__nav {
  position: relative;
  z-index: 2;
  display: flex;
  justify-content: center;
  margin-bottom: -1px;
  border-bottom: 1px solid #e7ebe7
}
.tabs.style__horizontal .tabs__nav .tabs__nav-link {
  padding: .5rem 1.5rem;
  margin: 0 .1rem;
  display: block;
  background-color: #fff;
  border-bottom: 2px solid transparent
}
.tabs.style__horizontal .tabs__nav .tabs__nav-link:hover {
  background-color: #e7ebe7
}
.tabs.style__horizontal .tabs__nav .tabs__nav-link:first-child {
  margin-left: 0
}
.tabs.style__horizontal .tabs__nav .tabs__nav-link:last-child {
  margin-right: 0
}
.tabs.style__horizontal .tabs__nav .tabs__nav-link.is__active {
  font-weight: 600;
  background-color: #e7ebe7;
  border-bottom: 2px solid #7e072a
}
.tabs.style__horizontal .tabs__content.is__active {
  background-color: #fff;
  position: relative;
  z-index: 1
}
.tabs.style__horizontal .tabs__content .tabs__nav-link {
  display: none
}
.tabs.is__responsive, .tabs.style__accordion {
  display: block
}
.tabs.is__responsive .tabs__nav, .tabs.style__accordion .tabs__nav {
  display: none
}
.tabs.is__responsive .tabs__content .tabs__nav-link, .tabs.is__responsive .tabs__nav-link, .tabs.style__accordion .tabs__content .tabs__nav-link, .tabs.style__accordion .tabs__nav-link {
  display: flex;
  justify-content: space-between;
  width: 100%;
  text-align: left;
  padding: 1rem;
  font-weight: 600;
  background-color: #7e072a;
  border-bottom: 1px solid #e7ebe7;
  color: #FFF
}
.tabs.is__responsive .tabs__content .tabs__nav-link > span, .tabs.is__responsive .tabs__nav-link > span, .tabs.style__accordion .tabs__content .tabs__nav-link > span, .tabs.style__accordion .tabs__nav-link > span {
  width: 95%;
  color: inherit
}
.tabs.is__responsive .tabs__content .tabs__nav-link svg, .tabs.is__responsive .tabs__nav-link svg, .tabs.style__accordion .tabs__content .tabs__nav-link svg, .tabs.style__accordion .tabs__nav-link svg {
  fill: #fff
}
.tabs.is__responsive .tabs__content .tabs__nav-link.bg-primary, .tabs.is__responsive .tabs__nav-link.bg-primary, .tabs.style__accordion .tabs__content .tabs__nav-link.bg-primary, .tabs.style__accordion .tabs__nav-link.bg-primary {
  border-bottom: 1px solid #fff
}
.tabs.is__responsive .tabs__content .tabs__nav-link.bg-primary:focus, .tabs.is__responsive .tabs__content .tabs__nav-link.bg-primary:hover, .tabs.is__responsive .tabs__nav-link.bg-primary:focus, .tabs.is__responsive .tabs__nav-link.bg-primary:hover, .tabs.style__accordion .tabs__content .tabs__nav-link.bg-primary:focus, .tabs.style__accordion .tabs__content .tabs__nav-link.bg-primary:hover, .tabs.style__accordion .tabs__nav-link.bg-primary:focus, .tabs.style__accordion .tabs__nav-link.bg-primary:hover {
  background-color: #7e072a !important
}
.tabs.is__responsive .tabs__content .tabs__nav-link.bg-secondary-grey-10, .tabs.is__responsive .tabs__nav-link.bg-secondary-grey-10, .tabs.style__accordion .tabs__content .tabs__nav-link.bg-secondary-grey-10, .tabs.style__accordion .tabs__nav-link.bg-secondary-grey-10 {
  background-color: #e7ebe7 !important;
  border-bottom: 1px solid #cbd3cb
}
.tabs.is__responsive .tabs__content .tabs__nav-link.bg-secondary-grey-10 svg, .tabs.is__responsive .tabs__nav-link.bg-secondary-grey-10 svg, .tabs.style__accordion .tabs__content .tabs__nav-link.bg-secondary-grey-10 svg, .tabs.style__accordion .tabs__nav-link.bg-secondary-grey-10 svg {
  fill: #7e072a
}
.tabs.is__responsive .tabs__content .tabs__nav-link.bg-secondary-blue-10, .tabs.is__responsive .tabs__nav-link.bg-secondary-blue-10, .tabs.style__accordion .tabs__content .tabs__nav-link.bg-secondary-blue-10, .tabs.style__accordion .tabs__nav-link.bg-secondary-blue-10 {
  background-color: #e5f0f4 !important;
  border-bottom: 1px solid #cbd3cb
}
.tabs.is__responsive .tabs__content .tabs__nav-link.bg-secondary-blue-10 svg, .tabs.is__responsive .tabs__nav-link.bg-secondary-blue-10 svg, .tabs.style__accordion .tabs__content .tabs__nav-link.bg-secondary-blue-10 svg, .tabs.style__accordion .tabs__nav-link.bg-secondary-blue-10 svg {
  fill: #7e072a
}
.tabs.is__responsive .tabs__content .tabs__nav-link.bg-white, .tabs.is__responsive .tabs__nav-link.bg-white, .tabs.style__accordion .tabs__content .tabs__nav-link.bg-white, .tabs.style__accordion .tabs__nav-link.bg-white {
  background-color: #fff !important;
  border-bottom: 1px solid #cbd3cb
}
.tabs.is__responsive .tabs__content .tabs__nav-link.bg-white svg, .tabs.is__responsive .tabs__nav-link.bg-white svg, .tabs.style__accordion .tabs__content .tabs__nav-link.bg-white svg, .tabs.style__accordion .tabs__nav-link.bg-white svg {
  fill: #7e072a
}
.tabs.is__responsive .tabs__content .tabs__nav-link.text-white, .tabs.is__responsive .tabs__nav-link.text-white, .tabs.style__accordion .tabs__content .tabs__nav-link.text-white, .tabs.style__accordion .tabs__nav-link.text-white {
  color: #fff !important
}
.tabs.is__responsive .tabs__content .tabs__nav-link.text-primary, .tabs.is__responsive .tabs__nav-link.text-primary, .tabs.style__accordion .tabs__content .tabs__nav-link.text-primary, .tabs.style__accordion .tabs__nav-link.text-primary {
  color: #7e072a !important
}
.tabs.is__responsive .tabs__content .tabs__nav-link.text-dark-grey, .tabs.is__responsive .tabs__nav-link.text-dark-grey, .tabs.style__accordion .tabs__content .tabs__nav-link.text-dark-grey, .tabs.style__accordion .tabs__nav-link.text-dark-grey {
  color: #707070 !important
}
.tabs.is__responsive .tabs__nav-link.is__active, .tabs.style__accordion .tabs__nav-link.is__active {
  margin-bottom: 0
}
.tabs.is__responsive .tabs__content, .tabs.style__accordion .tabs__content {
  display: block;
  height: auto;
  flex: none;
  opacity: 1;
  visibility: visible;
  overflow: auto;
  width: auto;
  padding: 2px 5px;
  margin: -5px
}
.tabs.is__responsive .tabs__content-wrapper, .tabs.style__accordion .tabs__content-wrapper {
  border-bottom: 1px solid #e7ebe7;
  height: 0;
  overflow: hidden;
  visibility: hidden;
  transform-origin: top center;
  padding: 0 1rem;
  transition: min-height .4s cubic-bezier(.2, .4, .75, .97), padding .4s cubic-bezier(.2, .4, .75, .97)
}
.tabs.is__responsive .tabs__content.is__active .tabs__content-wrapper, .tabs.style__accordion .tabs__content.is__active .tabs__content-wrapper {
  min-height: 10px;
  height: auto;
  visibility: visible;
  padding: 1rem
}
.tabs.is__responsive .tabs__content.is__active .tabs__icon--add, .tabs.style__accordion .tabs__content.is__active .tabs__icon--add {
  display: none
}
.tabs.is__responsive .tabs__content.is__active .tabs__icon--remove, .tabs.style__accordion .tabs__content.is__active .tabs__icon--remove {
  display: block
}
@media (max-width:991px) {
  .style__horizontal .tabs__icon--add {
    display: block
  }
}
.breadcrumb {
  display: flex;
  flex-wrap: wrap;
  list-style: none
}
.breadcrumb__item {
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem
}
.breadcrumb__item + li:before {
  content: "/";
  color: #b0bcb0;
  margin: 0 .5rem
}
.breadcrumb__link, .breadcrumb__link:hover {
  color: #333
}
.breadcrumb__link--active, .breadcrumb__link--active:hover {
  color: #7e072a
}
.js .inner {
  opacity: 0
}
.js.js-ready .inner {
  opacity: 1
}
.inner {
  display: flex;
  max-width: 1200px;
  margin-right: auto;
  margin-left: auto
}
.inner__sidebar {
  display: flex;
  flex-direction: column;
  align-items: flex-end;
  text-align: left;
  width: 325px;
  padding: 2rem 4rem 2rem 2rem;
  border-right: 1px solid #e7ebe7;
  transition: width .3s ease-in-out
}
.inner__sidebar__lists {
  width: 100%
}
.inner__sidebar__dropdown-menu {
  padding: .25rem 0
}
.inner__sidebar__dropdown-menu p {
  color: #7e072a;
  font-weight: 600
}
.inner__sidebar__dropdown-menu ul {
  margin-top: .5rem;
  margin-bottom: 0;
  /*padding: .5rem .65rem 0*/
}
.inner__sidebar__dropdown-menu ul li a::after {
  content: "";
  background-image: url(https://pxl-fordhamedu.terminalfour.net/prod01/channel_8/cura-personalis/media/arrow-right.svg);
  height: 8px;
  width: 8px;
  display: inline-block;
  background-repeat: no-repeat;
  background-position: center;
  background-size: contain;
  margin-left: 5px;
}
.inner__sidebar__dropdown-menu ul li a.active {
  color: #7e072a !important;
  font-weight: 700
}
.inner__sidebar__dropdown-menu > ul {
  background-color: #FFFFFF;
  padding-bottom: .5rem
}
.inner__sidebar__dropdown-menu > ul li .currentbranch0 {
  color: #333;
  font-weight: 700
}
.inner__sidebar__dropdown-menu > ul li .currentbranch0 a {
  color: #333
}
.inner__sidebar__dropdown-menu > ul li ul {
  background-color: #dbdbdb
}
.inner__sidebar__dropdown-menu > ul li ul ul {
  background-color: #e8e8e8
}
.inner__sidebar__dropdown-menu > ul li ul ul ul {
  background-color: #f4f4f4
}
.inner__sidebar__dropdown-menu > ul li ul ul ul ul {
  background-color: #fff
}
.inner__sidebar__dropdown-menu__item {
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem;
  padding: .25rem 0
}
.inner__sidebar__dropdown-menu__link {
color: var(--Maroon, #7E072A);
}
.inner__sidebar__dropdown-menu__link:hover {
  color: #727272 !important
}
.inner__sidebar__button {
  display: none;
  justify-content: space-between;
  align-items: center;
  width: 100%;
  background-color: #e7ebe7;
  padding: 0
}
.inner__sidebar__button > span {
  display: block;
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  text-transform: capitalize
}
.inner__sidebar__button > svg {
  fill: #fff;
  background-color: #7e072a
}
.inner__sidebar__widget {
  width: 100%
}
.inner__sidebar__widget .events-side-widget__wrapper {
  padding: 0
}
.inner__sidebar__widget .events-side-widget .event__panel {
  padding: 1rem 0
}
.inner__sidebar__widget .statistics-blocks__block {
  width: 230px;
  height: 230px;
  margin: 2rem 0 2rem auto
}
.inner__sidebar__widget .statistics-blocks__block:first-child {
  margin-top: 0
}
.inner__content {
  padding: 0 2rem 0 4rem;
  width: calc(100% - 325px)
}
.inner__content .accordion-ct__wrapper, .inner__content .events-card-type__wrapper, .inner__content .header-bullet-list__wrapper, .inner__content .header-button__wrapper, .inner__content .tabs-ct__wrapper {
  padding: 0
}
.inner__content .accordion-ct .event__card, .inner__content .events-card-type .event__card, .inner__content .header-bullet-list .event__card, .inner__content .header-button .event__card, .inner__content .tabs-ct .event__card {
  flex: 0 0 calc(50% - 1rem);
  max-width: calc(50% - 1rem)
}
.inner__content .accordion-ct .event__card:nth-of-type(odd), .inner__content .events-card-type .event__card:nth-of-type(odd), .inner__content .header-bullet-list .event__card:nth-of-type(odd), .inner__content .header-button .event__card:nth-of-type(odd), .inner__content .tabs-ct .event__card:nth-of-type(odd) {
  margin-left: 0;
  margin-right: 1rem
}
.inner__content .accordion-ct .event__card:nth-of-type(2n), .inner__content .events-card-type .event__card:nth-of-type(2n), .inner__content .header-bullet-list .event__card:nth-of-type(2n), .inner__content .header-button .event__card:nth-of-type(2n), .inner__content .tabs-ct .event__card:nth-of-type(2n) {
  margin-right: 0;
  margin-left: 1rem
}
.inner__content .statistics-blocks {
  display: flex;
  flex-wrap: wrap
}
.inner__content .statistics-blocks__block {
  flex: 0 0 calc(50% - 1rem);
  max-width: calc(50% - 1rem);
  height: unset;
  min-height: 260px;
  margin-top: 1rem;
  margin-bottom: 1rem
}
.inner__content .statistics-blocks__block:nth-of-type(odd) {
  margin-left: 0;
  margin-right: 1rem
}
.inner__content .statistics-blocks__block:nth-of-type(2n) {
  margin-right: 0;
  margin-left: 1rem
}
.inner__content .profile__wrapper {
  padding: 2rem 0
}
.inner__content .featured-item-banner__img {
  display: none
}
.inner__content .featured-item-banner__wrapper {
  position: static;
  display: block;
  flex-wrap: nowrap
}
.inner__content .featured-item-banner__block {
  position: static;
  transform: translateY(0);
  width: 100%;
  display: block;
  flex-direction: row;
  justify-content: initial;
  padding: 0
}
.inner__content .featured-item-banner__block.left-position {
  left: 0
}
.inner__content .featured-item-banner__block.right-position {
  right: 0
}
.inner__content .featured-item-banner__block__img {
  height: auto;
  margin-bottom: 0
}
.inner__content .featured-item-banner__block__inner {
  padding: 2rem;
  margin-bottom: 1rem
}
.inner__content .featured-item-banner__widget {
  position: static;
  width: 100%
}
.inner__content .featured-item-banner__widget--block {
  justify-content: space-between
}
.inner__content .featured-item-banner__caption {
  display: none
}
.inner__content .video-panel__wrapper.left-block-right-video {
  flex-direction: column-reverse
}
.inner__content .video-panel__wrapper.right-block-left-video {
  flex-direction: column
}
.inner__content .video-panel__block, .inner__content .video-panel__video {
  width: 100%
}
.inner__content .video-panel__video--youtube {
  padding-bottom: 42%
}
.inner__content .video-panel__video--mp4 {
  height: auto
}
.inner__content .video-panel__video--vimeo {
  padding-bottom: 57%
}
.inner__content .img-call-out__wrapper {
  display: block
}
.inner__content .img-call-out__block, .inner__content .img-call-out__img {
  width: 100%
}
.inner__content .banner-img-txt__img {
  height: 100%
}
.inner__content .banner-img-txt-alt__img {
  height: auto
}
.inner__content .banner-img-txt-alt__block {
  position: static;
  transform: translateY(0);
  width: 100%;
  height: 100%
}
.inner__content .general-content img {
  width: 100%
}
.inner__breadcrumb {
  margin: 2rem 0
}
.inner__footer, .inner__widget {
  display: none
}
.inner__footer-social {
  margin: 0 -2rem
}
.fullwidth {
  max-width: 1800px;
  margin-right: auto;
  margin-left: auto
}
.fullwidth .section-title {
  font-weight: 300;
  font-size: 3.125rem;
  line-height: 1.2;
  letter-spacing: -.03rem;
  word-break: break-word;
  margin-bottom: 1rem;
  padding: 2rem;
  margin-bottom: 0
}
.fullwidth .button-ct {
  padding: 0 2rem
}
.fullwidth .statistics-blocks {
  display: flex;
  flex-wrap: wrap
}
.fullwidth .statistics-blocks__block {
  flex: 0 0 calc(25% - 1.5rem);
  max-width: calc(25% - 1.5rem);
  margin: 1rem
}
.fullwidth .statistics-blocks__block:first-child, .fullwidth .statistics-blocks__block:nth-child(4n+1) {
  margin-left: 0;
  margin-right: 1rem
}
.fullwidth .statistics-blocks__block:nth-child(4n) {
  margin-right: 0;
  margin-left: 1rem
}
.fullwidth .accordion-ct__wrapper, .fullwidth .header-button__wrapper, .fullwidth .tabs-ct__wrapper {
  padding: 0
}
@media (max-width:1280px) {
  .fullwidth .accordion-ct__wrapper, .fullwidth .cta-box__heading, .fullwidth .general-content, .fullwidth .header-button__wrapper, .fullwidth .statistics-blocks, .fullwidth .tabs-ct__wrapper {
    padding: 0 2rem
  }
}
@media (max-width:1199px) {
  .inner__content .carousel__slide {
    display: block
  }
  .inner__content .carousel__slide__block {
    width: 100%
  }
  .inner__content .carousel__slide__img {
    width: 100%;
    height: auto
  }
  .inner__content .carousel__arrows {
    right: 0;
    top: 0;
    left: auto;
    transform: none
  }
  .inner__content .featured-item-list__featured {
    display: block;
    flex-direction: row;
    margin-bottom: 1rem
  }
  .inner__content .featured-item-list__featured__block, .inner__content .featured-item-list__featured__img {
    width: 100%
  }
}
@media (max-width:1024px) {
  .fullwidth .statistics-blocks__block {
    flex: 0 0 calc(50% - 1rem);
    max-width: calc(50% - 1rem);
    height: unset;
    min-height: 260px
  }
  .fullwidth .statistics-blocks__block:nth-of-type(odd) {
    margin-left: 0;
    margin-right: 1rem
  }
  .fullwidth .statistics-blocks__block:nth-of-type(2n) {
    margin-right: 0;
    margin-left: 1rem
  }
}
@media (min-width:992px) {
  .inner__content .box-img-text-type-1__widget, .inner__content .events-slider-type-1__widget {
    padding-left: 0;
    padding-right: 0
  }
  .inner__content .box-img-text-type-1__slide, .inner__content .events-slider-type-1__slide {
    margin: .25rem
  }
  .inner__content .box-img-text-type-2__widget, .inner__content .events-slider-type-2__widget {
    width: 35%;
    padding-left: 0
  }
  .inner__content .cta-box__col--3 .cta-box__img {
    height: 150px;
    min-height: 225px;
    max-height: 225px
  }
  .inner__content .cta-box__col--5 .cta-box__img {
    height: 150px
  }
}
@media (max-width:991px) {
  .inner {
    display: block
  }
  .inner__sidebar {
    display: block;
    flex-direction: row;
    align-items: initial;
    text-align: left;
    width: auto;
    border-right: none;
    padding: 0;
    margin: 2rem
  }
  .inner__sidebar__button {
    display: flex;
    padding: .5rem
  }
  .inner__sidebar__button > span {
    color: #7e072a;
    font-weight: 700;
    width: 80%;
    padding: 0 .5rem;
    text-align: left
  }
  .inner__sidebar__lists {
    border: 1px solid #e7ebe7;
    padding: 1.5rem;
    overflow: hidden;
    visibility: visible;
    max-height: 100vh;
    transition: max-height .4s cubic-bezier(.35, .15, .84, .89), padding .4s cubic-bezier(.2, .4, .75, .97)
  }
  .inner__sidebar__lists--collapse {
    padding: 0 1.5rem;
    visibility: hidden;
    max-height: 0;
    transition: max-height .4s cubic-bezier(.2, .4, .75, .97), padding .4s cubic-bezier(.14, .34, .73, .72), visibility .8s cubic-bezier(.14, .34, .73, .72)
  }
  .inner__sidebar__dropdown-menu {
    margin-top: 0;
    padding: 0
  }
  .inner__sidebar__dropdown-menu p {
    font-weight: 400;
    font-size: .875rem;
    letter-spacing: .01rem;
    font-weight: 600;
    padding: .5rem 1rem;
    background-color: #e5f0f4
  }
  .inner__sidebar__dropdown-menu ul {
    padding: 0;
    border-right: none;
    border-left: 1px solid #e7ebe7
  }
  .inner__sidebar__dropdown-menu > ul, .inner__sidebar__dropdown-menu > ul li ul, .inner__sidebar__dropdown-menu > ul li ul ul, .inner__sidebar__dropdown-menu > ul li ul ul ul, .inner__sidebar__dropdown-menu > ul li ul ul ul ul {
    background-color: #fff
  }
  .inner__sidebar__dropdown-menu > li {
    padding-left: 0;
    padding-right: 0
  }
  .inner__sidebar__dropdown-menu__item {
    padding: .25rem 1.5rem
  }
  .inner__sidebar__dropdown-menu__link {
    display: block
  }
  .inner__sidebar__widget {
    display: none
  }
  .inner__sidebar .statistics-blocks {
    display: flex;
    flex-wrap: wrap;
    justify-content: center
  }
  .inner__sidebar .statistics-blocks__block {
    margin: 0 1rem 2rem
  }
  .inner__content {
    padding: 0;
    width: auto
  }
  .inner__content .accordion-ct__wrapper, .inner__content .button-ct, .inner__content .events-card-type__wrapper, .inner__content .general-content, .inner__content .header-bullet-list__wrapper, .inner__content .header-button__wrapper, .inner__content .statistics-blocks, .inner__content .tabs-ct__wrapper {
    padding: 0 2rem
  }
  .inner__content .box-img-text-type-2__widget, .inner__content .events-slider-type-2__widget {
    width: 100%
  }
  .inner__content .gallery__arrows {
    right: 20vw
  }
  .inner__content .profile__wrapper {
    padding: 2rem
  }
  .inner__content .cta-box__heading {
    padding: 0 2rem
  }
  .inner__breadcrumb {
    display: none
  }
  .inner__footer, .inner__widget {
    display: block
  }
}
@media (max-width:575px) {
  .fullwidth .events-card-type .event__card, .inner .events-card-type .event__card {
    flex: none;
    max-width: none;
    width: 100%
  }
  .fullwidth .events-card-type .event__card:nth-of-type(2n), .fullwidth .events-card-type .event__card:nth-of-type(odd), .inner .events-card-type .event__card:nth-of-type(2n), .inner .events-card-type .event__card:nth-of-type(odd) {
    margin-left: 0;
    margin-right: 0
  }
  .fullwidth .statistics-blocks__block, .inner .statistics-blocks__block {
    flex: none;
    max-width: none;
    width: 100%;
    margin: 1rem 0
  }
  .fullwidth .statistics-blocks__block:nth-of-type(2n), .fullwidth .statistics-blocks__block:nth-of-type(odd), .inner .statistics-blocks__block:nth-of-type(2n), .inner .statistics-blocks__block:nth-of-type(odd) {
    margin-left: 0;
    margin-right: 0
  }
}
.align-baseline {
  vertical-align: baseline !important
}
.align-top {
  vertical-align: top !important
}
.align-middle {
  vertical-align: middle !important
}
.align-bottom {
  vertical-align: bottom !important
}
.align-text-bottom {
  vertical-align: text-bottom !important
}
.align-text-top {
  vertical-align: text-top !important
}
.bg-primary {
  background-color: #7e072a !important
}
a.bg-primary:focus, a.bg-primary:hover, button.bg-primary:focus, button.bg-primary:hover {
  background-color: #5d001a !important
}
.bg-secondary {
  background-color: #6c757d !important
}
a.bg-secondary:focus, a.bg-secondary:hover, button.bg-secondary:focus, button.bg-secondary:hover {
  background-color: #545b62 !important
}
.bg-success {
  background-color: #28a745 !important
}
a.bg-success:focus, a.bg-success:hover, button.bg-success:focus, button.bg-success:hover {
  background-color: #1e7e34 !important
}
.bg-info {
  background-color: #17a2b8 !important
}
a.bg-info:focus, a.bg-info:hover, button.bg-info:focus, button.bg-info:hover {
  background-color: #117a8b !important
}
.bg-warning {
  background-color: #ffdf00 !important
}
a.bg-warning:focus, a.bg-warning:hover, button.bg-warning:focus, button.bg-warning:hover {
  background-color: #ccb200 !important
}
.bg-danger {
  background-color: #7e072a !important
}
a.bg-danger:focus, a.bg-danger:hover, button.bg-danger:focus, button.bg-danger:hover {
  background-color: #5d001a !important
}
.bg-light {
  background-color: #f8f9fa !important
}
a.bg-light:focus, a.bg-light:hover, button.bg-light:focus, button.bg-light:hover {
  background-color: #dae0e5 !important
}
.bg-dark {
  background-color: #343a40 !important
}
a.bg-dark:focus, a.bg-dark:hover, button.bg-dark:focus, button.bg-dark:hover {
  background-color: #1d2124 !important
}
.bg-white {
  background-color: #fff !important
}
.bg-transparent {
  background-color: transparent !important
}
.border {
  border: 1px solid #dee2e6 !important
}
.border-top {
  border-top: 1px solid #dee2e6 !important
}
.border-right {
  border-right: 1px solid #dee2e6 !important
}
.border-bottom {
  border-bottom: 1px solid #dee2e6 !important
}
.border-left {
  border-left: 1px solid #dee2e6 !important
}
.border-0 {
  border: 0 !important
}
.border-top-0 {
  border-top: 0 !important
}
.border-right-0 {
  border-right: 0 !important
}
.border-bottom-0 {
  border-bottom: 0 !important
}
.border-left-0 {
  border-left: 0 !important
}
.border-primary {
  border-color: #7e072a !important
}
.border-secondary {
  border-color: #6c757d !important
}
.border-success {
  border-color: #28a745 !important
}
.border-info {
  border-color: #17a2b8 !important
}
.border-warning {
  border-color: #ffdf00 !important
}
.border-danger {
  border-color: #7e072a !important
}
.border-light {
  border-color: #f8f9fa !important
}
.border-dark {
  border-color: #343a40 !important
}
.border-white {
  border-color: #fff !important
}
.rounded-sm {
  border-radius: .2rem !important
}
.rounded {
  border-radius: 2px !important
}
.rounded-top {
  border-top-left-radius: 2px !important
}
.rounded-right, .rounded-top {
  border-top-right-radius: 2px !important
}
.rounded-bottom, .rounded-right {
  border-bottom-right-radius: 2px !important
}
.rounded-bottom, .rounded-left {
  border-bottom-left-radius: 2px !important
}
.rounded-left {
  border-top-left-radius: 2px !important
}
.rounded-lg {
  border-radius: .3rem !important
}
.rounded-circle {
  border-radius: 50% !important
}
.rounded-pill {
  border-radius: 50rem !important
}
.rounded-0 {
  border-radius: 0 !important
}
.clearfix:after {
  display: block;
  clear: both;
  content: ""
}
.d-none {
  display: none !important
}
.d-inline {
  display: inline !important
}
.d-inline-block {
  display: inline-block !important
}
.d-block {
  display: block !important
}
.d-table {
  display: table !important
}
.d-table-row {
  display: table-row !important
}
.d-table-cell {
  display: table-cell !important
}
.d-flex {
  display: flex !important
}
.d-inline-flex {
  display: inline-flex !important
}
@media (min-width:576px) {
  .d-sm-none {
    display: none !important
  }
  .d-sm-inline {
    display: inline !important
  }
  .d-sm-inline-block {
    display: inline-block !important
  }
  .d-sm-block {
    display: block !important
  }
  .d-sm-table {
    display: table !important
  }
  .d-sm-table-row {
    display: table-row !important
  }
  .d-sm-table-cell {
    display: table-cell !important
  }
  .d-sm-flex {
    display: flex !important
  }
  .d-sm-inline-flex {
    display: inline-flex !important
  }
}
@media (min-width:768px) {
  .d-md-none {
    display: none !important
  }
  .d-md-inline {
    display: inline !important
  }
  .d-md-inline-block {
    display: inline-block !important
  }
  .d-md-block {
    display: block !important
  }
  .d-md-table {
    display: table !important
  }
  .d-md-table-row {
    display: table-row !important
  }
  .d-md-table-cell {
    display: table-cell !important
  }
  .d-md-flex {
    display: flex !important
  }
  .d-md-inline-flex {
    display: inline-flex !important
  }
}
@media (min-width:992px) {
  .d-lg-none {
    display: none !important
  }
  .d-lg-inline {
    display: inline !important
  }
  .d-lg-inline-block {
    display: inline-block !important
  }
  .d-lg-block {
    display: block !important
  }
  .d-lg-table {
    display: table !important
  }
  .d-lg-table-row {
    display: table-row !important
  }
  .d-lg-table-cell {
    display: table-cell !important
  }
  .d-lg-flex {
    display: flex !important
  }
  .d-lg-inline-flex {
    display: inline-flex !important
  }
}
@media (min-width:1200px) {
  .d-xl-none {
    display: none !important
  }
  .d-xl-inline {
    display: inline !important
  }
  .d-xl-inline-block {
    display: inline-block !important
  }
  .d-xl-block {
    display: block !important
  }
  .d-xl-table {
    display: table !important
  }
  .d-xl-table-row {
    display: table-row !important
  }
  .d-xl-table-cell {
    display: table-cell !important
  }
  .d-xl-flex {
    display: flex !important
  }
  .d-xl-inline-flex {
    display: inline-flex !important
  }
}
@media print {
  .d-print-none {
    display: none !important
  }
  .d-print-inline {
    display: inline !important
  }
  .d-print-inline-block {
    display: inline-block !important
  }
  .d-print-block {
    display: block !important
  }
  .d-print-table {
    display: table !important
  }
  .d-print-table-row {
    display: table-row !important
  }
  .d-print-table-cell {
    display: table-cell !important
  }
  .d-print-flex {
    display: flex !important
  }
  .d-print-inline-flex {
    display: inline-flex !important
  }
}
.embed-responsive {
  position: relative;
  display: block;
  width: 100%;
  padding: 0;
  overflow: hidden
}
.embed-responsive:before {
  display: block;
  content: ""
}
.embed-responsive .embed-responsive-item, .embed-responsive embed, .embed-responsive iframe, .embed-responsive object, .embed-responsive video {
  position: absolute;
  top: 0;
  bottom: 0;
  left: 0;
  width: 100%;
  height: 100%;
  border: 0
}
.embed-responsive-21by9:before {
  padding-top: 42.8571428571%
}
.embed-responsive-16by9:before {
  padding-top: 56.25%
}
.embed-responsive-4by3:before {
  padding-top: 75%
}
.embed-responsive-1by1:before {
  padding-top: 100%
}
.flex-row {
  flex-direction: row !important
}
.flex-column {
  flex-direction: column !important
}
.flex-row-reverse {
  flex-direction: row-reverse !important
}
.flex-column-reverse {
  flex-direction: column-reverse !important
}
.flex-wrap {
  flex-wrap: wrap !important
}
.flex-nowrap {
  flex-wrap: nowrap !important
}
.flex-wrap-reverse {
  flex-wrap: wrap-reverse !important
}
.flex-fill {
  flex: 1 1 auto !important
}
.flex-grow-0 {
  flex-grow: 0 !important
}
.flex-grow-1 {
  flex-grow: 1 !important
}
.flex-shrink-0 {
  flex-shrink: 0 !important
}
.flex-shrink-1 {
  flex-shrink: 1 !important
}
.justify-content-start {
  justify-content: flex-start !important
}
.justify-content-end {
  justify-content: flex-end !important
}
.justify-content-center {
  justify-content: center !important
}
.justify-content-between {
  justify-content: space-between !important
}
.justify-content-around {
  justify-content: space-around !important
}
.align-items-start {
  align-items: flex-start !important
}
.align-items-end {
  align-items: flex-end !important
}
.align-items-center {
  align-items: center !important
}
.align-items-baseline {
  align-items: baseline !important
}
.align-items-stretch {
  align-items: stretch !important
}
.align-content-start {
  align-content: flex-start !important
}
.align-content-end {
  align-content: flex-end !important
}
.align-content-center {
  align-content: center !important
}
.align-content-between {
  align-content: space-between !important
}
.align-content-around {
  align-content: space-around !important
}
.align-content-stretch {
  align-content: stretch !important
}
.align-self-auto {
  align-self: auto !important
}
.align-self-start {
  align-self: flex-start !important
}
.align-self-end {
  align-self: flex-end !important
}
.align-self-center {
  align-self: center !important
}
.align-self-baseline {
  align-self: baseline !important
}
.align-self-stretch {
  align-self: stretch !important
}
@media (min-width:576px) {
  .flex-sm-row {
    flex-direction: row !important
  }
  .flex-sm-column {
    flex-direction: column !important
  }
  .flex-sm-row-reverse {
    flex-direction: row-reverse !important
  }
  .flex-sm-column-reverse {
    flex-direction: column-reverse !important
  }
  .flex-sm-wrap {
    flex-wrap: wrap !important
  }
  .flex-sm-nowrap {
    flex-wrap: nowrap !important
  }
  .flex-sm-wrap-reverse {
    flex-wrap: wrap-reverse !important
  }
  .flex-sm-fill {
    flex: 1 1 auto !important
  }
  .flex-sm-grow-0 {
    flex-grow: 0 !important
  }
  .flex-sm-grow-1 {
    flex-grow: 1 !important
  }
  .flex-sm-shrink-0 {
    flex-shrink: 0 !important
  }
  .flex-sm-shrink-1 {
    flex-shrink: 1 !important
  }
  .justify-content-sm-start {
    justify-content: flex-start !important
  }
  .justify-content-sm-end {
    justify-content: flex-end !important
  }
  .justify-content-sm-center {
    justify-content: center !important
  }
  .justify-content-sm-between {
    justify-content: space-between !important
  }
  .justify-content-sm-around {
    justify-content: space-around !important
  }
  .align-items-sm-start {
    align-items: flex-start !important
  }
  .align-items-sm-end {
    align-items: flex-end !important
  }
  .align-items-sm-center {
    align-items: center !important
  }
  .align-items-sm-baseline {
    align-items: baseline !important
  }
  .align-items-sm-stretch {
    align-items: stretch !important
  }
  .align-content-sm-start {
    align-content: flex-start !important
  }
  .align-content-sm-end {
    align-content: flex-end !important
  }
  .align-content-sm-center {
    align-content: center !important
  }
  .align-content-sm-between {
    align-content: space-between !important
  }
  .align-content-sm-around {
    align-content: space-around !important
  }
  .align-content-sm-stretch {
    align-content: stretch !important
  }
  .align-self-sm-auto {
    align-self: auto !important
  }
  .align-self-sm-start {
    align-self: flex-start !important
  }
  .align-self-sm-end {
    align-self: flex-end !important
  }
  .align-self-sm-center {
    align-self: center !important
  }
  .align-self-sm-baseline {
    align-self: baseline !important
  }
  .align-self-sm-stretch {
    align-self: stretch !important
  }
}
@media (min-width:768px) {
  .flex-md-row {
    flex-direction: row !important
  }
  .flex-md-column {
    flex-direction: column !important
  }
  .flex-md-row-reverse {
    flex-direction: row-reverse !important
  }
  .flex-md-column-reverse {
    flex-direction: column-reverse !important
  }
  .flex-md-wrap {
    flex-wrap: wrap !important
  }
  .flex-md-nowrap {
    flex-wrap: nowrap !important
  }
  .flex-md-wrap-reverse {
    flex-wrap: wrap-reverse !important
  }
  .flex-md-fill {
    flex: 1 1 auto !important
  }
  .flex-md-grow-0 {
    flex-grow: 0 !important
  }
  .flex-md-grow-1 {
    flex-grow: 1 !important
  }
  .flex-md-shrink-0 {
    flex-shrink: 0 !important
  }
  .flex-md-shrink-1 {
    flex-shrink: 1 !important
  }
  .justify-content-md-start {
    justify-content: flex-start !important
  }
  .justify-content-md-end {
    justify-content: flex-end !important
  }
  .justify-content-md-center {
    justify-content: center !important
  }
  .justify-content-md-between {
    justify-content: space-between !important
  }
  .justify-content-md-around {
    justify-content: space-around !important
  }
  .align-items-md-start {
    align-items: flex-start !important
  }
  .align-items-md-end {
    align-items: flex-end !important
  }
  .align-items-md-center {
    align-items: center !important
  }
  .align-items-md-baseline {
    align-items: baseline !important
  }
  .align-items-md-stretch {
    align-items: stretch !important
  }
  .align-content-md-start {
    align-content: flex-start !important
  }
  .align-content-md-end {
    align-content: flex-end !important
  }
  .align-content-md-center {
    align-content: center !important
  }
  .align-content-md-between {
    align-content: space-between !important
  }
  .align-content-md-around {
    align-content: space-around !important
  }
  .align-content-md-stretch {
    align-content: stretch !important
  }
  .align-self-md-auto {
    align-self: auto !important
  }
  .align-self-md-start {
    align-self: flex-start !important
  }
  .align-self-md-end {
    align-self: flex-end !important
  }
  .align-self-md-center {
    align-self: center !important
  }
  .align-self-md-baseline {
    align-self: baseline !important
  }
  .align-self-md-stretch {
    align-self: stretch !important
  }
}
@media (min-width:992px) {
  .flex-lg-row {
    flex-direction: row !important
  }
  .flex-lg-column {
    flex-direction: column !important
  }
  .flex-lg-row-reverse {
    flex-direction: row-reverse !important
  }
  .flex-lg-column-reverse {
    flex-direction: column-reverse !important
  }
  .flex-lg-wrap {
    flex-wrap: wrap !important
  }
  .flex-lg-nowrap {
    flex-wrap: nowrap !important
  }
  .flex-lg-wrap-reverse {
    flex-wrap: wrap-reverse !important
  }
  .flex-lg-fill {
    flex: 1 1 auto !important
  }
  .flex-lg-grow-0 {
    flex-grow: 0 !important
  }
  .flex-lg-grow-1 {
    flex-grow: 1 !important
  }
  .flex-lg-shrink-0 {
    flex-shrink: 0 !important
  }
  .flex-lg-shrink-1 {
    flex-shrink: 1 !important
  }
  .justify-content-lg-start {
    justify-content: flex-start !important
  }
  .justify-content-lg-end {
    justify-content: flex-end !important
  }
  .justify-content-lg-center {
    justify-content: center !important
  }
  .justify-content-lg-between {
    justify-content: space-between !important
  }
  .justify-content-lg-around {
    justify-content: space-around !important
  }
  .align-items-lg-start {
    align-items: flex-start !important
  }
  .align-items-lg-end {
    align-items: flex-end !important
  }
  .align-items-lg-center {
    align-items: center !important
  }
  .align-items-lg-baseline {
    align-items: baseline !important
  }
  .align-items-lg-stretch {
    align-items: stretch !important
  }
  .align-content-lg-start {
    align-content: flex-start !important
  }
  .align-content-lg-end {
    align-content: flex-end !important
  }
  .align-content-lg-center {
    align-content: center !important
  }
  .align-content-lg-between {
    align-content: space-between !important
  }
  .align-content-lg-around {
    align-content: space-around !important
  }
  .align-content-lg-stretch {
    align-content: stretch !important
  }
  .align-self-lg-auto {
    align-self: auto !important
  }
  .align-self-lg-start {
    align-self: flex-start !important
  }
  .align-self-lg-end {
    align-self: flex-end !important
  }
  .align-self-lg-center {
    align-self: center !important
  }
  .align-self-lg-baseline {
    align-self: baseline !important
  }
  .align-self-lg-stretch {
    align-self: stretch !important
  }
}
@media (min-width:1200px) {
  .flex-xl-row {
    flex-direction: row !important
  }
  .flex-xl-column {
    flex-direction: column !important
  }
  .flex-xl-row-reverse {
    flex-direction: row-reverse !important
  }
  .flex-xl-column-reverse {
    flex-direction: column-reverse !important
  }
  .flex-xl-wrap {
    flex-wrap: wrap !important
  }
  .flex-xl-nowrap {
    flex-wrap: nowrap !important
  }
  .flex-xl-wrap-reverse {
    flex-wrap: wrap-reverse !important
  }
  .flex-xl-fill {
    flex: 1 1 auto !important
  }
  .flex-xl-grow-0 {
    flex-grow: 0 !important
  }
  .flex-xl-grow-1 {
    flex-grow: 1 !important
  }
  .flex-xl-shrink-0 {
    flex-shrink: 0 !important
  }
  .flex-xl-shrink-1 {
    flex-shrink: 1 !important
  }
  .justify-content-xl-start {
    justify-content: flex-start !important
  }
  .justify-content-xl-end {
    justify-content: flex-end !important
  }
  .justify-content-xl-center {
    justify-content: center !important
  }
  .justify-content-xl-between {
    justify-content: space-between !important
  }
  .justify-content-xl-around {
    justify-content: space-around !important
  }
  .align-items-xl-start {
    align-items: flex-start !important
  }
  .align-items-xl-end {
    align-items: flex-end !important
  }
  .align-items-xl-center {
    align-items: center !important
  }
  .align-items-xl-baseline {
    align-items: baseline !important
  }
  .align-items-xl-stretch {
    align-items: stretch !important
  }
  .align-content-xl-start {
    align-content: flex-start !important
  }
  .align-content-xl-end {
    align-content: flex-end !important
  }
  .align-content-xl-center {
    align-content: center !important
  }
  .align-content-xl-between {
    align-content: space-between !important
  }
  .align-content-xl-around {
    align-content: space-around !important
  }
  .align-content-xl-stretch {
    align-content: stretch !important
  }
  .align-self-xl-auto {
    align-self: auto !important
  }
  .align-self-xl-start {
    align-self: flex-start !important
  }
  .align-self-xl-end {
    align-self: flex-end !important
  }
  .align-self-xl-center {
    align-self: center !important
  }
  .align-self-xl-baseline {
    align-self: baseline !important
  }
  .align-self-xl-stretch {
    align-self: stretch !important
  }
}
.float-left {
  float: left !important
}
.float-right {
  float: right !important
}
.float-none {
  float: none !important
}
@media (min-width:576px) {
  .float-sm-left {
    float: left !important
  }
  .float-sm-right {
    float: right !important
  }
  .float-sm-none {
    float: none !important
  }
}
@media (min-width:768px) {
  .float-md-left {
    float: left !important
  }
  .float-md-right {
    float: right !important
  }
  .float-md-none {
    float: none !important
  }
}
@media (min-width:992px) {
  .float-lg-left {
    float: left !important
  }
  .float-lg-right {
    float: right !important
  }
  .float-lg-none {
    float: none !important
  }
}
@media (min-width:1200px) {
  .float-xl-left {
    float: left !important
  }
  .float-xl-right {
    float: right !important
  }
  .float-xl-none {
    float: none !important
  }
}
.overflow-auto {
  overflow: auto !important
}
.overflow-hidden {
  overflow: hidden !important
}
.position-static {
  position: static !important
}
.position-relative {
  position: relative !important
}
.position-absolute {
  position: absolute !important
}
.position-fixed {
  position: fixed !important
}
.position-sticky {
  position: -webkit-sticky !important;
  position: sticky !important
}
.fixed-top {
  top: 0
}
.fixed-bottom, .fixed-top {
  position: fixed;
  right: 0;
  left: 0;
  z-index: 1030
}
.fixed-bottom {
  bottom: 0
}
@supports ((position:-webkit-sticky) or (position:sticky)) {
  .sticky-top {
    position: -webkit-sticky;
    position: sticky;
    top: 0;
    z-index: 1020
  }
}
.sr-only {
  position: absolute;
  width: 1px;
  height: 1px;
  padding: 0;
  margin: -1px;
  overflow: hidden;
  clip: rect(0, 0, 0, 0);
  white-space: nowrap;
  border: 0
}
.sr-only-focusable:active, .sr-only-focusable:focus {
  position: static;
  width: auto;
  height: auto;
  overflow: visible;
  clip: auto;
  white-space: normal
}
.shadow-sm {
  box-shadow: 0 .125rem .25rem rgba(51, 51, 51, .075) !important
}
.shadow {
  box-shadow: 0 .5rem 1rem rgba(51, 51, 51, .15) !important
}
.shadow-lg {
  box-shadow: 0 1rem 3rem rgba(51, 51, 51, .175) !important
}
.shadow-none {
  box-shadow: none !important
}
.w-25 {
  width: 25% !important
}
.w-50 {
  width: 50% !important
}
.w-75 {
  width: 75% !important
}
.w-100 {
  width: 100% !important
}
.w-auto {
  width: auto !important
}
.h-25 {
  height: 25% !important
}
.h-50 {
  height: 50% !important
}
.h-75 {
  height: 75% !important
}
.h-100 {
  height: 100% !important
}
.h-auto {
  height: auto !important
}
.mw-100 {
  max-width: 100% !important
}
.mh-100 {
  max-height: 100% !important
}
.min-vw-100 {
  min-width: 100vw !important
}
.min-vh-100 {
  min-height: 100vh !important
}
.vw-100 {
  width: 100vw !important
}
.vh-100 {
  height: 100vh !important
}
.stretched-link:after {
  position: absolute;
  top: 0;
  right: 0;
  bottom: 0;
  left: 0;
  z-index: 1;
  pointer-events: auto;
  content: "";
  background-color: transparent
}
.m-0 {
  margin: 0 !important
}
.mt-0, .my-0 {
  margin-top: 0 !important
}
.mr-0, .mx-0 {
  margin-right: 0 !important
}
.mb-0, .my-0 {
  margin-bottom: 0 !important
}
.ml-0, .mx-0 {
  margin-left: 0 !important
}
.m-1 {
  margin: .25rem !important
}
.mt-1, .my-1 {
  margin-top: .25rem !important
}
.mr-1, .mx-1 {
  margin-right: .25rem !important
}
.mb-1, .my-1 {
  margin-bottom: .25rem !important
}
.ml-1, .mx-1 {
  margin-left: .25rem !important
}
.m-2 {
  margin: .5rem !important
}
.mt-2, .my-2 {
  margin-top: .5rem !important
}
.mr-2, .mx-2 {
  margin-right: .5rem !important
}
.mb-2, .my-2 {
  margin-bottom: .5rem !important
}
.ml-2, .mx-2 {
  margin-left: .5rem !important
}
.m-3 {
  margin: 1rem !important
}
.mt-3, .my-3 {
  margin-top: 1rem !important
}
.mr-3, .mx-3 {
  margin-right: 1rem !important
}
.mb-3, .my-3 {
  margin-bottom: 1rem !important
}
.ml-3, .mx-3 {
  margin-left: 1rem !important
}
.m-4 {
  margin: 1.5rem !important
}
.mt-4, .my-4 {
  margin-top: 1.5rem !important
}
.mr-4, .mx-4 {
  margin-right: 1.5rem !important
}
.mb-4, .my-4 {
  margin-bottom: 1.5rem !important
}
.ml-4, .mx-4 {
  margin-left: 1.5rem !important
}
.m-5 {
  margin: 3rem !important
}
.mt-5, .my-5 {
  margin-top: 3rem !important
}
.mr-5, .mx-5 {
  margin-right: 3rem !important
}
.mb-5, .my-5 {
  margin-bottom: 3rem !important
}
.ml-5, .mx-5 {
  margin-left: 3rem !important
}
.p-0 {
  padding: 0 !important
}
.pt-0, .py-0 {
  padding-top: 0 !important
}
.pr-0, .px-0 {
  padding-right: 0 !important
}
.pb-0, .py-0 {
  padding-bottom: 0 !important
}
.pl-0, .px-0 {
  padding-left: 0 !important
}
.p-1 {
  padding: .25rem !important
}
.pt-1, .py-1 {
  padding-top: .25rem !important
}
.pr-1, .px-1 {
  padding-right: .25rem !important
}
.pb-1, .py-1 {
  padding-bottom: .25rem !important
}
.pl-1, .px-1 {
  padding-left: .25rem !important
}
.p-2 {
  padding: .5rem !important
}
.pt-2, .py-2 {
  padding-top: .5rem !important
}
.pr-2, .px-2 {
  padding-right: .5rem !important
}
.pb-2, .py-2 {
  padding-bottom: .5rem !important
}
.pl-2, .px-2 {
  padding-left: .5rem !important
}
.p-3 {
  padding: 1rem !important
}
.pt-3, .py-3 {
  padding-top: 1rem !important
}
.pr-3, .px-3 {
  padding-right: 1rem !important
}
.pb-3, .py-3 {
  padding-bottom: 1rem !important
}
.pl-3, .px-3 {
  padding-left: 1rem !important
}
.p-4 {
  padding: 1.5rem !important
}
.pt-4, .py-4 {
  padding-top: 1.5rem !important
}
.pr-4, .px-4 {
  padding-right: 1.5rem !important
}
.pb-4, .py-4 {
  padding-bottom: 1.5rem !important
}
.pl-4, .px-4 {
  padding-left: 1.5rem !important
}
.p-5 {
  padding: 3rem !important
}
.pt-5, .py-5 {
  padding-top: 3rem !important
}
.pr-5, .px-5 {
  padding-right: 3rem !important
}
.pb-5, .py-5 {
  padding-bottom: 3rem !important
}
.pl-5, .px-5 {
  padding-left: 3rem !important
}
.m-n1 {
  margin: -.25rem !important
}
.mt-n1, .my-n1 {
  margin-top: -.25rem !important
}
.mr-n1, .mx-n1 {
  margin-right: -.25rem !important
}
.mb-n1, .my-n1 {
  margin-bottom: -.25rem !important
}
.ml-n1, .mx-n1 {
  margin-left: -.25rem !important
}
.m-n2 {
  margin: -.5rem !important
}
.mt-n2, .my-n2 {
  margin-top: -.5rem !important
}
.mr-n2, .mx-n2 {
  margin-right: -.5rem !important
}
.mb-n2, .my-n2 {
  margin-bottom: -.5rem !important
}
.ml-n2, .mx-n2 {
  margin-left: -.5rem !important
}
.m-n3 {
  margin: -1rem !important
}
.mt-n3, .my-n3 {
  margin-top: -1rem !important
}
.mr-n3, .mx-n3 {
  margin-right: -1rem !important
}
.mb-n3, .my-n3 {
  margin-bottom: -1rem !important
}
.ml-n3, .mx-n3 {
  margin-left: -1rem !important
}
.m-n4 {
  margin: -1.5rem !important
}
.mt-n4, .my-n4 {
  margin-top: -1.5rem !important
}
.mr-n4, .mx-n4 {
  margin-right: -1.5rem !important
}
.mb-n4, .my-n4 {
  margin-bottom: -1.5rem !important
}
.ml-n4, .mx-n4 {
  margin-left: -1.5rem !important
}
.m-n5 {
  margin: -3rem !important
}
.mt-n5, .my-n5 {
  margin-top: -3rem !important
}
.mr-n5, .mx-n5 {
  margin-right: -3rem !important
}
.mb-n5, .my-n5 {
  margin-bottom: -3rem !important
}
.ml-n5, .mx-n5 {
  margin-left: -3rem !important
}
.m-auto {
  margin: auto !important
}
.mt-auto, .my-auto {
  margin-top: auto !important
}
.mr-auto, .mx-auto {
  margin-right: auto !important
}
.mb-auto, .my-auto {
  margin-bottom: auto !important
}
.ml-auto, .mx-auto {
  margin-left: auto !important
}
@media (min-width:576px) {
  .m-sm-0 {
    margin: 0 !important
  }
  .mt-sm-0, .my-sm-0 {
    margin-top: 0 !important
  }
  .mr-sm-0, .mx-sm-0 {
    margin-right: 0 !important
  }
  .mb-sm-0, .my-sm-0 {
    margin-bottom: 0 !important
  }
  .ml-sm-0, .mx-sm-0 {
    margin-left: 0 !important
  }
  .m-sm-1 {
    margin: .25rem !important
  }
  .mt-sm-1, .my-sm-1 {
    margin-top: .25rem !important
  }
  .mr-sm-1, .mx-sm-1 {
    margin-right: .25rem !important
  }
  .mb-sm-1, .my-sm-1 {
    margin-bottom: .25rem !important
  }
  .ml-sm-1, .mx-sm-1 {
    margin-left: .25rem !important
  }
  .m-sm-2 {
    margin: .5rem !important
  }
  .mt-sm-2, .my-sm-2 {
    margin-top: .5rem !important
  }
  .mr-sm-2, .mx-sm-2 {
    margin-right: .5rem !important
  }
  .mb-sm-2, .my-sm-2 {
    margin-bottom: .5rem !important
  }
  .ml-sm-2, .mx-sm-2 {
    margin-left: .5rem !important
  }
  .m-sm-3 {
    margin: 1rem !important
  }
  .mt-sm-3, .my-sm-3 {
    margin-top: 1rem !important
  }
  .mr-sm-3, .mx-sm-3 {
    margin-right: 1rem !important
  }
  .mb-sm-3, .my-sm-3 {
    margin-bottom: 1rem !important
  }
  .ml-sm-3, .mx-sm-3 {
    margin-left: 1rem !important
  }
  .m-sm-4 {
    margin: 1.5rem !important
  }
  .mt-sm-4, .my-sm-4 {
    margin-top: 1.5rem !important
  }
  .mr-sm-4, .mx-sm-4 {
    margin-right: 1.5rem !important
  }
  .mb-sm-4, .my-sm-4 {
    margin-bottom: 1.5rem !important
  }
  .ml-sm-4, .mx-sm-4 {
    margin-left: 1.5rem !important
  }
  .m-sm-5 {
    margin: 3rem !important
  }
  .mt-sm-5, .my-sm-5 {
    margin-top: 3rem !important
  }
  .mr-sm-5, .mx-sm-5 {
    margin-right: 3rem !important
  }
  .mb-sm-5, .my-sm-5 {
    margin-bottom: 3rem !important
  }
  .ml-sm-5, .mx-sm-5 {
    margin-left: 3rem !important
  }
  .p-sm-0 {
    padding: 0 !important
  }
  .pt-sm-0, .py-sm-0 {
    padding-top: 0 !important
  }
  .pr-sm-0, .px-sm-0 {
    padding-right: 0 !important
  }
  .pb-sm-0, .py-sm-0 {
    padding-bottom: 0 !important
  }
  .pl-sm-0, .px-sm-0 {
    padding-left: 0 !important
  }
  .p-sm-1 {
    padding: .25rem !important
  }
  .pt-sm-1, .py-sm-1 {
    padding-top: .25rem !important
  }
  .pr-sm-1, .px-sm-1 {
    padding-right: .25rem !important
  }
  .pb-sm-1, .py-sm-1 {
    padding-bottom: .25rem !important
  }
  .pl-sm-1, .px-sm-1 {
    padding-left: .25rem !important
  }
  .p-sm-2 {
    padding: .5rem !important
  }
  .pt-sm-2, .py-sm-2 {
    padding-top: .5rem !important
  }
  .pr-sm-2, .px-sm-2 {
    padding-right: .5rem !important
  }
  .pb-sm-2, .py-sm-2 {
    padding-bottom: .5rem !important
  }
  .pl-sm-2, .px-sm-2 {
    padding-left: .5rem !important
  }
  .p-sm-3 {
    padding: 1rem !important
  }
  .pt-sm-3, .py-sm-3 {
    padding-top: 1rem !important
  }
  .pr-sm-3, .px-sm-3 {
    padding-right: 1rem !important
  }
  .pb-sm-3, .py-sm-3 {
    padding-bottom: 1rem !important
  }
  .pl-sm-3, .px-sm-3 {
    padding-left: 1rem !important
  }
  .p-sm-4 {
    padding: 1.5rem !important
  }
  .pt-sm-4, .py-sm-4 {
    padding-top: 1.5rem !important
  }
  .pr-sm-4, .px-sm-4 {
    padding-right: 1.5rem !important
  }
  .pb-sm-4, .py-sm-4 {
    padding-bottom: 1.5rem !important
  }
  .pl-sm-4, .px-sm-4 {
    padding-left: 1.5rem !important
  }
  .p-sm-5 {
    padding: 3rem !important
  }
  .pt-sm-5, .py-sm-5 {
    padding-top: 3rem !important
  }
  .pr-sm-5, .px-sm-5 {
    padding-right: 3rem !important
  }
  .pb-sm-5, .py-sm-5 {
    padding-bottom: 3rem !important
  }
  .pl-sm-5, .px-sm-5 {
    padding-left: 3rem !important
  }
  .m-sm-n1 {
    margin: -.25rem !important
  }
  .mt-sm-n1, .my-sm-n1 {
    margin-top: -.25rem !important
  }
  .mr-sm-n1, .mx-sm-n1 {
    margin-right: -.25rem !important
  }
  .mb-sm-n1, .my-sm-n1 {
    margin-bottom: -.25rem !important
  }
  .ml-sm-n1, .mx-sm-n1 {
    margin-left: -.25rem !important
  }
  .m-sm-n2 {
    margin: -.5rem !important
  }
  .mt-sm-n2, .my-sm-n2 {
    margin-top: -.5rem !important
  }
  .mr-sm-n2, .mx-sm-n2 {
    margin-right: -.5rem !important
  }
  .mb-sm-n2, .my-sm-n2 {
    margin-bottom: -.5rem !important
  }
  .ml-sm-n2, .mx-sm-n2 {
    margin-left: -.5rem !important
  }
  .m-sm-n3 {
    margin: -1rem !important
  }
  .mt-sm-n3, .my-sm-n3 {
    margin-top: -1rem !important
  }
  .mr-sm-n3, .mx-sm-n3 {
    margin-right: -1rem !important
  }
  .mb-sm-n3, .my-sm-n3 {
    margin-bottom: -1rem !important
  }
  .ml-sm-n3, .mx-sm-n3 {
    margin-left: -1rem !important
  }
  .m-sm-n4 {
    margin: -1.5rem !important
  }
  .mt-sm-n4, .my-sm-n4 {
    margin-top: -1.5rem !important
  }
  .mr-sm-n4, .mx-sm-n4 {
    margin-right: -1.5rem !important
  }
  .mb-sm-n4, .my-sm-n4 {
    margin-bottom: -1.5rem !important
  }
  .ml-sm-n4, .mx-sm-n4 {
    margin-left: -1.5rem !important
  }
  .m-sm-n5 {
    margin: -3rem !important
  }
  .mt-sm-n5, .my-sm-n5 {
    margin-top: -3rem !important
  }
  .mr-sm-n5, .mx-sm-n5 {
    margin-right: -3rem !important
  }
  .mb-sm-n5, .my-sm-n5 {
    margin-bottom: -3rem !important
  }
  .ml-sm-n5, .mx-sm-n5 {
    margin-left: -3rem !important
  }
  .m-sm-auto {
    margin: auto !important
  }
  .mt-sm-auto, .my-sm-auto {
    margin-top: auto !important
  }
  .mr-sm-auto, .mx-sm-auto {
    margin-right: auto !important
  }
  .mb-sm-auto, .my-sm-auto {
    margin-bottom: auto !important
  }
  .ml-sm-auto, .mx-sm-auto {
    margin-left: auto !important
  }
}
@media (min-width:768px) {
  .m-md-0 {
    margin: 0 !important
  }
  .mt-md-0, .my-md-0 {
    margin-top: 0 !important
  }
  .mr-md-0, .mx-md-0 {
    margin-right: 0 !important
  }
  .mb-md-0, .my-md-0 {
    margin-bottom: 0 !important
  }
  .ml-md-0, .mx-md-0 {
    margin-left: 0 !important
  }
  .m-md-1 {
    margin: .25rem !important
  }
  .mt-md-1, .my-md-1 {
    margin-top: .25rem !important
  }
  .mr-md-1, .mx-md-1 {
    margin-right: .25rem !important
  }
  .mb-md-1, .my-md-1 {
    margin-bottom: .25rem !important
  }
  .ml-md-1, .mx-md-1 {
    margin-left: .25rem !important
  }
  .m-md-2 {
    margin: .5rem !important
  }
  .mt-md-2, .my-md-2 {
    margin-top: .5rem !important
  }
  .mr-md-2, .mx-md-2 {
    margin-right: .5rem !important
  }
  .mb-md-2, .my-md-2 {
    margin-bottom: .5rem !important
  }
  .ml-md-2, .mx-md-2 {
    margin-left: .5rem !important
  }
  .m-md-3 {
    margin: 1rem !important
  }
  .mt-md-3, .my-md-3 {
    margin-top: 1rem !important
  }
  .mr-md-3, .mx-md-3 {
    margin-right: 1rem !important
  }
  .mb-md-3, .my-md-3 {
    margin-bottom: 1rem !important
  }
  .ml-md-3, .mx-md-3 {
    margin-left: 1rem !important
  }
  .m-md-4 {
    margin: 1.5rem !important
  }
  .mt-md-4, .my-md-4 {
    margin-top: 1.5rem !important
  }
  .mr-md-4, .mx-md-4 {
    margin-right: 1.5rem !important
  }
  .mb-md-4, .my-md-4 {
    margin-bottom: 1.5rem !important
  }
  .ml-md-4, .mx-md-4 {
    margin-left: 1.5rem !important
  }
  .m-md-5 {
    margin: 3rem !important
  }
  .mt-md-5, .my-md-5 {
    margin-top: 3rem !important
  }
  .mr-md-5, .mx-md-5 {
    margin-right: 3rem !important
  }
  .mb-md-5, .my-md-5 {
    margin-bottom: 3rem !important
  }
  .ml-md-5, .mx-md-5 {
    margin-left: 3rem !important
  }
  .p-md-0 {
    padding: 0 !important
  }
  .pt-md-0, .py-md-0 {
    padding-top: 0 !important
  }
  .pr-md-0, .px-md-0 {
    padding-right: 0 !important
  }
  .pb-md-0, .py-md-0 {
    padding-bottom: 0 !important
  }
  .pl-md-0, .px-md-0 {
    padding-left: 0 !important
  }
  .p-md-1 {
    padding: .25rem !important
  }
  .pt-md-1, .py-md-1 {
    padding-top: .25rem !important
  }
  .pr-md-1, .px-md-1 {
    padding-right: .25rem !important
  }
  .pb-md-1, .py-md-1 {
    padding-bottom: .25rem !important
  }
  .pl-md-1, .px-md-1 {
    padding-left: .25rem !important
  }
  .p-md-2 {
    padding: .5rem !important
  }
  .pt-md-2, .py-md-2 {
    padding-top: .5rem !important
  }
  .pr-md-2, .px-md-2 {
    padding-right: .5rem !important
  }
  .pb-md-2, .py-md-2 {
    padding-bottom: .5rem !important
  }
  .pl-md-2, .px-md-2 {
    padding-left: .5rem !important
  }
  .p-md-3 {
    padding: 1rem !important
  }
  .pt-md-3, .py-md-3 {
    padding-top: 1rem !important
  }
  .pr-md-3, .px-md-3 {
    padding-right: 1rem !important
  }
  .pb-md-3, .py-md-3 {
    padding-bottom: 1rem !important
  }
  .pl-md-3, .px-md-3 {
    padding-left: 1rem !important
  }
  .p-md-4 {
    padding: 1.5rem !important
  }
  .pt-md-4, .py-md-4 {
    padding-top: 1.5rem !important
  }
  .pr-md-4, .px-md-4 {
    padding-right: 1.5rem !important
  }
  .pb-md-4, .py-md-4 {
    padding-bottom: 1.5rem !important
  }
  .pl-md-4, .px-md-4 {
    padding-left: 1.5rem !important
  }
  .p-md-5 {
    padding: 3rem !important
  }
  .pt-md-5, .py-md-5 {
    padding-top: 3rem !important
  }
  .pr-md-5, .px-md-5 {
    padding-right: 3rem !important
  }
  .pb-md-5, .py-md-5 {
    padding-bottom: 3rem !important
  }
  .pl-md-5, .px-md-5 {
    padding-left: 3rem !important
  }
  .m-md-n1 {
    margin: -.25rem !important
  }
  .mt-md-n1, .my-md-n1 {
    margin-top: -.25rem !important
  }
  .mr-md-n1, .mx-md-n1 {
    margin-right: -.25rem !important
  }
  .mb-md-n1, .my-md-n1 {
    margin-bottom: -.25rem !important
  }
  .ml-md-n1, .mx-md-n1 {
    margin-left: -.25rem !important
  }
  .m-md-n2 {
    margin: -.5rem !important
  }
  .mt-md-n2, .my-md-n2 {
    margin-top: -.5rem !important
  }
  .mr-md-n2, .mx-md-n2 {
    margin-right: -.5rem !important
  }
  .mb-md-n2, .my-md-n2 {
    margin-bottom: -.5rem !important
  }
  .ml-md-n2, .mx-md-n2 {
    margin-left: -.5rem !important
  }
  .m-md-n3 {
    margin: -1rem !important
  }
  .mt-md-n3, .my-md-n3 {
    margin-top: -1rem !important
  }
  .mr-md-n3, .mx-md-n3 {
    margin-right: -1rem !important
  }
  .mb-md-n3, .my-md-n3 {
    margin-bottom: -1rem !important
  }
  .ml-md-n3, .mx-md-n3 {
    margin-left: -1rem !important
  }
  .m-md-n4 {
    margin: -1.5rem !important
  }
  .mt-md-n4, .my-md-n4 {
    margin-top: -1.5rem !important
  }
  .mr-md-n4, .mx-md-n4 {
    margin-right: -1.5rem !important
  }
  .mb-md-n4, .my-md-n4 {
    margin-bottom: -1.5rem !important
  }
  .ml-md-n4, .mx-md-n4 {
    margin-left: -1.5rem !important
  }
  .m-md-n5 {
    margin: -3rem !important
  }
  .mt-md-n5, .my-md-n5 {
    margin-top: -3rem !important
  }
  .mr-md-n5, .mx-md-n5 {
    margin-right: -3rem !important
  }
  .mb-md-n5, .my-md-n5 {
    margin-bottom: -3rem !important
  }
  .ml-md-n5, .mx-md-n5 {
    margin-left: -3rem !important
  }
  .m-md-auto {
    margin: auto !important
  }
  .mt-md-auto, .my-md-auto {
    margin-top: auto !important
  }
  .mr-md-auto, .mx-md-auto {
    margin-right: auto !important
  }
  .mb-md-auto, .my-md-auto {
    margin-bottom: auto !important
  }
  .ml-md-auto, .mx-md-auto {
    margin-left: auto !important
  }
}
@media (min-width:992px) {
  .m-lg-0 {
    margin: 0 !important
  }
  .mt-lg-0, .my-lg-0 {
    margin-top: 0 !important
  }
  .mr-lg-0, .mx-lg-0 {
    margin-right: 0 !important
  }
  .mb-lg-0, .my-lg-0 {
    margin-bottom: 0 !important
  }
  .ml-lg-0, .mx-lg-0 {
    margin-left: 0 !important
  }
  .m-lg-1 {
    margin: .25rem !important
  }
  .mt-lg-1, .my-lg-1 {
    margin-top: .25rem !important
  }
  .mr-lg-1, .mx-lg-1 {
    margin-right: .25rem !important
  }
  .mb-lg-1, .my-lg-1 {
    margin-bottom: .25rem !important
  }
  .ml-lg-1, .mx-lg-1 {
    margin-left: .25rem !important
  }
  .m-lg-2 {
    margin: .5rem !important
  }
  .mt-lg-2, .my-lg-2 {
    margin-top: .5rem !important
  }
  .mr-lg-2, .mx-lg-2 {
    margin-right: .5rem !important
  }
  .mb-lg-2, .my-lg-2 {
    margin-bottom: .5rem !important
  }
  .ml-lg-2, .mx-lg-2 {
    margin-left: .5rem !important
  }
  .m-lg-3 {
    margin: 1rem !important
  }
  .mt-lg-3, .my-lg-3 {
    margin-top: 1rem !important
  }
  .mr-lg-3, .mx-lg-3 {
    margin-right: 1rem !important
  }
  .mb-lg-3, .my-lg-3 {
    margin-bottom: 1rem !important
  }
  .ml-lg-3, .mx-lg-3 {
    margin-left: 1rem !important
  }
  .m-lg-4 {
    margin: 1.5rem !important
  }
  .mt-lg-4, .my-lg-4 {
    margin-top: 1.5rem !important
  }
  .mr-lg-4, .mx-lg-4 {
    margin-right: 1.5rem !important
  }
  .mb-lg-4, .my-lg-4 {
    margin-bottom: 1.5rem !important
  }
  .ml-lg-4, .mx-lg-4 {
    margin-left: 1.5rem !important
  }
  .m-lg-5 {
    margin: 3rem !important
  }
  .mt-lg-5, .my-lg-5 {
    margin-top: 3rem !important
  }
  .mr-lg-5, .mx-lg-5 {
    margin-right: 3rem !important
  }
  .mb-lg-5, .my-lg-5 {
    margin-bottom: 3rem !important
  }
  .ml-lg-5, .mx-lg-5 {
    margin-left: 3rem !important
  }
  .p-lg-0 {
    padding: 0 !important
  }
  .pt-lg-0, .py-lg-0 {
    padding-top: 0 !important
  }
  .pr-lg-0, .px-lg-0 {
    padding-right: 0 !important
  }
  .pb-lg-0, .py-lg-0 {
    padding-bottom: 0 !important
  }
  .pl-lg-0, .px-lg-0 {
    padding-left: 0 !important
  }
  .p-lg-1 {
    padding: .25rem !important
  }
  .pt-lg-1, .py-lg-1 {
    padding-top: .25rem !important
  }
  .pr-lg-1, .px-lg-1 {
    padding-right: .25rem !important
  }
  .pb-lg-1, .py-lg-1 {
    padding-bottom: .25rem !important
  }
  .pl-lg-1, .px-lg-1 {
    padding-left: .25rem !important
  }
  .p-lg-2 {
    padding: .5rem !important
  }
  .pt-lg-2, .py-lg-2 {
    padding-top: .5rem !important
  }
  .pr-lg-2, .px-lg-2 {
    padding-right: .5rem !important
  }
  .pb-lg-2, .py-lg-2 {
    padding-bottom: .5rem !important
  }
  .pl-lg-2, .px-lg-2 {
    padding-left: .5rem !important
  }
  .p-lg-3 {
    padding: 1rem !important
  }
  .pt-lg-3, .py-lg-3 {
    padding-top: 1rem !important
  }
  .pr-lg-3, .px-lg-3 {
    padding-right: 1rem !important
  }
  .pb-lg-3, .py-lg-3 {
    padding-bottom: 1rem !important
  }
  .pl-lg-3, .px-lg-3 {
    padding-left: 1rem !important
  }
  .p-lg-4 {
    padding: 1.5rem !important
  }
  .pt-lg-4, .py-lg-4 {
    padding-top: 1.5rem !important
  }
  .pr-lg-4, .px-lg-4 {
    padding-right: 1.5rem !important
  }
  .pb-lg-4, .py-lg-4 {
    padding-bottom: 1.5rem !important
  }
  .pl-lg-4, .px-lg-4 {
    padding-left: 1.5rem !important
  }
  .p-lg-5 {
    padding: 3rem !important
  }
  .pt-lg-5, .py-lg-5 {
    padding-top: 3rem !important
  }
  .pr-lg-5, .px-lg-5 {
    padding-right: 3rem !important
  }
  .pb-lg-5, .py-lg-5 {
    padding-bottom: 3rem !important
  }
  .pl-lg-5, .px-lg-5 {
    padding-left: 3rem !important
  }
  .m-lg-n1 {
    margin: -.25rem !important
  }
  .mt-lg-n1, .my-lg-n1 {
    margin-top: -.25rem !important
  }
  .mr-lg-n1, .mx-lg-n1 {
    margin-right: -.25rem !important
  }
  .mb-lg-n1, .my-lg-n1 {
    margin-bottom: -.25rem !important
  }
  .ml-lg-n1, .mx-lg-n1 {
    margin-left: -.25rem !important
  }
  .m-lg-n2 {
    margin: -.5rem !important
  }
  .mt-lg-n2, .my-lg-n2 {
    margin-top: -.5rem !important
  }
  .mr-lg-n2, .mx-lg-n2 {
    margin-right: -.5rem !important
  }
  .mb-lg-n2, .my-lg-n2 {
    margin-bottom: -.5rem !important
  }
  .ml-lg-n2, .mx-lg-n2 {
    margin-left: -.5rem !important
  }
  .m-lg-n3 {
    margin: -1rem !important
  }
  .mt-lg-n3, .my-lg-n3 {
    margin-top: -1rem !important
  }
  .mr-lg-n3, .mx-lg-n3 {
    margin-right: -1rem !important
  }
  .mb-lg-n3, .my-lg-n3 {
    margin-bottom: -1rem !important
  }
  .ml-lg-n3, .mx-lg-n3 {
    margin-left: -1rem !important
  }
  .m-lg-n4 {
    margin: -1.5rem !important
  }
  .mt-lg-n4, .my-lg-n4 {
    margin-top: -1.5rem !important
  }
  .mr-lg-n4, .mx-lg-n4 {
    margin-right: -1.5rem !important
  }
  .mb-lg-n4, .my-lg-n4 {
    margin-bottom: -1.5rem !important
  }
  .ml-lg-n4, .mx-lg-n4 {
    margin-left: -1.5rem !important
  }
  .m-lg-n5 {
    margin: -3rem !important
  }
  .mt-lg-n5, .my-lg-n5 {
    margin-top: -3rem !important
  }
  .mr-lg-n5, .mx-lg-n5 {
    margin-right: -3rem !important
  }
  .mb-lg-n5, .my-lg-n5 {
    margin-bottom: -3rem !important
  }
  .ml-lg-n5, .mx-lg-n5 {
    margin-left: -3rem !important
  }
  .m-lg-auto {
    margin: auto !important
  }
  .mt-lg-auto, .my-lg-auto {
    margin-top: auto !important
  }
  .mr-lg-auto, .mx-lg-auto {
    margin-right: auto !important
  }
  .mb-lg-auto, .my-lg-auto {
    margin-bottom: auto !important
  }
  .ml-lg-auto, .mx-lg-auto {
    margin-left: auto !important
  }
}
@media (min-width:1200px) {
  .m-xl-0 {
    margin: 0 !important
  }
  .mt-xl-0, .my-xl-0 {
    margin-top: 0 !important
  }
  .mr-xl-0, .mx-xl-0 {
    margin-right: 0 !important
  }
  .mb-xl-0, .my-xl-0 {
    margin-bottom: 0 !important
  }
  .ml-xl-0, .mx-xl-0 {
    margin-left: 0 !important
  }
  .m-xl-1 {
    margin: .25rem !important
  }
  .mt-xl-1, .my-xl-1 {
    margin-top: .25rem !important
  }
  .mr-xl-1, .mx-xl-1 {
    margin-right: .25rem !important
  }
  .mb-xl-1, .my-xl-1 {
    margin-bottom: .25rem !important
  }
  .ml-xl-1, .mx-xl-1 {
    margin-left: .25rem !important
  }
  .m-xl-2 {
    margin: .5rem !important
  }
  .mt-xl-2, .my-xl-2 {
    margin-top: .5rem !important
  }
  .mr-xl-2, .mx-xl-2 {
    margin-right: .5rem !important
  }
  .mb-xl-2, .my-xl-2 {
    margin-bottom: .5rem !important
  }
  .ml-xl-2, .mx-xl-2 {
    margin-left: .5rem !important
  }
  .m-xl-3 {
    margin: 1rem !important
  }
  .mt-xl-3, .my-xl-3 {
    margin-top: 1rem !important
  }
  .mr-xl-3, .mx-xl-3 {
    margin-right: 1rem !important
  }
  .mb-xl-3, .my-xl-3 {
    margin-bottom: 1rem !important
  }
  .ml-xl-3, .mx-xl-3 {
    margin-left: 1rem !important
  }
  .m-xl-4 {
    margin: 1.5rem !important
  }
  .mt-xl-4, .my-xl-4 {
    margin-top: 1.5rem !important
  }
  .mr-xl-4, .mx-xl-4 {
    margin-right: 1.5rem !important
  }
  .mb-xl-4, .my-xl-4 {
    margin-bottom: 1.5rem !important
  }
  .ml-xl-4, .mx-xl-4 {
    margin-left: 1.5rem !important
  }
  .m-xl-5 {
    margin: 3rem !important
  }
  .mt-xl-5, .my-xl-5 {
    margin-top: 3rem !important
  }
  .mr-xl-5, .mx-xl-5 {
    margin-right: 3rem !important
  }
  .mb-xl-5, .my-xl-5 {
    margin-bottom: 3rem !important
  }
  .ml-xl-5, .mx-xl-5 {
    margin-left: 3rem !important
  }
  .p-xl-0 {
    padding: 0 !important
  }
  .pt-xl-0, .py-xl-0 {
    padding-top: 0 !important
  }
  .pr-xl-0, .px-xl-0 {
    padding-right: 0 !important
  }
  .pb-xl-0, .py-xl-0 {
    padding-bottom: 0 !important
  }
  .pl-xl-0, .px-xl-0 {
    padding-left: 0 !important
  }
  .p-xl-1 {
    padding: .25rem !important
  }
  .pt-xl-1, .py-xl-1 {
    padding-top: .25rem !important
  }
  .pr-xl-1, .px-xl-1 {
    padding-right: .25rem !important
  }
  .pb-xl-1, .py-xl-1 {
    padding-bottom: .25rem !important
  }
  .pl-xl-1, .px-xl-1 {
    padding-left: .25rem !important
  }
  .p-xl-2 {
    padding: .5rem !important
  }
  .pt-xl-2, .py-xl-2 {
    padding-top: .5rem !important
  }
  .pr-xl-2, .px-xl-2 {
    padding-right: .5rem !important
  }
  .pb-xl-2, .py-xl-2 {
    padding-bottom: .5rem !important
  }
  .pl-xl-2, .px-xl-2 {
    padding-left: .5rem !important
  }
  .p-xl-3 {
    padding: 1rem !important
  }
  .pt-xl-3, .py-xl-3 {
    padding-top: 1rem !important
  }
  .pr-xl-3, .px-xl-3 {
    padding-right: 1rem !important
  }
  .pb-xl-3, .py-xl-3 {
    padding-bottom: 1rem !important
  }
  .pl-xl-3, .px-xl-3 {
    padding-left: 1rem !important
  }
  .p-xl-4 {
    padding: 1.5rem !important
  }
  .pt-xl-4, .py-xl-4 {
    padding-top: 1.5rem !important
  }
  .pr-xl-4, .px-xl-4 {
    padding-right: 1.5rem !important
  }
  .pb-xl-4, .py-xl-4 {
    padding-bottom: 1.5rem !important
  }
  .pl-xl-4, .px-xl-4 {
    padding-left: 1.5rem !important
  }
  .p-xl-5 {
    padding: 3rem !important
  }
  .pt-xl-5, .py-xl-5 {
    padding-top: 3rem !important
  }
  .pr-xl-5, .px-xl-5 {
    padding-right: 3rem !important
  }
  .pb-xl-5, .py-xl-5 {
    padding-bottom: 3rem !important
  }
  .pl-xl-5, .px-xl-5 {
    padding-left: 3rem !important
  }
  .m-xl-n1 {
    margin: -.25rem !important
  }
  .mt-xl-n1, .my-xl-n1 {
    margin-top: -.25rem !important
  }
  .mr-xl-n1, .mx-xl-n1 {
    margin-right: -.25rem !important
  }
  .mb-xl-n1, .my-xl-n1 {
    margin-bottom: -.25rem !important
  }
  .ml-xl-n1, .mx-xl-n1 {
    margin-left: -.25rem !important
  }
  .m-xl-n2 {
    margin: -.5rem !important
  }
  .mt-xl-n2, .my-xl-n2 {
    margin-top: -.5rem !important
  }
  .mr-xl-n2, .mx-xl-n2 {
    margin-right: -.5rem !important
  }
  .mb-xl-n2, .my-xl-n2 {
    margin-bottom: -.5rem !important
  }
  .ml-xl-n2, .mx-xl-n2 {
    margin-left: -.5rem !important
  }
  .m-xl-n3 {
    margin: -1rem !important
  }
  .mt-xl-n3, .my-xl-n3 {
    margin-top: -1rem !important
  }
  .mr-xl-n3, .mx-xl-n3 {
    margin-right: -1rem !important
  }
  .mb-xl-n3, .my-xl-n3 {
    margin-bottom: -1rem !important
  }
  .ml-xl-n3, .mx-xl-n3 {
    margin-left: -1rem !important
  }
  .m-xl-n4 {
    margin: -1.5rem !important
  }
  .mt-xl-n4, .my-xl-n4 {
    margin-top: -1.5rem !important
  }
  .mr-xl-n4, .mx-xl-n4 {
    margin-right: -1.5rem !important
  }
  .mb-xl-n4, .my-xl-n4 {
    margin-bottom: -1.5rem !important
  }
  .ml-xl-n4, .mx-xl-n4 {
    margin-left: -1.5rem !important
  }
  .m-xl-n5 {
    margin: -3rem !important
  }
  .mt-xl-n5, .my-xl-n5 {
    margin-top: -3rem !important
  }
  .mr-xl-n5, .mx-xl-n5 {
    margin-right: -3rem !important
  }
  .mb-xl-n5, .my-xl-n5 {
    margin-bottom: -3rem !important
  }
  .ml-xl-n5, .mx-xl-n5 {
    margin-left: -3rem !important
  }
  .m-xl-auto {
    margin: auto !important
  }
  .mt-xl-auto, .my-xl-auto {
    margin-top: auto !important
  }
  .mr-xl-auto, .mx-xl-auto {
    margin-right: auto !important
  }
  .mb-xl-auto, .my-xl-auto {
    margin-bottom: auto !important
  }
  .ml-xl-auto, .mx-xl-auto {
    margin-left: auto !important
  }
}
.text-monospace {
  font-family: SFMono-Regular, Menlo, Monaco, Consolas, Liberation Mono, Courier New, monospace !important
}
.text-justify {
  text-align: justify !important
}
.text-wrap {
  white-space: normal !important
}
.text-nowrap {
  white-space: nowrap !important
}
.text-truncate {
  overflow: hidden;
  text-overflow: ellipsis;
  white-space: nowrap
}
.text-left {
  text-align: left !important
}
.text-right {
  text-align: right !important
}
.text-center {
  text-align: center !important
}
@media (min-width:576px) {
  .text-sm-left {
    text-align: left !important
  }
  .text-sm-right {
    text-align: right !important
  }
  .text-sm-center {
    text-align: center !important
  }
}
@media (min-width:768px) {
  .text-md-left {
    text-align: left !important
  }
  .text-md-right {
    text-align: right !important
  }
  .text-md-center {
    text-align: center !important
  }
}
@media (min-width:992px) {
  .text-lg-left {
    text-align: left !important
  }
  .text-lg-right {
    text-align: right !important
  }
  .text-lg-center {
    text-align: center !important
  }
}
@media (min-width:1200px) {
  .text-xl-left {
    text-align: left !important
  }
  .text-xl-right {
    text-align: right !important
  }
  .text-xl-center {
    text-align: center !important
  }
}
.text-lowercase {
  text-transform: lowercase !important
}
.text-uppercase {
  text-transform: uppercase !important
}
.text-capitalize {
  text-transform: capitalize !important
}
.font-weight-light {
  font-weight: 300 !important
}
.font-weight-lighter {
  font-weight: lighter !important
}
.font-weight-normal {
  font-weight: 400 !important
}
.font-weight-bold {
  font-weight: 700 !important
}
.font-weight-bolder {
  font-weight: bolder !important
}
.font-italic {
  font-style: italic !important
}
.text-white {
  color: #fff !important
}
.text-primary {
  color: #7e072a !important
}
a.text-primary:focus, a.text-primary:hover {
  color: #440013 !important
}
.text-secondary {
  color: #6c757d !important
}
a.text-secondary:focus, a.text-secondary:hover {
  color: #494f54 !important
}
.text-success {
  color: #28a745 !important
}
a.text-success:focus, a.text-success:hover {
  color: #19692c !important
}
.text-info {
  color: #17a2b8 !important
}
a.text-info:focus, a.text-info:hover {
  color: #0f6674 !important
}
.text-warning {
  color: #ffdf00 !important
}
a.text-warning:focus, a.text-warning:hover {
  color: #b39c00 !important
}
.text-danger {
  color: #7e072a !important
}
a.text-danger:focus, a.text-danger:hover {
  color: #440013 !important
}
.text-light {
  color: #f8f9fa !important
}
a.text-light:focus, a.text-light:hover {
  color: #cbd3da !important
}
.text-dark {
  color: #343a40 !important
}
a.text-dark:focus, a.text-dark:hover {
  color: #121416 !important
}
.text-body {
  color: #333 !important
}
.text-muted {
  color: #6c757d !important
}
.text-black-50 {
  color: rgba(51, 51, 51, .5) !important
}
.text-white-50 {
  color: hsla(0, 0%, 100%, .5) !important
}
.text-hide {
  font: 0/0 a;
  color: transparent;
  text-shadow: none;
  background-color: transparent;
  border: 0
}
.text-decoration-none {
  text-decoration: none !important
}
.text-break {
  word-break: break-word !important;
  overflow-wrap: break-word !important
}
.text-reset {
  color: inherit !important
}
.visible {
  visibility: visible !important
}
.invisible {
  visibility: hidden !important
}
*, :after, :before {
  box-sizing: border-box
}
html {
  font-family: sans-serif;
  line-height: 1.15;
  -webkit-text-size-adjust: 100%;
  -webkit-tap-highlight-color: rgba(51, 51, 51, 0)
}
article, aside, figcaption, figure, footer, header, hgroup, main, nav, section {
  display: block
}
body {
  margin: 0;
  font-family: "Modern Gothic", Arial, sans-serif;
  font-size: 1rem;
  font-weight: 400;
  line-height: 1.5;
  color: #333;
  text-align: left;
  -webkit-font-smoothing: antialiased;
  background-color: #fff
}
[tabindex="-1"]:focus:not(:focus-visible) {
  outline: 0 !important
}
hr {
  box-sizing: content-box;
  height: 0;
  overflow: visible
}
h1, h2, h3, h4, h5, h6 {
  margin-top: 0;
  margin-bottom: .5rem
}
p {
  margin-top: 0;
  margin-bottom: 1rem
}
abbr[data-original-title], abbr[title] {
  text-decoration: underline;
  -webkit-text-decoration: underline dotted;
  text-decoration: underline dotted;
  cursor: help;
  border-bottom: 0;
  -webkit-text-decoration-skip-ink: none;
  text-decoration-skip-ink: none
}
address {
  font-style: normal;
  line-height: inherit
}
address, dl, ol, ul {
  margin-bottom: 1rem
}
dl, ol, ul {
  margin-top: 0
}
ol ol, ol ul, ul ol, ul ul {
  margin-bottom: 0
}
dt {
  font-weight: 700
}
dd {
  margin-bottom: .5rem;
  margin-left: 0
}
blockquote {
  margin: 0 0 1rem
}
b, strong {
  font-weight: bolder
}
small {
  font-size: 80%
}
sub, sup {
  position: relative;
  font-size: 75%;
  line-height: 0;
  vertical-align: baseline
}
sub {
  bottom: -.25em
}
sup {
  top: -.5em
}
a {
  color: #7e072a;
  text-decoration: none;
  background-color: transparent
}
a:hover {
  color: #440013;
  text-decoration: underline
}
a:not([href]), a:not([href]):hover {
  color: inherit;
  text-decoration: none
}
code, kbd, pre, samp {
  font-family: SFMono-Regular, Menlo, Monaco, Consolas, Liberation Mono, Courier New, monospace;
  font-size: 1em
}
pre {
  margin-top: 0;
  margin-bottom: 1rem;
  overflow: auto
}
figure {
  margin: 0 0 1rem
}
img {
  border-style: none
}
img, svg {
  vertical-align: middle
}
svg {
  overflow: hidden
}
table {
  border-collapse: collapse
}
caption {
  padding-top: .75rem;
  padding-bottom: .75rem;
  color: #6c757d;
  text-align: left;
  caption-side: bottom
}
th {
  text-align: inherit
}
label {
  display: inline-block;
  margin-bottom: .5rem
}
button {
  border-radius: 0
}
button:focus {
  outline: 1px dotted;
  outline: 5px auto -webkit-focus-ring-color
}
button, input, optgroup, select, textarea {
  margin: 0;
  font-family: inherit;
  font-size: inherit;
  line-height: inherit
}
button, input {
  overflow: visible
}
button, select {
  text-transform: none
}
select {
  word-wrap: normal
}
[type=button], [type=reset], [type=submit], button {
  -webkit-appearance: button
}
[type=button]:not(:disabled), [type=reset]:not(:disabled), [type=submit]:not(:disabled), button:not(:disabled) {
  cursor: pointer
}
[type=button]::-moz-focus-inner, [type=reset]::-moz-focus-inner, [type=submit]::-moz-focus-inner, button::-moz-focus-inner {
  padding: 0;
  border-style: none
}
input[type=checkbox], input[type=radio] {
  box-sizing: border-box;
  padding: 0
}
input[type=date], input[type=datetime-local], input[type=month], input[type=time] {
  -webkit-appearance: listbox
}
textarea {
  overflow: auto;
  resize: vertical
}
fieldset {
  min-width: 0;
  padding: 0;
  margin: 0;
  border: 0
}
legend {
  display: block;
  width: 100%;
  max-width: 100%;
  padding: 0;
  margin-bottom: .5rem;
  font-size: 1.5rem;
  line-height: inherit;
  color: inherit;
  white-space: normal
}
progress {
  vertical-align: baseline
}
[type=number]::-webkit-inner-spin-button, [type=number]::-webkit-outer-spin-button {
  height: auto
}
[type=search] {
  outline-offset: -2px;
  -webkit-appearance: none
}
[type=search]::-webkit-search-decoration {
  -webkit-appearance: none
}
::-webkit-file-upload-button {
  font: inherit;
  -webkit-appearance: button
}
output {
  display: inline-block
}
summary {
  display: list-item;
  cursor: pointer
}
template {
  display: none
}
[hidden] {
  display: none !important
}
code {
  font-size: 87.5%;
  color: #e83e8c;
  word-wrap: break-word
}
a > code {
  color: inherit
}
kbd {
  padding: .2rem .4rem;
  font-size: 87.5%;
  color: #fff;
  background-color: #212529;
  border-radius: .2rem
}
kbd kbd {
  padding: 0;
  font-size: 100%;
  font-weight: 700
}
pre {
  display: block;
  font-size: 87.5%;
  color: #212529
}
pre code {
  font-size: inherit;
  color: inherit;
  word-break: normal
}
.pre-scrollable {
  max-height: 340px;
  overflow-y: scroll
}
.container {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto
}
@media (min-width:576px) {
  .container {
    max-width: 540px
  }
}
@media (min-width:768px) {
  .container {
    max-width: 720px
  }
}
@media (min-width:992px) {
  .container {
    max-width: 960px
  }
}
@media (min-width:1200px) {
  .container {
    max-width: 1140px
  }
}
.container-fluid, .container-lg, .container-md, .container-sm, .container-xl {
  width: 100%;
  padding-right: 15px;
  padding-left: 15px;
  margin-right: auto;
  margin-left: auto
}
@media (min-width:576px) {
  .container, .container-sm {
    max-width: 540px
  }
}
@media (min-width:768px) {
  .container, .container-md, .container-sm {
    max-width: 720px
  }
}
@media (min-width:992px) {
  .container, .container-lg, .container-md, .container-sm {
    max-width: 960px
  }
}
@media (min-width:1200px) {
  .container, .container-lg, .container-md, .container-sm, .container-xl {
    max-width: 1140px
  }
}
.row {
  display: flex;
  flex-wrap: wrap;
  margin-right: -15px;
  margin-left: -15px
}
.no-gutters {
  margin-right: 0;
  margin-left: 0
}
.no-gutters > .col, .no-gutters > [class*=col-] {
  padding-right: 0;
  padding-left: 0
}
.col, .col-1, .col-2, .col-3, .col-4, .col-5, .col-6, .col-7, .col-8, .col-9, .col-10, .col-11, .col-12, .col-auto, .col-lg, .col-lg-1, .col-lg-2, .col-lg-3, .col-lg-4, .col-lg-5, .col-lg-6, .col-lg-7, .col-lg-8, .col-lg-9, .col-lg-10, .col-lg-11, .col-lg-12, .col-lg-auto, .col-md, .col-md-1, .col-md-2, .col-md-3, .col-md-4, .col-md-5, .col-md-6, .col-md-7, .col-md-8, .col-md-9, .col-md-10, .col-md-11, .col-md-12, .col-md-auto, .col-sm, .col-sm-1, .col-sm-2, .col-sm-3, .col-sm-4, .col-sm-5, .col-sm-6, .col-sm-7, .col-sm-8, .col-sm-9, .col-sm-10, .col-sm-11, .col-sm-12, .col-sm-auto, .col-xl, .col-xl-1, .col-xl-2, .col-xl-3, .col-xl-4, .col-xl-5, .col-xl-6, .col-xl-7, .col-xl-8, .col-xl-9, .col-xl-10, .col-xl-11, .col-xl-12, .col-xl-auto {
  position: relative;
  width: 100%;
  padding-right: 15px;
  padding-left: 15px
}
.col {
  flex-basis: 0;
  flex-grow: 1;
  max-width: 100%
}
.row-cols-1 > * {
  flex: 0 0 100%;
  max-width: 100%
}
.row-cols-2 > * {
  flex: 0 0 50%;
  max-width: 50%
}
.row-cols-3 > * {
  flex: 0 0 33.3333333333%;
  max-width: 33.3333333333%
}
.row-cols-4 > * {
  flex: 0 0 25%;
  max-width: 25%
}
.row-cols-5 > * {
  flex: 0 0 20%;
  max-width: 20%
}
.row-cols-6 > * {
  flex: 0 0 16.6666666667%;
  max-width: 16.6666666667%
}
.col-auto {
  flex: 0 0 auto;
  width: auto;
  max-width: 100%
}
.col-1 {
  flex: 0 0 8.3333333333%;
  max-width: 8.3333333333%
}
.col-2 {
  flex: 0 0 16.6666666667%;
  max-width: 16.6666666667%
}
.col-3 {
  flex: 0 0 25%;
  max-width: 25%
}
.col-4 {
  flex: 0 0 33.3333333333%;
  max-width: 33.3333333333%
}
.col-5 {
  flex: 0 0 41.6666666667%;
  max-width: 41.6666666667%
}
.col-6 {
  flex: 0 0 50%;
  max-width: 50%
}
.col-7 {
  flex: 0 0 58.3333333333%;
  max-width: 58.3333333333%
}
.col-8 {
  flex: 0 0 66.6666666667%;
  max-width: 66.6666666667%
}
.col-9 {
  flex: 0 0 75%;
  max-width: 75%
}
.col-10 {
  flex: 0 0 83.3333333333%;
  max-width: 83.3333333333%
}
.col-11 {
  flex: 0 0 91.6666666667%;
  max-width: 91.6666666667%
}
.col-12 {
  flex: 0 0 100%;
  max-width: 100%
}
.order-first {
  order: -1
}
.order-last {
  order: 13
}
.order-0 {
  order: 0
}
.order-1 {
  order: 1
}
.order-2 {
  order: 2
}
.order-3 {
  order: 3
}
.order-4 {
  order: 4
}
.order-5 {
  order: 5
}
.order-6 {
  order: 6
}
.order-7 {
  order: 7
}
.order-8 {
  order: 8
}
.order-9 {
  order: 9
}
.order-10 {
  order: 10
}
.order-11 {
  order: 11
}
.order-12 {
  order: 12
}
.offset-1 {
  margin-left: 8.3333333333%
}
.offset-2 {
  margin-left: 16.6666666667%
}
.offset-3 {
  margin-left: 25%
}
.offset-4 {
  margin-left: 33.3333333333%
}
.offset-5 {
  margin-left: 41.6666666667%
}
.offset-6 {
  margin-left: 50%
}
.offset-7 {
  margin-left: 58.3333333333%
}
.offset-8 {
  margin-left: 66.6666666667%
}
.offset-9 {
  margin-left: 75%
}
.offset-10 {
  margin-left: 83.3333333333%
}
.offset-11 {
  margin-left: 91.6666666667%
}
@media (min-width:576px) {
  .col-sm {
    flex-basis: 0;
    flex-grow: 1;
    max-width: 100%
  }
  .row-cols-sm-1 > * {
    flex: 0 0 100%;
    max-width: 100%
  }
  .row-cols-sm-2 > * {
    flex: 0 0 50%;
    max-width: 50%
  }
  .row-cols-sm-3 > * {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%
  }
  .row-cols-sm-4 > * {
    flex: 0 0 25%;
    max-width: 25%
  }
  .row-cols-sm-5 > * {
    flex: 0 0 20%;
    max-width: 20%
  }
  .row-cols-sm-6 > * {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%
  }
  .col-sm-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%
  }
  .col-sm-1 {
    flex: 0 0 8.3333333333%;
    max-width: 8.3333333333%
  }
  .col-sm-2 {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%
  }
  .col-sm-3 {
    flex: 0 0 25%;
    max-width: 25%
  }
  .col-sm-4 {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%
  }
  .col-sm-5 {
    flex: 0 0 41.6666666667%;
    max-width: 41.6666666667%
  }
  .col-sm-6 {
    flex: 0 0 50%;
    max-width: 50%
  }
  .col-sm-7 {
    flex: 0 0 58.3333333333%;
    max-width: 58.3333333333%
  }
  .col-sm-8 {
    flex: 0 0 66.6666666667%;
    max-width: 66.6666666667%
  }
  .col-sm-9 {
    flex: 0 0 75%;
    max-width: 75%
  }
  .col-sm-10 {
    flex: 0 0 83.3333333333%;
    max-width: 83.3333333333%
  }
  .col-sm-11 {
    flex: 0 0 91.6666666667%;
    max-width: 91.6666666667%
  }
  .col-sm-12 {
    flex: 0 0 100%;
    max-width: 100%
  }
  .order-sm-first {
    order: -1
  }
  .order-sm-last {
    order: 13
  }
  .order-sm-0 {
    order: 0
  }
  .order-sm-1 {
    order: 1
  }
  .order-sm-2 {
    order: 2
  }
  .order-sm-3 {
    order: 3
  }
  .order-sm-4 {
    order: 4
  }
  .order-sm-5 {
    order: 5
  }
  .order-sm-6 {
    order: 6
  }
  .order-sm-7 {
    order: 7
  }
  .order-sm-8 {
    order: 8
  }
  .order-sm-9 {
    order: 9
  }
  .order-sm-10 {
    order: 10
  }
  .order-sm-11 {
    order: 11
  }
  .order-sm-12 {
    order: 12
  }
  .offset-sm-0 {
    margin-left: 0
  }
  .offset-sm-1 {
    margin-left: 8.3333333333%
  }
  .offset-sm-2 {
    margin-left: 16.6666666667%
  }
  .offset-sm-3 {
    margin-left: 25%
  }
  .offset-sm-4 {
    margin-left: 33.3333333333%
  }
  .offset-sm-5 {
    margin-left: 41.6666666667%
  }
  .offset-sm-6 {
    margin-left: 50%
  }
  .offset-sm-7 {
    margin-left: 58.3333333333%
  }
  .offset-sm-8 {
    margin-left: 66.6666666667%
  }
  .offset-sm-9 {
    margin-left: 75%
  }
  .offset-sm-10 {
    margin-left: 83.3333333333%
  }
  .offset-sm-11 {
    margin-left: 91.6666666667%
  }
}
@media (min-width:768px) {
  .col-md {
    flex-basis: 0;
    flex-grow: 1;
    max-width: 100%
  }
  .row-cols-md-1 > * {
    flex: 0 0 100%;
    max-width: 100%
  }
  .row-cols-md-2 > * {
    flex: 0 0 50%;
    max-width: 50%
  }
  .row-cols-md-3 > * {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%
  }
  .row-cols-md-4 > * {
    flex: 0 0 25%;
    max-width: 25%
  }
  .row-cols-md-5 > * {
    flex: 0 0 20%;
    max-width: 20%
  }
  .row-cols-md-6 > * {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%
  }
  .col-md-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%
  }
  .col-md-1 {
    flex: 0 0 8.3333333333%;
    max-width: 8.3333333333%
  }
  .col-md-2 {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%
  }
  .col-md-3 {
    flex: 0 0 25%;
    max-width: 25%
  }
  .col-md-4 {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%
  }
  .col-md-5 {
    flex: 0 0 41.6666666667%;
    max-width: 41.6666666667%
  }
  .col-md-6 {
    flex: 0 0 50%;
    max-width: 50%
  }
  .col-md-7 {
    flex: 0 0 58.3333333333%;
    max-width: 58.3333333333%
  }
  .col-md-8 {
    flex: 0 0 66.6666666667%;
    max-width: 66.6666666667%
  }
  .col-md-9 {
    flex: 0 0 75%;
    max-width: 75%
  }
  .col-md-10 {
    flex: 0 0 83.3333333333%;
    max-width: 83.3333333333%
  }
  .col-md-11 {
    flex: 0 0 91.6666666667%;
    max-width: 91.6666666667%
  }
  .col-md-12 {
    flex: 0 0 100%;
    max-width: 100%
  }
  .order-md-first {
    order: -1
  }
  .order-md-last {
    order: 13
  }
  .order-md-0 {
    order: 0
  }
  .order-md-1 {
    order: 1
  }
  .order-md-2 {
    order: 2
  }
  .order-md-3 {
    order: 3
  }
  .order-md-4 {
    order: 4
  }
  .order-md-5 {
    order: 5
  }
  .order-md-6 {
    order: 6
  }
  .order-md-7 {
    order: 7
  }
  .order-md-8 {
    order: 8
  }
  .order-md-9 {
    order: 9
  }
  .order-md-10 {
    order: 10
  }
  .order-md-11 {
    order: 11
  }
  .order-md-12 {
    order: 12
  }
  .offset-md-0 {
    margin-left: 0
  }
  .offset-md-1 {
    margin-left: 8.3333333333%
  }
  .offset-md-2 {
    margin-left: 16.6666666667%
  }
  .offset-md-3 {
    margin-left: 25%
  }
  .offset-md-4 {
    margin-left: 33.3333333333%
  }
  .offset-md-5 {
    margin-left: 41.6666666667%
  }
  .offset-md-6 {
    margin-left: 50%
  }
  .offset-md-7 {
    margin-left: 58.3333333333%
  }
  .offset-md-8 {
    margin-left: 66.6666666667%
  }
  .offset-md-9 {
    margin-left: 75%
  }
  .offset-md-10 {
    margin-left: 83.3333333333%
  }
  .offset-md-11 {
    margin-left: 91.6666666667%
  }
}
@media (min-width:992px) {
  .col-lg {
    flex-basis: 0;
    flex-grow: 1;
    max-width: 100%
  }
  .row-cols-lg-1 > * {
    flex: 0 0 100%;
    max-width: 100%
  }
  .row-cols-lg-2 > * {
    flex: 0 0 50%;
    max-width: 50%
  }
  .row-cols-lg-3 > * {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%
  }
  .row-cols-lg-4 > * {
    flex: 0 0 25%;
    max-width: 25%
  }
  .row-cols-lg-5 > * {
    flex: 0 0 20%;
    max-width: 20%
  }
  .row-cols-lg-6 > * {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%
  }
  .col-lg-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%
  }
  .col-lg-1 {
    flex: 0 0 8.3333333333%;
    max-width: 8.3333333333%
  }
  .col-lg-2 {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%
  }
  .col-lg-3 {
    flex: 0 0 25%;
    max-width: 25%
  }
  .col-lg-4 {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%
  }
  .col-lg-5 {
    flex: 0 0 41.6666666667%;
    max-width: 41.6666666667%
  }
  .col-lg-6 {
    flex: 0 0 50%;
    max-width: 50%
  }
  .col-lg-7 {
    flex: 0 0 58.3333333333%;
    max-width: 58.3333333333%
  }
  .col-lg-8 {
    flex: 0 0 66.6666666667%;
    max-width: 66.6666666667%
  }
  .col-lg-9 {
    flex: 0 0 75%;
    max-width: 75%
  }
  .col-lg-10 {
    flex: 0 0 83.3333333333%;
    max-width: 83.3333333333%
  }
  .col-lg-11 {
    flex: 0 0 91.6666666667%;
    max-width: 91.6666666667%
  }
  .col-lg-12 {
    flex: 0 0 100%;
    max-width: 100%
  }
  .order-lg-first {
    order: -1
  }
  .order-lg-last {
    order: 13
  }
  .order-lg-0 {
    order: 0
  }
  .order-lg-1 {
    order: 1
  }
  .order-lg-2 {
    order: 2
  }
  .order-lg-3 {
    order: 3
  }
  .order-lg-4 {
    order: 4
  }
  .order-lg-5 {
    order: 5
  }
  .order-lg-6 {
    order: 6
  }
  .order-lg-7 {
    order: 7
  }
  .order-lg-8 {
    order: 8
  }
  .order-lg-9 {
    order: 9
  }
  .order-lg-10 {
    order: 10
  }
  .order-lg-11 {
    order: 11
  }
  .order-lg-12 {
    order: 12
  }
  .offset-lg-0 {
    margin-left: 0
  }
  .offset-lg-1 {
    margin-left: 8.3333333333%
  }
  .offset-lg-2 {
    margin-left: 16.6666666667%
  }
  .offset-lg-3 {
    margin-left: 25%
  }
  .offset-lg-4 {
    margin-left: 33.3333333333%
  }
  .offset-lg-5 {
    margin-left: 41.6666666667%
  }
  .offset-lg-6 {
    margin-left: 50%
  }
  .offset-lg-7 {
    margin-left: 58.3333333333%
  }
  .offset-lg-8 {
    margin-left: 66.6666666667%
  }
  .offset-lg-9 {
    margin-left: 75%
  }
  .offset-lg-10 {
    margin-left: 83.3333333333%
  }
  .offset-lg-11 {
    margin-left: 91.6666666667%
  }
}
@media (min-width:1200px) {
  .col-xl {
    flex-basis: 0;
    flex-grow: 1;
    max-width: 100%
  }
  .row-cols-xl-1 > * {
    flex: 0 0 100%;
    max-width: 100%
  }
  .row-cols-xl-2 > * {
    flex: 0 0 50%;
    max-width: 50%
  }
  .row-cols-xl-3 > * {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%
  }
  .row-cols-xl-4 > * {
    flex: 0 0 25%;
    max-width: 25%
  }
  .row-cols-xl-5 > * {
    flex: 0 0 20%;
    max-width: 20%
  }
  .row-cols-xl-6 > * {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%
  }
  .col-xl-auto {
    flex: 0 0 auto;
    width: auto;
    max-width: 100%
  }
  .col-xl-1 {
    flex: 0 0 8.3333333333%;
    max-width: 8.3333333333%
  }
  .col-xl-2 {
    flex: 0 0 16.6666666667%;
    max-width: 16.6666666667%
  }
  .col-xl-3 {
    flex: 0 0 25%;
    max-width: 25%
  }
  .col-xl-4 {
    flex: 0 0 33.3333333333%;
    max-width: 33.3333333333%
  }
  .col-xl-5 {
    flex: 0 0 41.6666666667%;
    max-width: 41.6666666667%
  }
  .col-xl-6 {
    flex: 0 0 50%;
    max-width: 50%
  }
  .col-xl-7 {
    flex: 0 0 58.3333333333%;
    max-width: 58.3333333333%
  }
  .col-xl-8 {
    flex: 0 0 66.6666666667%;
    max-width: 66.6666666667%
  }
  .col-xl-9 {
    flex: 0 0 75%;
    max-width: 75%
  }
  .col-xl-10 {
    flex: 0 0 83.3333333333%;
    max-width: 83.3333333333%
  }
  .col-xl-11 {
    flex: 0 0 91.6666666667%;
    max-width: 91.6666666667%
  }
  .col-xl-12 {
    flex: 0 0 100%;
    max-width: 100%
  }
  .order-xl-first {
    order: -1
  }
  .order-xl-last {
    order: 13
  }
  .order-xl-0 {
    order: 0
  }
  .order-xl-1 {
    order: 1
  }
  .order-xl-2 {
    order: 2
  }
  .order-xl-3 {
    order: 3
  }
  .order-xl-4 {
    order: 4
  }
  .order-xl-5 {
    order: 5
  }
  .order-xl-6 {
    order: 6
  }
  .order-xl-7 {
    order: 7
  }
  .order-xl-8 {
    order: 8
  }
  .order-xl-9 {
    order: 9
  }
  .order-xl-10 {
    order: 10
  }
  .order-xl-11 {
    order: 11
  }
  .order-xl-12 {
    order: 12
  }
  .offset-xl-0 {
    margin-left: 0
  }
  .offset-xl-1 {
    margin-left: 8.3333333333%
  }
  .offset-xl-2 {
    margin-left: 16.6666666667%
  }
  .offset-xl-3 {
    margin-left: 25%
  }
  .offset-xl-4 {
    margin-left: 33.3333333333%
  }
  .offset-xl-5 {
    margin-left: 41.6666666667%
  }
  .offset-xl-6 {
    margin-left: 50%
  }
  .offset-xl-7 {
    margin-left: 58.3333333333%
  }
  .offset-xl-8 {
    margin-left: 66.6666666667%
  }
  .offset-xl-9 {
    margin-left: 75%
  }
  .offset-xl-10 {
    margin-left: 83.3333333333%
  }
  .offset-xl-11 {
    margin-left: 91.6666666667%
  }
}
.nav {
  display: flex;
  flex-wrap: wrap;
  padding-left: 0;
  margin-bottom: 0;
  list-style: none
}
.nav-link {
  display: block;
  padding: .5rem 1rem
}
.nav-link:focus, .nav-link:hover {
  text-decoration: none
}
.nav-link.disabled {
  color: #6c757d;
  pointer-events: none;
  cursor: default
}
.nav-tabs {
  border-bottom: 1px solid #dee2e6
}
.nav-tabs .nav-item {
  margin-bottom: -1px
}
.nav-tabs .nav-link {
  border: 1px solid transparent;
  border-top-left-radius: 2px;
  border-top-right-radius: 2px
}
.nav-tabs .nav-link:focus, .nav-tabs .nav-link:hover {
  border-color: #e9ecef #e9ecef #dee2e6
}
.nav-tabs .nav-link.disabled {
  color: #6c757d;
  background-color: transparent;
  border-color: transparent
}
.nav-tabs .nav-item.show .nav-link, .nav-tabs .nav-link.active {
  color: #495057;
  background-color: #fff;
  border-color: #dee2e6 #dee2e6 #fff
}
.nav-tabs .dropdown-menu {
  margin-top: -1px;
  border-top-left-radius: 0;
  border-top-right-radius: 0
}
.nav-pills .nav-link {
  border-radius: 2px
}
.nav-pills .nav-link.active, .nav-pills .show > .nav-link {
  color: #fff;
  background-color: #7e072a
}
.nav-fill .nav-item {
  flex: 1 1 auto;
  text-align: center
}
.nav-justified .nav-item {
  flex-basis: 0;
  flex-grow: 1;
  text-align: center
}
.tab-content > .tab-pane {
  display: none
}
.tab-content > .active {
  display: block
}
.fade {
  transition: opacity .15s linear
}
@media (prefers-reduced-motion:reduce) {
  .fade {
    transition: none
  }
}
.fade:not(.show) {
  opacity: 0
}
.collapse:not(.show) {
  display: none
}
.collapsing {
  position: relative;
  height: 0;
  overflow: hidden;
  transition: height .35s ease
}
@media (prefers-reduced-motion:reduce) {
  .collapsing {
    transition: none
  }
}
.glide {
  position: relative;
  width: 100%;
  box-sizing: border-box
}
.glide * {
  box-sizing: inherit
}
.glide__slides, .glide__track {
  overflow: hidden
}
.glide__slides {
  position: relative;
  width: 100%;
  list-style: none;
  -webkit-backface-visibility: hidden;
  backface-visibility: hidden;
  transform-style: preserve-3d;
  touch-action: pan-Y;
  margin: 0;
  padding: 0;
  white-space: nowrap;
  display: flex;
  flex-wrap: nowrap;
  will-change: transform
}
.glide__slide, .glide__slides--dragging {
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none
}
.glide__slide {
  width: 100%;
  height: 100%;
  flex-shrink: 0;
  white-space: normal;
  -webkit-touch-callout: none;
  -webkit-tap-highlight-color: transparent
}
.glide__slide a {
  -webkit-user-select: none;
  user-select: none;
  -webkit-user-drag: none;
  -moz-user-select: none;
  -ms-user-select: none
}
.glide__arrows, .glide__bullets {
  -webkit-touch-callout: none;
  -webkit-user-select: none;
  -moz-user-select: none;
  -ms-user-select: none;
  user-select: none
}
.glide--rtl {
  direction: rtl
}
.js .header-placeholder, .js .header-sticky {
  opacity: 0
}
.js.js-ready .header-placeholder, .js.js-ready .header-sticky {
  opacity: 1
}
.header-overlay {
  position: fixed;
  left: 0;
  right: 0;
  bottom: 0;
  width: 100%;
  height: 100%;
  background-color: rgba(0, 0, 0, .5);
  z-index: 100
}
.header-sticky {
  position: fixed;
  top: 0;
  left: 0;
  right: 0;
  z-index: 2000;
  transition: transform .5s ease-in-out
}
.header-placeholder {
  transition: height .5s ease-in-out
}
.scroll-down {
  transform: translate3d(0, -100%, 0)
}
.scroll-up {
  transform: none
}
.header-nav {
  position: relative
}
.header-nav__top {
  background-color: #7e072a;
  overflow: hidden;
  visibility: visible;
  transition: height .3s ease-in-out
}
.header-nav__top--collapse {
  height: 0;
  visibility: hidden;
  transition: height .3s ease-in-out
}
.header-nav__top__container {
  display: flex;
  flex-wrap: wrap;
  justify-content: flex-end
}
.header-nav__top__direct-edit {
  display: inline-flex;
  align-items: center;
  margin: 0 1rem
}
.header-nav__top__direct-edit > a {
  display: inline-block
}
.header-nav__top__direct-edit > a > svg {
  fill: #fff;
  transform: scale(.8)
}
.header-nav__top__auth-user {
  border-left: 1px solid #fff;
  display: inline-flex;
  align-items: center;
  padding: 0 1rem
}
.header-nav__top__auth-user > a {
  color: #fff !important;
  font-weight: 700;
  font-size: .8rem;
  padding: .35rem .5rem
}
.header-nav__top__auth-user > a svg {
  fill: #fff;
  margin-left: .25rem
}
.header-nav__top__list {
  border-left: 1px solid #fff;
  text-decoration: none;
  display: inline-flex;
  margin-bottom: 0;
  padding: 0 1rem
}
.header-nav__top__list--secondary {
  background-color: #333
}
.header-nav__top__list--tertiary {
  background-color: #333;
  border-left: 1px solid #fff
}
.header-nav__top__link {
  display: inline-block;
  color: #fff !important;
  font-size: .8rem;
  padding: .35rem .5rem
}
.header-nav__bottom {
  position: relative;
  background-color: #fff;
  border-bottom: 6px solid #7e072a;
  padding: 0 .9375rem
}
.header-nav__bottom__container {
  display: flex;
  flex-wrap: wrap
}
.header-nav__bottom__list {
  text-decoration: none;
  display: inline-flex;
  align-items: center;
  margin-bottom: 0
}
.header-nav__bottom__item {
  height: 100%
}
.header-nav__bottom__link {
  color: #333 !important;
  padding: .25rem .5rem;
  position: relative;
  height: inherit;
  display: inline-flex;
  align-items: center
}
.header-nav__bottom__link:before {
  content: "";
  display: block;
  position: absolute;
  left: 50%;
  bottom: .3rem;
  width: 20px;
  height: 20px;
  transform: translateX(-50%)
}
.header-nav__bottom__link:after {
  content: "";
  display: block;
  position: absolute;
  left: 0;
  bottom: 0;
  height: 3px;
  background-color: #7e072a;
  z-index: 1100
}
.header-nav__bottom__link:hover:before {
  background-image: url(/media/review/site-assets/images/icons/arrow.svg);
  background-repeat: no-repeat;
  background-position: 50%;
  background-size: cover
}
.header-nav__bottom__link:hover:after {
  width: 100%;
  animation: a forwards cubic-bezier(.21, 1.3, .94, 1.12) .25s
}
.header-nav__bottom__link--active:before {
  background-image: url(/media/review/site-assets/images/icons/arrow.svg);
  background-repeat: no-repeat;
  background-position: 50%;
  background-size: cover
}
.header-nav__bottom__link--active:after {
  width: 100%;
  animation: a forwards cubic-bezier(.21, 1.3, .94, 1.12) .25s
}
.header-nav__bottom__link:active, .header-nav__bottom__link:focus, .header-nav__bottom__link:hover {
  text-decoration: none;
  color: #707070 !important
}
.header-nav__bottom__search-toggler {
  display: flex;
  align-items: center;
  margin-left: 1.5rem
}
.header-nav__bottom__search-toggler__button {
  padding: .5rem
}
.header-nav__bottom__search-toggler__button > svg {
  transform: scale(1.3)
}
.header-nav__bottom__search-toggler__label {
  text-transform: uppercase;
  font-weight: 700;
  font-size: .85rem;
  margin-left: .5rem
}
.header-nav__bottom__nav-toggler {
  display: none
}
.header-nav__bottom__nav-toggler__button {
  padding: .5rem
}
.header-nav__bottom__nav-toggler__button > svg {
  transform: scale(1.3)
}
.header-nav__bottom__toggler {
  position: absolute;
  top: 0;
  right: 1rem;
  display: none
}
.header-nav__bottom__toggler:focus .header-nav__bottom__toggler__label, .header-nav__bottom__toggler:hover .header-nav__bottom__toggler__label {
  text-decoration: underline
}
.header-nav__bottom__toggler__button {
  display: flex;
  align-items: center;
  background-color: #7e072a;
  color: #fff !important;
  padding: .75rem 1rem;
  box-shadow: 0 2px 5px rgba(51, 51, 51, .2);
  border-radius: 0 0 .5rem .5rem
}
.header-nav__bottom__toggler__button > svg {
  fill: #fff;
  transform: scale(1.3)
}
.header-nav__bottom__toggler__label {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  font-weight: 700;
  margin-left: .5rem
}
.header-nav__bottom__outer-quick-list {
  display: none
}
.header-nav__mobile {
  display: flex;
  margin-left: auto
}
.header-nav__mobile__auth-user, .header-nav__mobile__close-toggler, .header-nav__mobile__direct-edit {
  display: none
}
.header-nav__logo {
  display: flex;
  width: auto;
  height: auto;
  padding: 1.5rem .25rem;
  margin-bottom: 0;
  overflow: hidden;
  -webkit-backface-visibility: hidden;
  backface-visibility: hidden
}
.header-nav__logo a {
  display: block
}
.header-nav__logo img {
  width: 12rem;
  height: auto
}
.header-nav__dropdown-menu {
  position: absolute;
  width: 100%;
  left: 50%;
  transform: translateX(-50%);
  display: none;
  flex-wrap: wrap;
  background-color: #fff;
  border-top: 3px solid #e9e9e9;
  border-bottom: 6px solid #7e072a;
  z-index: 1000
}
.header-nav__dropdown-menu--active {
  display: flex
}
.header-nav__dropdown-menu__img {
  position: relative;
  width: 150px;
  height: 150px;
  background-color: #b0bcb0
}
.header-nav__dropdown-menu__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;";
  position: absolute;
  top: 0;
  left: 0
}
.header-nav__dropdown-menu__img__link {
  width: 100%;
  position: absolute;
  bottom: 0;
  left: 0;
  background-color: #7e072a;
  color: #fff !important;
  font-size: .8rem;
  text-align: center;
  padding: .5rem
}
.header-nav__dropdown-menu__item > img {
  width: 24px;
  height: 24px;
  margin-right: .5rem
}
.header-nav__dropdown-menu__link-title {
  display: block;
  font-size: .9rem;
  text-decoration: underline;
  font-weight: 700;
  letter-spacing: -.025rem;
  margin-bottom: .5rem
}
.header-nav__dropdown-menu__link {
  font-size: .9rem;
  color: #333 !important
}
.header-nav__dropdown-menu__link:active, .header-nav__dropdown-menu__link:focus, .header-nav__dropdown-menu__link:hover {
  text-decoration: none;
  color: #7e072a !important
}
.header-nav__dropdown-menu__back-toggler, .header-nav__dropdown-menu__sibling-link {
  display: none
}
.header-nav__dropdown-menu__lists-widget {
  width: 80%;
  display: flex;
  flex-direction: column;
  align-items: flex-end;
  margin-left: auto;
  padding: 2rem
}
.header-nav__dropdown-menu__lists-widget--top {
  display: flex
}
.header-nav__dropdown-menu__lists-widget--top--list {
  margin-right: 3rem
}
.header-nav__dropdown-menu__lists-widget--top--list:last-child {
  margin-right: 0
}
.header-nav__dropdown-menu__lists-widget--bottom {
  display: flex;
  justify-content: flex-end;
  width: 100vw;
  border-top: 1px solid #e9e9e9;
  margin-top: 2rem;
  padding-top: 2rem
}
.header-nav__dropdown-menu__lists-widget--bottom > li {
  display: inline-flex;
  align-items: center;
  padding: 0 1rem
}
.header-nav__dropdown-menu__lists-widget--bottom > li:first-child {
  display: none
}
.header-nav__dropdown-menu__lists-widget--bottom > li:last-child {
  padding-right: 0
}
.header-nav__dropdown-menu__images-widget {
  display: flex;
  flex-direction: column;
  padding: 2rem;
  margin: 0 auto
}
.section-header-nav {
  background-color: #7e072a;
  color: #fff !important;
  padding: .9375rem;
  display: flex
}
.section-header-nav__title {
  white-space: normal;
  word-break: break-word;
  margin-right: 1.2rem;
  margin-bottom: 0
}
.section-header-nav__title > a {
  font-family: owners-wide, sans-serif;
  font-weight: 900;
  font-style: normal;
  font-size: 2.375rem;
  text-transform: uppercase;
  line-height: 99%;
  letter-spacing: .15rem;
  word-break: break-word;
  margin-bottom: 1rem;
  color: #fff !important
}
.section-header-nav__title > a:hover {
  text-decoration: none
}
.section-header-nav__toggler {
  margin-left: auto;
  margin-top: -1.15rem;
  z-index: 10
}
.section-header-nav__toggler:focus .section-header-nav__toggler__label, .section-header-nav__toggler:hover .section-header-nav__toggler__label {
  text-decoration: underline
}
.section-header-nav__toggler__button {
  display: flex;
  align-items: center;
  background-color: #7e072a;
  color: #fff !important;
  padding: .75rem 1rem;
  box-shadow: 0 2px 5px rgba(51, 51, 51, .2);
  border-radius: 0 0 .5rem .5rem
}
.section-header-nav__toggler__button > svg {
  fill: #fff;
  transform: scale(1.3)
}
.section-header-nav__toggler__label {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  font-weight: 700;
  margin-left: .5rem
}
.section-nav {
  position: relative;
  color: #fff !important;
  padding: 0 .9375rem;
  display: flex
}
.section-nav, .section-nav__button {
  background-color: #7e072a;
  border-top: 1px solid silver;
  justify-content: space-between
}
.section-nav__button {
  display: none;
  align-items: center;
  width: 100%;
  padding: 0
}
.section-nav__button > span {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  color: #fff !important;
  text-transform: capitalize;
  font-weight: 700;
  margin-left: 1rem
}
.section-nav__button > svg {
  fill: #fff;
  /*background-color: #333*/
}
.section-nav__lists {
  margin-bottom: 0;
  width: 97.5%
}
.section-nav__item {
  position: relative;
  display: inline-flex;
  align-items: center
}
.section-nav__link {
  color: #fff !important;
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem;
  padding: .65rem .5rem
}
.section-nav__dropdown-menu {
  position: absolute;
  top: 2.25rem;
  width: 225px;
  background-color: #333;
  display: none;
  z-index: 100
}
.section-nav__dropdown-menu--active {
  display: block
}
.section-nav__dropdown-menu li {
  border-top: 1px solid hsla(120, 9%, 91%, .2)
}
.section-nav__dropdown-menu li a {
  display: block;
  font-weight: 400;
  letter-spacing: .01rem;
  font-size: .875rem;
  color: #fff !important;
  padding: .5rem 1rem
}
.section-nav__search-toggler {
  display: flex;
  align-items: center;
  margin-left: 1.5rem
}
.section-nav__search-toggler__button {
  color: #fff !important;
  box-shadow: 0 2px 5px rgba(51, 51, 51, .2);
  border-radius: 0 0 .5rem .5rem;
  padding: 0
}
.section-nav__search-toggler__button > svg {
  fill: #fff;
  transform: scale(.7)
}
.section-nav__search-toggler__label {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  font-weight: 700;
  margin-left: .5rem
}
.site-search {
  display: none;
  width: 100%;
  position: absolute;
  left: 0;
  background-color: #fff;
  padding: 1rem 1rem 2rem;
  border-top: 1px solid #e9e9e9;
  border-bottom: 1px solid #e9e9e9;
  z-index: 90;
  transition: top .3s ease-in-out
}
.site-search--open {
  display: block
}
.site-search__container {
  display: flex;
  flex-wrap: wrap
}
.site-search__form {
  width: 100%
}
.site-search .search-form-container {
  position: relative
}
.site-search .search-form-container__input-search {
  width: 100%;
  padding: 1rem 3rem 1rem 0;
  border-top: none;
  border-right: none;
  border-left: none;
  border-bottom: 2px solid #e9e9e9;
  font-size: .875rem;
  transition: border-bottom-color .3s ease-in-out
}
.site-search .search-form-container__input-search:focus, .site-search .search-form-container__input-search:hover {
  border-bottom-color: #7e072a;
  outline: none
}
.site-search .search-form-container__button {
  height: 100%;
  position: absolute;
  top: 0
}
.site-search .search-form-container__button > svg {
  transform: scale(1.3)
}
.site-search .search-form-container__button--search {
  right: 2.5rem
}
.site-search .search-form-container__button--close {
  right: 0
}
.section-search {
  display: none;
  width: 100%;
  position: absolute;
  left: 0;
  background-color: #fff;
  padding: 1rem 1rem 2rem;
  border-top: 1px solid #e9e9e9;
  border-bottom: 1px solid #e9e9e9;
  z-index: 90;
  transition: top .3s ease-in-out
}
.section-search--open {
  display: block
}
.section-search__container {
  display: flex;
  flex-wrap: wrap
}
.section-search__form {
  width: 100%
}
.section-search .search-form-container {
  position: relative
}
.section-search .search-form-container__input-search {
  width: 100%;
  padding: 1rem 3rem 1rem 0;
  border-top: none;
  border-right: none;
  border-left: none;
  border-bottom: 2px solid #e9e9e9;
  font-size: .875rem;
  transition: border-bottom-color .3s ease-in-out
}
.section-search .search-form-container__input-search:focus, .section-search .search-form-container__input-search:hover {
  border-bottom-color: #7e072a;
  outline: none
}
.section-search .search-form-container__button {
  height: 100%;
  position: absolute;
  top: 0
}
.section-search .search-form-container__button > svg {
  transform: scale(1.3)
}
.section-search .search-form-container__button--search {
  right: 2.5rem
}
.section-search .search-form-container__button--close {
  right: 0
}
@media (min-width:1280px) {
  .header-nav__mobile {
    overflow: hidden !important
  }
}
@media (max-width:1279px) {
  .header-nav__top {
    display: none
  }
  .header-nav__bottom__list {
    display: block;
    padding: 1rem 2rem 2rem;
    background-color: #fff
  }
  .header-nav__bottom__item {
    height: auto
  }
  .header-nav__bottom__link {
    display: block;
    padding: .2rem 1.5rem .2rem .5rem
  }
  .header-nav__bottom__link:after, .header-nav__bottom__link:before {
    content: none
  }
  .header-nav__bottom__link:active, .header-nav__bottom__link:focus, .header-nav__bottom__link:hover {
    background-color: #eff0f4;
    color: currentColor !important
  }
  .header-nav__bottom__link > svg {
    position: absolute;
    right: 0
  }
  .header-nav__bottom__search-toggler {
    margin-left: auto
  }
  .header-nav__bottom__search-toggler__label {
    display: none
  }
  .header-nav__bottom__nav-toggler {
    display: flex;
    align-items: center;
    margin-left: .5rem
  }
  .header-nav__bottom__toggler {
    display: none
  }
  .header-nav__bottom__outer-quick-list {
    display: block
  }
  .header-nav__bottom__outer-quick-list ul {
    padding: 2rem;
    margin-bottom: 0
  }
  .header-nav__bottom__outer-quick-list--primary {
    background-color: #7e072a;
    color: #fff !important
  }
  .header-nav__bottom__outer-quick-list--primary a {
    color: #fff !important
  }
  .header-nav__bottom__outer-quick-list--primary a:active, .header-nav__bottom__outer-quick-list--primary a:focus, .header-nav__bottom__outer-quick-list--primary a:hover {
    background-color: #8c0027;
    color: currentColor !important
  }
  .header-nav__bottom__outer-quick-list--secondary {
    background-color: #333;
    border-bottom: 1px solid #fff;
    color: #fff !important
  }
  .header-nav__bottom__outer-quick-list--secondary a {
    color: #fff !important
  }
  .header-nav__bottom__outer-quick-list--secondary a:active, .header-nav__bottom__outer-quick-list--secondary a:focus, .header-nav__bottom__outer-quick-list--secondary a:hover {
    background-color: #262626;
    color: currentColor !important
  }
  .header-nav__bottom__outer-quick-list--tertiary {
    background-color: #333;
    color: #fff !important
  }
  .header-nav__bottom__outer-quick-list--tertiary a {
    color: #fff !important;
    font-size: .8rem
  }
  .header-nav__logo {
    padding-top: 1rem;
    padding-bottom: 1rem
  }
  .header-nav__logo img {
    width: 12rem
  }
  .header-nav__mobile {
    display: none;
    overflow-y: auto
  }
  .header-nav__mobile--open {
    display: block;
    position: fixed;
    width: 33.3333333333%;
    height: 100%;
    background-color: #333;
    top: 0;
    right: 0;
    z-index: 2100;
    box-shadow: 0 0 1rem 0 rgba(0, 0, 0, .5)
  }
  .header-nav__mobile__direct-edit {
    display: inline-flex;
    margin: 0 .5rem
  }
  .header-nav__mobile__direct-edit > svg {
    fill: #fff;
    transform: scale(.8)
  }
  .header-nav__mobile__auth-user {
    display: flex;
    align-items: center;
    padding: .5rem 2.5rem;
    background-color: #7e072a
  }
  .header-nav__mobile__auth-user > a {
    display: inline-flex;
    align-items: center;
    color: #fff !important;
    font-weight: 600;
    font-size: .75rem;
    line-height: 1.4;
    letter-spacing: .07rem;
    text-transform: uppercase;
    font-weight: 700
  }
  .header-nav__mobile__auth-user > a svg {
    fill: #fff;
    margin-left: .25rem
  }
  .header-nav__mobile__close-toggler {
    display: flex;
    align-items: center;
    justify-content: flex-end;
    padding: 1rem;
    background-color: #fff
  }
  .header-nav__mobile__close-toggler__label {
    text-transform: uppercase;
    font-weight: 700;
    font-size: .8rem;
    margin-left: .25rem
  }
  .header-nav__mobile.slide-in-right {
    animation: .5s b
  }
  .header-nav__mobile.slide-out-right {
    animation: .5s c
  }
  .header-nav__mobile.slide-overlay:before {
    content: "";
    position: fixed;
    width: inherit;
    height: inherit;
    z-index: 110;
    background-color: rgba(0, 0, 0, .5)
  }
  .header-nav__dropdown-menu {
    width: 95%;
    height: 100%;
    top: 0;
    left: auto;
    right: 0;
    transform: none;
    flex-wrap: nowrap;
    border-top: none;
    border-bottom: none;
    background-color: #f4f4f4;
    box-shadow: 0 0 1rem 0 rgba(0, 0, 0, .5);
    overflow-y: auto
  }
  .header-nav__dropdown-menu__item > img {
    display: none
  }
  .header-nav__dropdown-menu--active {
    display: block
  }
  .header-nav__dropdown-menu--active.slide-in-right {
    width: 90%;
    transition: width .5s ease-out;
    animation: .5s b
  }
  .header-nav__dropdown-menu--active.slide-out-right {
    animation: .5s c
  }
  .header-nav__dropdown-menu__back-toggler {
    width: 100%;
    display: block;
    padding: 1rem 2rem 1rem 1.5rem;
    background-color: #fff
  }
  .header-nav__dropdown-menu__back-toggler__button {
    padding: 0
  }
  .header-nav__dropdown-menu__back-toggler__label {
    text-transform: uppercase;
    font-weight: 700;
    font-size: .8rem;
    margin-right: .5rem
  }
  .header-nav__dropdown-menu__sibling-link {
    display: block;
    background-color: #fff;
    padding: .5rem 2rem 1.75rem
  }
  .header-nav__dropdown-menu__sibling-link a {
    color: #333 !important;
    font-size: 1.2rem;
    font-weight: 700;
    text-decoration: none
  }
  .header-nav__dropdown-menu__sibling-link a:active, .header-nav__dropdown-menu__sibling-link a:focus, .header-nav__dropdown-menu__sibling-link a:hover {
    color: #7e072a !important
  }
  .header-nav__dropdown-menu__lists-widget {
    width: 100%;
    display: block;
    align-items: normal;
    flex-direction: row;
    padding: 0;
    margin-left: 0
  }
  .header-nav__dropdown-menu__lists-widget--top {
    display: block;
    width: 100%;
    padding: 0 2rem 2rem;
    background-color: #fff
  }
  .header-nav__dropdown-menu__lists-widget--top--list {
    margin-right: 0;
    margin-bottom: 2rem
  }
  .header-nav__dropdown-menu__lists-widget--top--list:last-child {
    margin-bottom: 0
  }
  .header-nav__dropdown-menu__lists-widget--bottom {
    display: block;
    border-top: none;
    margin-top: 0;
    padding: 2rem;
    width: 100%
  }
  .header-nav__dropdown-menu__lists-widget--bottom > li {
    display: block;
    padding: 0
  }
  .header-nav__dropdown-menu__lists-widget--bottom > li:first-child {
    display: block
  }
  .header-nav__dropdown-menu__images-widget {
    display: none
  }
  .section-header-nav__title > a {
    font-weight: 300;
    font-size: 2.5rem;
    line-height: 1.2;
    letter-spacing: .15rem;
    word-break: break-word;
    margin-bottom: 1rem
  }
  .section-header-nav__toggler {
    display: none
  }
}
@media (min-width:1200px) {
  .section-nav__link--active, .section-nav__link:hover {
    color: #f2edd6 !important
  }
  .section-nav__link--active:before, .section-nav__link:hover:before {
    position: absolute;
    content: "";
    display: block;
    width: 0;
    height: 0;
    pointer-events: none;
    top: 0;
    left: 45%;
    border: 7px solid hsla(0, 0%, 100%, 0);
    border-top-color: #7e072a
  }
  .section-nav__dropdown-menu li a:focus, .section-nav__dropdown-menu li a:hover {
    color: #f2edd6 !important
  }
}
@media (max-width:1199px) {
  .section-nav {
    background-color: transparent;
    padding: 0
  }
  .section-nav__button {
    display: flex
  }
  .section-nav__button > span {
    margin: 1rem 0 1rem 1rem;
    width: 80%;
    text-align: left
  }
  .section-nav__lists {
    position: absolute;
    top: 2.25rem;
    left: 0;
    width: 100%;
    max-height: 100vh;
    overflow: hidden;
    visibility: visible;
    transition: max-height .4s ease-in;
    background-color: #333;
    z-index: 100
  }
  .section-nav__lists--collapse {
    max-height: 0;
    visibility: hidden;
    transition: max-height .4s ease-out
  }
  .section-nav__item {
    display: block;
    border-top: 1px solid hsla(120, 9%, 91%, .2)
  }
  .section-nav__link {
    display: block;
    color: #fff !important;
    padding: .5rem 1rem
  }
  .section-nav__dropdown-menu {
    position: static;
    width: 100%;
    border-left: 5px solid hsla(120, 9%, 91%, .2)
  }
  .section-nav__dropdown-menu li a {
    padding: .5rem 1rem .5rem 1.5rem
  }
  .section-nav__search-toggler {
    display: none
  }
}
@media (max-width:1099px) {
  .header-nav__mobile--open {
    width: 50%
  }
  .header-nav__mobile.slide-overlay {
    width: 55%
  }
}
@media (max-width:691px) {
  .header-nav__dropdown-menu--active.slide-in-right, .header-nav__mobile--open, .header-nav__mobile.slide-overlay {
    width: 100%
  }
}
@media (max-width:480px) {
  .header-nav__bottom__nav-toggler__button > svg, .header-nav__bottom__search-toggler__button > svg {
    transform: scale(1)
  }
  .header-nav__bottom__nav-toggler {
    margin-left: -.25rem
  }
  .header-nav__logo img {
    width: 12rem
  }
  .site-search .search-form-container__button > svg {
    transform: scale(1)
  }
  .site-search .search-form-container__button--search {
    right: 2rem
  }
  .section-search .search-form-container__button > svg {
    transform: scale(1)
  }
  .section-search .search-form-container__button--search {
    right: 2rem
  }
}
.js .hero-banner {
  opacity: 0
}
.js.js-ready .hero-banner {
  opacity: 1
}
.hero-banner__wrapper {
  position: relative
}
.hero-banner__img {
  width: 100%;
  height: 700px
}
.hero-banner__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.hero-banner__block {
  width: 85%;
  position: absolute;
  top: 8rem;
  left: 5rem;
  padding: 2rem
}
.hero-banner__block__title {
  margin-bottom: 1rem;
  font-family: owners-wide, sans-serif;
  letter-spacing: .15rem;
  text-transform: uppercase;
  white-space: normal;
  word-break: break-word
}
.hero-banner__block__title > span {
  font-weight: 300;
  font-size: 3rem;
  line-height: 1.2;
  letter-spacing: .15rem;
  word-break: break-word;
  margin-bottom: 1rem
}
.hero-banner__block__desc, .hero-banner__block__title > span {
  color: #fff;
  background-color: rgba(51, 51, 51, .6);
  padding: .75rem 1.5rem
}
.hero-banner__block__desc {
  margin-top: 2.5rem
}
.hero-banner__block__button-link {
  display: none;
  margin-top: 1rem
}
.hero-banner__block__button-link:first-of-type {
  margin-right: 1rem
}
@media (max-width:1199px) {
  .hero-banner__block {
    left: 50%;
    transform: translateX(-50%);
    text-align: center;
    padding: 0
  }
  .hero-banner__block__title {
    background-color: rgba(51, 51, 51, .6);
    padding: .75rem 1.5rem
  }
  .hero-banner__block__title > span {
    background-color: transparent;
    padding: 0
  }
  .hero-banner__block__desc {
    margin-top: 2rem
  }
}
@media (max-width:767px) {
  .hero-banner__img {
    height: 800px
  }
  .hero-banner__block {
    top: 50%;
    transform: translateX(-50%) translateY(-50%)
  }
  .hero-banner__block__title > span {
    /*font-size: 2.5rem;*/
    font-size:1.8rem;
    line-height: 1.2;
    letter-spacing: -.01rem
  }
}
.js .sign-post {
  opacity: 0
}
.js.js-ready .sign-post {
  opacity: 1
}
.sign-post__img {
  width: 100%
}
.sign-post__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.js .banner-img-txt, .js .banner-img-txt-alt {
  opacity: 0
}
.js.js-ready .banner-img-txt, .js.js-ready .banner-img-txt-alt {
  opacity: 1
}
.banner-img-txt__col:last-child {
  display: flex;
  flex-wrap: wrap
}
.banner-img-txt__img {
  width: 100%
}
.banner-img-txt__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.banner-img-txt__block {
  display: flex;
  flex-direction: column;
  justify-content: center;
  background-color: #7e072a;
  color: #fff !important;
  padding: 2rem
}
.banner-img-txt__block__label {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  display: block;
  margin-bottom: .5rem
}
.banner-img-txt__block__title {
  margin-bottom: 1rem;
  white-space: normal;
  word-break: break-word
}
.banner-img-txt__block__title::before {
  content: "";
  display: block;
  margin-bottom: 10px;
  top: 15px;
  left: 30px;
  width: 50px;
  height: 3px;
  background-color: #dd3224
}
.banner-img-txt__block__title > span {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600
}
.banner-img-txt__block__link {
  color: #fff !important
}
.banner-img-txt__block__link > span {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase
}
.banner-img-txt__block__link > svg {
  fill: #fff
}
.banner-img-txt-alt__wrapper {
  position: relative;
  display: flex;
  flex-wrap: wrap
}
.banner-img-txt-alt__img {
  width: 100%
}
.banner-img-txt-alt__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.banner-img-txt-alt__block {
  position: absolute;
  padding: 2rem;
  width: 40%;
  height: 60%;
  right: 0;
  top: 50%;
  transform: translateY(-50%);
  background-color: #fff;
  color: #333 !important;
  display: flex;
  flex-direction: column;
  justify-content: center
}
.banner-img-txt-alt__block__label {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  display: block;
  margin-bottom: .5rem
}
.banner-img-txt-alt__block__title {
  margin-bottom: 1rem;
  white-space: normal;
  word-break: break-word
}
.banner-img-txt-alt__block__title > span {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600
}
.banner-img-txt-alt__block__link, .banner-img-txt-alt__block__link:hover {
  color: #7e072a
}
.banner-img-txt-alt__block__link > span {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase
}
.banner-img-txt-alt__block__link > svg {
  fill: #7e072a
}
@media (max-width:1400px) {
  .banner-img-txt__img {
    height: 450px
  }
  .banner-img-txt-alt__img {
    height: 750px
  }
}
@media (min-width:992px) {
  .banner-img-txt__col:first-child {
    padding-right: 0
  }
  .banner-img-txt__col:last-child {
    padding-left: 0
  }
}
@media (max-width:991px) {
  .banner-img-txt-alt__img, .banner-img-txt__img {
    height: auto
  }
  .banner-img-txt-alt__block {
    position: static;
    transform: translateY(0);
    width: 100%;
    height: 100%
  }
}
.js .featured-item-banner {
  opacity: 0
}
.js.js-ready .featured-item-banner {
  opacity: 1
}
.featured-item-banner__img {
  width: 100%;
  height: 82.5vh;
  min-height: 700px
}
.featured-item-banner__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.featured-item-banner__wrapper {
  position: relative;
  display: flex;
  flex-wrap: wrap
}
.featured-item-banner__block {
  position: absolute;
  width: 40%;
  bottom: 3rem;
  display: flex;
  flex-direction: column;
  justify-content: center;
  padding: 2rem;
  background-color: #fff
}
.featured-item-banner__block.left-position {
  left: 1rem
}
.featured-item-banner__block.right-position {
  right: 1rem
}
.featured-item-banner__block__link {
  display: block;
  color: #333 !important
}
.featured-item-banner__block__link:hover {
  text-decoration: none
}
.featured-item-banner__block__link:focus .featured-item-banner__block__link__text, .featured-item-banner__block__link:hover .featured-item-banner__block__link__text {
  text-decoration: underline
}
.featured-item-banner__block__img {
  width: 100%;
  margin-bottom: 2rem
}
.featured-item-banner__block__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.featured-item-banner__block__inner__label {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  display: block;
  margin-bottom: .5rem
}
.featured-item-banner__block__inner__title {
  margin-bottom: 1rem;
  white-space: normal;
  word-break: break-word
}
.featured-item-banner__block__inner__title > span {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600
}
.featured-item-banner__block__inner__text {
  color: #7e072a !important;
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase
}
.featured-item-banner__block__inner__text:hover {
  text-decoration: underline
}
.featured-item-banner__block__inner__text > svg {
  fill: #7e072a
}
.featured-item-banner__widget {
  position: absolute;
  width: 50%;
  bottom: 3rem
}
.featured-item-banner__widget--label > a, .featured-item-banner__widget--label > span {
  background-color: #7e072a;
  color: #fff !important;
  text-transform: uppercase;
  padding: .5rem 1.5rem
}
.featured-item-banner__widget--block {
  display: flex;
  background-color: #fff;
  margin-top: .3rem
}
.featured-item-banner__widget.left-position {
  left: 1rem
}
.featured-item-banner__widget.right-position {
  right: 1rem
}
.featured-item-banner__item {
  display: flex;
  flex: 0 0 50%;
  max-width: 50%;
  flex-direction: row;
  color: #333 !important;
  padding: 1rem
}
.featured-item-banner__item:hover {
  text-decoration: none
}
.featured-item-banner__item:focus .featured-item-banner__item__title, .featured-item-banner__item:hover .featured-item-banner__item__title {
  text-decoration: underline
}
.featured-item-banner__item__img img {
  width: 100px !important;
  height: 100px !important;
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.featured-item-banner__item__content {
  margin-left: 1rem
}
.featured-item-banner__item__label {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  display: block;
  margin-bottom: .5rem
}
.featured-item-banner__item__title {
  margin-bottom: 1rem;
  white-space: normal;
  word-break: break-word
}
.featured-item-banner__item__title > span {
  font-weight: 600
}
.featured-item-banner__caption {
  font-weight: 400;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  background-color: rgba(51, 51, 51, .6);
  color: #fff !important;
  position: absolute;
  right: 0;
  bottom: 0;
  padding: .5rem 1rem
}
@media (max-width:1199px) {
  .featured-item-banner__img {
    display: none
  }
  .featured-item-banner__wrapper {
    position: static;
    display: block;
    flex-wrap: nowrap
  }
  .featured-item-banner__block {
    position: static;
    transform: translateY(0);
    width: 100%;
    display: block;
    flex-direction: row;
    justify-content: initial;
    padding: 0
  }
  .featured-item-banner__block.left-position {
    left: 0
  }
  .featured-item-banner__block.right-position {
    right: 0
  }
  .featured-item-banner__block__img {
    height: auto;
    margin-bottom: 0
  }
  .featured-item-banner__block__inner {
    padding: 2rem;
    margin-bottom: 1rem
  }
  .featured-item-banner__widget {
    position: static;
    width: 100%
  }
  .featured-item-banner__widget--block {
    justify-content: space-between
  }
  .featured-item-banner__caption {
    display: none
  }
}
@media (max-width:767px) {
  .featured-item-banner__item {
    flex: none;
    max-width: none
  }
  .featured-item-banner__widget--block {
    display: block;
    justify-content: initial
  }
}
.js .box-img-text-card-type, .js .box-img-text-type-1, .js .box-img-text-type-2 {
  opacity: 0
}
.js.js-ready .box-img-text-card-type, .js.js-ready .box-img-text-type-1, .js.js-ready .box-img-text-type-2 {
  opacity: 1
}
.box-img-text-type-1__widget {
  display: flex;
  align-items: center;
  /*border-bottom: 1px solid #e7ebe7;*/
  border-bottom: none !important;
  padding: 0 2rem 2rem
}
.box-img-text-type-1__arrows > button {
  padding: 0
}
.box-img-text-type-1__arrows > button:first-child {
  margin-left: 0;
  margin-right: .25rem
}
.box-img-text-type-1__arrows > button:last-child {
  margin-left: .25rem;
  margin-right: 0
}
.box-img-text-type-1__arrows > button > svg {
  transform: scale(1.3);
  fill: #7e072a
}
.box-img-text-type-1__title {
  white-space: normal;
  margin-right: auto;
  margin-bottom: 0
}
.box-img-text-type-1__title > a {
  color: var(--Maroon, #7E072A);
  font-family: owners-wide, sans-serif;
  text-transform: uppercase;
  font-weight: 400;
  font-size: 2rem;
  line-height: 1.3;
  letter-spacing: .15rem;
  word-break: break-word;
  margin-bottom: 1rem
}
.box-img-text-type-1__track {
  margin-top: 2rem
}
.box-img-text-type-1__slide {
  display: block;
  margin: .25rem 2rem
}
.box-img-text-type-1__slide:hover {
  text-decoration: none
}
.box-img-text-type-1__slide:hover .box-img-text-type-1__slide__block__link {
  text-decoration: underline
}
.box-img-text-type-1__slide__img {
  width: 100%
}
.box-img-text-type-1__slide__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.box-img-text-type-1__slide__block {
  padding: 2.5rem 2rem;
  background-color: #FFF
}
.box-img-text-type-1__slide__block__title {
  margin-bottom: 1rem;
  white-space: normal;
  color: var(--Maroon, #7E072A);
  word-break: break-word
}
.box-img-text-type-1__slide__block__title::before {    
  content: "";    
  display: block;    
  margin-bottom: 10px;    
  top: 15px;    
  left: 30px;    
  width: 50px;    
  height: 3px;    
  background-color: #dd3224
}
.box-img-text-type-1__slide__block__title > span {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600
}
.box-img-text-type-1__slide__block__link {
  color: #7e072a !important;
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  display: flex;
  align-items: center;
  margin-bottom: 0
}
.box-img-text-type-1__slide__block__link > svg {
  fill: #7e072a
}
.box-img-text-type-2__wrapper {
  display: flex;
  flex-wrap: wrap
}
.box-img-text-type-2__glide {
  display: flex;
  flex-direction: row
}
.box-img-text-type-2__widget {
  width: 20%;
  padding: 2rem
}
.box-img-text-type-2__arrows > button {
  padding: 0
}
.box-img-text-type-2__arrows > button:first-child {
  margin-left: 0;
  margin-right: .25rem
}
.box-img-text-type-2__arrows > button:last-child {
  margin-left: .25rem;
  margin-right: 0
}
.box-img-text-type-2__arrows > button > svg {
  transform: scale(1.3);
  fill: #7e072a
}
.box-img-text-type-2__title {
  margin-bottom: 1rem;
  white-space: normal
}
.box-img-text-type-2__title > a {
  color: #333;
  font-weight: 400;
  font-size: 2rem;
  line-height: 1.3;
  word-break: break-word;
  margin-bottom: 1rem
}
.box-img-text-type-2__track {
  width: 80%
}
.box-img-text-type-2__slide {
  display: block;
  margin: .25rem
}
.box-img-text-type-2__slide:hover {
  text-decoration: none
}
.box-img-text-type-2__slide:hover .box-img-text-type-2__slide__block__link {
  text-decoration: underline
}
.box-img-text-type-2__slide__img {
  width: 100%
}
.box-img-text-type-2__slide__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.box-img-text-type-2__slide__block {
  padding: 2.5rem 2rem;
  background-color: inherit
}
.box-img-text-type-2__slide__block__title {
  margin-bottom: 1rem;
  white-space: normal;
  word-break: break-word
}
.box-img-text-type-2__slide__block__title > span {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600
}
.box-img-text-type-2__slide__block__link {
  color: #7e072a !important;
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase;
  display: flex;
  align-items: center;
  margin-bottom: 0
}
.box-img-text-type-2__slide__block__link > svg {
  fill: #7e072a
}
.box-img-text-card-type__wrapper {
  display: flex;
  flex-wrap: wrap
}
.box-img-text-card-type__card {
  position: relative;
  display: block;
  margin: 1rem;
  flex: 0 0 calc(25% - 2rem);
  max-width: calc(25% - 2rem)
}
.box-img-text-card-type__card:hover {
  text-decoration: none
}
.box-img-text-card-type__card:hover .box-img-text-card-type__card__block__link {
  text-decoration: underline
}
.box-img-text-card-type__card__button {
  background-color: #333;
  position: absolute;
  right: -.75rem;
  top: -.75rem;
  cursor: pointer;
  border-radius: 50%;
  padding: .35rem
}
.box-img-text-card-type__card__button svg {
  fill: #fff
}
.box-img-text-card-type__card__img {
  width: 100%
}
.box-img-text-card-type__card__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.box-img-text-card-type__card__block {
  padding: 2.5rem 2rem;
  background-color: inherit
}
.box-img-text-card-type__card__block__title {
  margin-bottom: 1rem;
  white-space: normal;
  word-break: break-word
}
.box-img-text-card-type__card__block__title > span {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600
}
.box-img-text-card-type__card__block__link {
  color: #7e072a !important;
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase;
  display: flex;
  align-items: center;
  margin-bottom: 0
}
.box-img-text-card-type__card__block__link > svg {
  fill: #7e072a
}
@media (max-width:1199px) {
  .box-img-text-card-type__card {
    flex: 0 0 calc(33.3333333333% - 2rem);
    max-width: calc(33.3333333333% - 2rem)
  }
}
@media (max-width:991px) {
  .box-img-text-type-2__glide {
    display: block;
    flex-direction: row
  }
  .box-img-text-type-2__widget {
    width: 100%;
    padding: 2rem 0 2rem 2rem;
    display: flex;
    align-items: center;
    border-bottom: 1px solid #e7ebe7
  }
  .box-img-text-type-2__arrows {
    padding-right: 2rem
  }
  .box-img-text-type-2__title {
    margin-right: auto;
    margin-bottom: 0
  }
  .box-img-text-type-2__track {
    width: 100%;
    margin-top: 2rem
  }
  .box-img-text-type-2__slide {
    margin: .25rem 2rem
  }
  .box-img-text-card-type__card {
    flex: 0 0 calc(50% - 2rem);
    max-width: calc(50% - 2rem)
  }
}
@media (max-width:767px) {
  .box-img-text-type-1__wrapper {
    margin-bottom: 2rem
  }
  .box-img-text-type-1__widget {
    padding-right: 0;
    border-bottom: none
  }
  .box-img-text-type-1__arrows {
    padding-right: 2rem
  }
  .box-img-text-type-1__track {
    margin-top: 0;
    padding: 0
  }
  .box-img-text-type-2__widget {
    border-bottom: none
  }
  .box-img-text-type-2__track {
    margin-top: 0
  }
  .box-img-text-card-type__card {
    flex: none;
    max-width: calc(100% - 2rem)
  }
}
@media (max-width:480px) {
  .box-img-text-type-1__title, .box-img-text-type-2__title {
    width: 150px
  }
}
.js .event, .js .events-card-type, .js .events-side-widget, .js .events-slider-type-1, .js .events-slider-type-2 {
  opacity: 0
}
.js.js-ready .event, .js.js-ready .events-card-type, .js.js-ready .events-side-widget, .js.js-ready .events-slider-type-1, .js.js-ready .events-slider-type-2 {
  opacity: 1
}
.event__card {
  display: flex;
  flex-direction: column;
  width: 300px;
  min-height: 300px;
  padding: 1rem;
  margin: 1rem;
  background-color: #e7ebe7;
  color: #333 !important;
  transition: background-color .3s ease-in-out, color .3s ease-in-out
}
.event__card:hover {
  text-decoration: none;
  background-color: #7e072a;
  color: #fff !important
}
.event__card__date {
  display: flex;
  margin-bottom: 1rem
}
.event__card__date--date {
  display: block;
  font-weight: 400;
  font-size: 1.625rem;
  line-height: 1.5;
  word-break: break-word;
  margin-bottom: 1rem
}
.event__card__date--month {
  display: block;
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem;
  font-weight: 600;
  margin-left: .5rem
}
.event__card__date--day {
  display: block;
  font-weight: 400;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  margin-left: .5rem
}
.event__card__title {
  display: block;
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600;
  margin-bottom: .5rem
}
.event__card__time {
  margin-bottom: .5rem
}
.event__card__time, .event__card__venue {
  display: block;
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem
}
.event__panel {
  display: flex;
  padding: 1rem
}
.event__panel__date {
  display: flex;
  width: 130px
}
.event__panel__date--date {
  display: block;
  font-weight: 400;
  font-size: 1.625rem;
  line-height: 1.5;
  word-break: break-word;
  margin-bottom: 1rem
}
.event__panel__date--month {
  display: block;
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem;
  font-weight: 600;
  margin-left: .5rem
}
.event__panel__date--day {
  display: block;
  font-weight: 400;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  margin-left: .5rem
}
.event__panel__title {
  display: block;
  font-weight: 600
}
.event__panel__title:hover {
  color: #7e072a !important
}
.event__panel__content {
  margin-left: 1rem;
  width: 100%
}
.events-card-type__wrapper {
  display: flex;
  flex-wrap: wrap;
  padding: 0 2rem
}
.events-card-type .event__card {
  flex: 0 0 calc(25% - 1.5rem);
  max-width: calc(25% - 1.5rem)
}
.events-card-type .event__card:first-child, .events-card-type .event__card:nth-child(4n+1) {
  margin-left: 0;
  margin-right: 1rem
}
.events-card-type .event__card:nth-child(4n) {
  margin-right: 0;
  margin-left: 1rem
}
.events-slider-type-1 .event__card {
  margin: 0;
  width: auto
}
.events-slider-type-1__slide {
  margin: .25rem 2rem
}
.events-slider-type-1__widget {
  display: flex;
  align-items: center;
  border-bottom: 1px solid #e7ebe7;
  padding: 0 2rem 2rem
}
.events-slider-type-1__arrows > button {
  padding: 0
}
.events-slider-type-1__arrows > button:first-child {
  margin-left: 0;
  margin-right: .25rem
}
.events-slider-type-1__arrows > button:last-child {
  margin-left: .25rem;
  margin-right: 0
}
.events-slider-type-1__arrows > button > svg {
  transform: scale(1.3);
  fill: #7e072a
}
.events-slider-type-1__title {
  white-space: normal;
  margin-right: auto;
  margin-bottom: 0
}
.events-slider-type-1__title > a {
  color: var(--Maroon, #7E072A);
  font-family: owners-wide, sans-serif;
  text-transform: uppercase;
  font-weight: 400;
  word-break: break-word;
  margin-bottom: 1rem;
  font-size: 2rem;
  line-height: 1.3
}
.events-slider-type-1__track {
  margin-top: 2rem
}
.events-slider-type-2 .event__card {
  margin: 0;
  width: auto
}
.events-slider-type-2__wrapper {
  display: flex;
  flex-wrap: wrap
}
.events-slider-type-2__glide {
  display: flex;
  flex-direction: row
}
.events-slider-type-2__slide {
  margin: .25rem
}
.events-slider-type-2__widget {
  width: 20%;
  padding: 2rem
}
.events-slider-type-2__arrows > button {
  padding: 0
}
.events-slider-type-2__arrows > button:first-child {
  margin-left: 0;
  margin-right: .25rem
}
.events-slider-type-2__arrows > button:last-child {
  margin-left: .25rem;
  margin-right: 0
}
.events-slider-type-2__arrows > button > svg {
  transform: scale(1.3);
  fill: #7e072a
}
.events-slider-type-2__title {
  margin-bottom: 1rem;
  white-space: normal
}
.events-slider-type-2__title > a {
  color: #333;
  font-weight: 400;
  font-size: 2rem;
  line-height: 1.3
}
.events-slider-type-2__track {
  margin-top: 2rem;
  width: 80%
}
.events-side-widget__wrapper {
  padding: 1rem
}
@media (max-width:1024px) {
  .events-card-type .event__card {
    flex: 0 0 calc(50% - 1rem);
    max-width: calc(50% - 1rem)
  }
  .events-card-type .event__card:nth-of-type(odd) {
    margin-left: 0;
    margin-right: 1rem
  }
  .events-card-type .event__card:nth-of-type(2n) {
    margin-right: 0;
    margin-left: 1rem
  }
}
@media (max-width:991px) {
  .events-slider-type-2__glide {
    display: block;
    flex-direction: row
  }
  .events-slider-type-2__widget {
    width: 100%;
    padding: 2rem 0 2rem 2rem;
    display: flex;
    align-items: center;
    border-bottom: 1px solid #e7ebe7
  }
  .events-slider-type-2__arrows {
    padding-right: 2rem
  }
  .events-slider-type-2__title {
    margin-right: auto;
    margin-bottom: 0
  }
  .events-slider-type-2__track {
    width: 100%
  }
  .events-slider-type-2__slide {
    margin: .25rem 2rem
  }
}
@media (max-width:575px) {
  .events-card-type .event__card {
    flex: auto;
    max-width: none;
    width: 100%
  }
  .events-card-type .event__card:nth-of-type(2n), .events-card-type .event__card:nth-of-type(odd) {
    margin-left: 0;
    margin-right: 0
  }
}
@media (max-width:480px) {
  .events-slider-type-1__title, .events-slider-type-2__title {
    width: 150px
  }
}
.js .featured-item-list {
  opacity: 0
}
.js.js-ready .featured-item-list {
  opacity: 1
}
.featured-item-list__col:first-child {
  padding-left: 0
}
.featured-item-list__col:last-child {
  padding-right: 0;
  padding-left: 2rem
}
.featured-item-list__featured {
  display: block;
  color: #333
}
.featured-item-list__featured:hover {
  text-decoration: none;
  color: #333
}
.featured-item-list__featured:hover .featured-item-list__featured__block__link {
  text-decoration: underline
}
.featured-item-list__featured__img {
  width: 100%
}
.featured-item-list__featured__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.featured-item-list__featured__block {
  padding: 2rem
}
.featured-item-list__featured__block__label {
  font-weight: 400;
  font-size: .9rem;
  line-height: 1.4;
  display: block;
  margin-bottom: .5rem
}
.featured-item-list__featured__block__title {
  margin-bottom: 1rem;
  white-space: normal;
  color: var(--Maroon, #7E072A);
  word-break: break-word
}
.featured-item-list__featured__block__title > span {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600
}
.featured-item-list__featured__block__link {
  font-weight: 600;
  color: #7e072a
}
.featured-item-list__featured__block__link > span {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem
}
.featured-item-list__featured__block__link > svg {
  fill: #7e072a
}
.featured-item-list__widget-item {
  display: block;
  color: #333 !important
}
.featured-item-list__widget-item:hover {
  text-decoration: none
}
.featured-item-list__widget-item:focus .featured-item-list__widget-item__block__title, .featured-item-list__widget-item:hover .featured-item-list__widget-item__block__title {
  text-decoration: underline
}
.featured-item-list__widget-item__img {
  width: 100%
}
.featured-item-list__widget-item__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.featured-item-list__widget-item__block {
  padding: 1rem 0;
  margin-bottom: 2rem
}
.featured-item-list__widget-item__block__label {
  font-weight: 400;
  font-size: .9rem;
  line-height: 1.4;
  display: block;
  margin-bottom: .5rem
}
.featured-item-list__widget-item__block__title {
  white-space: normal;
  color: var(--Maroon, #7E072A);
  word-break: break-word
}
.featured-item-list__widget-item__block__title > span {
  font-weight: 600
}
@media (max-width:1199px) {
  .featured-item-list__col:first-child {
    padding-right: 0
  }
  .featured-item-list__col:last-child {
    padding-left: 1rem;
    padding-right: 1rem
  }
  .featured-item-list__featured {
    display: flex;
    flex-direction: row-reverse;
    margin-bottom: 2rem
  }
  .featured-item-list__featured__block, .featured-item-list__featured__img {
    width: 50%
  }
  .featured-item-list__widget-item {
    display: flex;
    flex-direction: row;
    padding: 1rem;
    margin-bottom: 1rem
  }
  .featured-item-list__widget-item__img {
    width: auto;
    height: auto
  }
  .featured-item-list__widget-item__img > img {
    width: 100px;
    height: 100px
  }
  .featured-item-list__widget-item__block {
    padding: 0;
    margin-bottom: 0;
    margin-left: 1rem
  }
}
@media (max-width:991px) {
  .featured-item-list__featured {
    display: block;
    flex-direction: row;
    margin-bottom: 1rem
  }
  .featured-item-list__featured__block, .featured-item-list__featured__img {
    width: 100%
  }
}
@media (max-width:767px) {
  .featured-item-list__featured {
    display: block;
    flex-direction: row;
    margin-bottom: 1rem
  }
  .featured-item-list__featured__block, .featured-item-list__featured__img {
    width: 100%
  }
  .featured-item-list__widget {
    margin-bottom: 1rem
  }
  .featured-item-list__widget-item {
    margin-bottom: 0
  }
}
.js .carousel {
  opacity: 0
}
.js.js-ready .carousel {
  opacity: 1
}
.carousel__glide {
  position: relative
}
.carousel__slide {
  display: flex;
  flex-direction: row-reverse
}
.carousel__slide__block {
  display: flex;
  flex-direction: column;
  justify-content: center;
  width: 40%;
  padding: 2rem
}
.carousel__slide__block__label {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  display: block;
  margin-bottom: .5rem
}
.carousel__slide__block__title {
  margin-bottom: 1rem;
  white-space: normal;
  word-break: break-word
}
.carousel__slide__block__title > span {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600
}
.carousel__slide__block__link {
  font-weight: 600
}
.carousel__slide__block__link:hover {
  color: #7e072a !important
}
.carousel__slide__block__link > span {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase
}
.carousel__slide__block__link > svg {
  fill: #7e072a
}
.carousel__slide__img {
  width: 60%
}
.carousel__slide__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.carousel__arrows {
  position: absolute;
  left: 40%;
  bottom: 0;
  transform: translateX(-50%)
}
@media (max-width:1400px) {
  .carousel__slide__img {
    height: 400px
  }
}
@media (max-width:991px) {
  .carousel__slide {
    display: block
  }
  .carousel__slide__block {
    width: 100%
  }
  .carousel__slide__img {
    width: 100%;
    height: auto
  }
  .carousel__arrows {
    right: 0;
    top: 0;
    left: auto;
    transform: none
  }
}
@media (max-width:767px) {
  .carousel__slide {
    display: block
  }
  .carousel__slide__block {
    width: 100%
  }
  .carousel__slide__img {
    width: 100%;
    height: auto
  }
  .carousel__arrows {
    right: 0;
    top: 0;
    left: auto;
    transform: none
  }
}
.js .header-bullet-list {
  opacity: 0
}
.js.js-ready .header-bullet-list {
  opacity: 1
}
.header-bullet-list__wrapper {
  padding: 0 2rem
}
.header-bullet-list__col {
  margin-bottom: 2rem
}
.header-bullet-list__title {
  margin-bottom: 2rem;
  white-space: normal;
  word-break: break-word
}
.header-bullet-list__title > span {
  font-weight: 400;
  font-size: 2rem;
  line-height: 1.3;
  word-break: break-word;
  margin-bottom: 1rem
}
.card {
  border: 1px solid #d7d2cb;
  padding: 2rem;
  height: 100%;
  overflow: hidden
}
.card__title {
  white-space: normal
}
.card__title, .card__title > span {
  margin-bottom: 1rem;
  word-break: break-word
}
.card__title > span {
  font-weight: 400;
  font-size: 2rem;
  line-height: 1.3
}
.card__body {
  list-style: disc inside
}
.card__body li > a:hover {
  color: #7e072a
}
.card ul {
  list-style: initial;
  margin: 0 0 1.25rem;
  padding: 0 0 0 2.5rem
}
.card ul li {
  margin: 0 0 .5rem
}
.card ul li ul {
  margin-top: .75rem
}
.js .call-out, .js .img-call-out {
  opacity: 0
}
.js.js-ready .call-out, .js.js-ready .img-call-out {
  opacity: 1
}
.call-out__block {
  padding: 2rem
}
.call-out__block__content {
  padding: 2rem;
  text-align: center
}
.bg-primary .call-out__block__content {
  border: 1px solid #fff
}
.call-out__block__content p {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5
}
.call-out__block__content span {
  display: block
}
.call-out__block__content a, .call-out__block__content span {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  font-weight: 700
}
.call-out__block__content a {
  border-bottom: 1px solid #e7ebe7;
  padding-bottom: .25rem
}
.call-out__block__content a:hover {
  text-decoration: none;
  border-bottom: 1px solid #7e072a
}
.call-out__block.bg-black .call-out__block__content a, .call-out__block.bg-primary .call-out__block__content a, .call-out__block.bg-secondary-blue .call-out__block__content a {
  color: #fff;
  border-bottom: 1px solid hsla(0, 0%, 100%, .5)
}
.call-out__block.bg-black .call-out__block__content a:hover, .call-out__block.bg-primary .call-out__block__content a:hover, .call-out__block.bg-secondary-blue .call-out__block__content a:hover {
  border-bottom: 1px solid #fff
}
.call-out__block.bg-secondary-grey-10 .call-out__block__content a {
  color: #7e072a;
  border-bottom: 1px solid #cbd3cb
}
.call-out__block.bg-secondary-grey-10 .call-out__block__content a:hover {
  border-bottom: 1px solid #7e072a
}
.img-call-out__wrapper {
  display: flex
}
.img-call-out__img {
  position: relative;
  width: 50%
}
.img-call-out__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.img-call-out__caption {
  font-weight: 400;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  background-color: rgba(51, 51, 51, .6);
  color: #fff !important;
  position: absolute;
  right: 0;
  bottom: 0;
  padding: .5rem 1rem
}
.img-call-out__block {
  width: 50%;
  padding: 2rem
}
.img-call-out__block__content {
  padding: 2rem;
  height: 100%;
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  justify-content: flex-end
}
.bg-primary .img-call-out__block__content {
  border: 1px solid #fff
}
.img-call-out__block__content p {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  text-align: left
}
.img-call-out__block__content a, .img-call-out__block__content span {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  font-weight: 700;
  text-align: right
}
.img-call-out__block__content a {
  border-bottom: 1px solid #e7ebe7;
  padding-bottom: .25rem
}
.img-call-out__block__content a:hover {
  text-decoration: none;
  border-bottom: 1px solid #7e072a
}
.img-call-out__block.bg-primary .img-call-out__block__content a {
  color: #fff;
  border-bottom: 1px solid hsla(0, 0%, 100%, .5)
}
.img-call-out__block.bg-primary .img-call-out__block__content a:hover {
  border-bottom: 1px solid #fff
}
.img-call-out__block.bg-black .img-call-out__block__content a {
  color: #fff;
  border-bottom: 1px solid hsla(0, 0%, 100%, .5)
}
.img-call-out__block.bg-black .img-call-out__block__content a:hover {
  border-bottom: 1px solid #fff
}
.img-call-out__block.bg-secondary-grey-10 .img-call-out__block__content a {
  color: #7e072a;
  border-bottom: 1px solid #cbd3cb
}
.img-call-out__block.bg-secondary-grey-10 .img-call-out__block__content a:hover {
  border-bottom: 1px solid #7e072a
}
@media (max-width:991px) {
  .img-call-out__wrapper {
    display: block
  }
  .img-call-out__block, .img-call-out__img {
    width: 100%
  }
}
.js .tabs-ct {
  opacity: 0
}
.js.js-ready .tabs-ct {
  opacity: 1
}
.tabs-ct__wrapper {
  padding: 0 2rem
}
.tabs-ct a {
  color: #006e97;
  border-bottom: 1px solid #e7ebe7;
  font-weight: 600
}
.tabs-ct a:hover {
  text-decoration: none;
  border-bottom: 1px solid #006e97
}
.tabs-ct .general-content {
  padding: 0;
  margin-bottom: 0
}
.tabs-ct .general-content ul.tabs {
  padding-left: 0
}
.js .accordion-ct {
  opacity: 0
}
.js.js-ready .accordion-ct {
  opacity: 1
}
.accordion-ct__wrapper {
  padding: 0 2rem
}
.accordion-ct a {
  color: #006e97;
  border-bottom: 1px solid #e7ebe7;
  font-weight: 600
}
.accordion-ct a:hover {
  text-decoration: none;
  border-bottom: 1px solid #006e97
}
.accordion-ct .tabs.col-md-6:first-child {
  padding-right: 1rem
}
.accordion-ct .tabs.col-md-6:last-child {
  padding-left: 1rem
}
.accordion-ct .general-content:not(.row) {
  padding: 0;
  margin-bottom: 0
}
.accordion-ct .general-content.row {
  padding: 0 1rem
}
.accordion-ct .general-content ul.tabs {
  padding-left: 0
}
@media (max-width:767px) {
  .accordion-ct .tabs.col-md-6 {
    margin-bottom: 5px
  }
  .accordion-ct .tabs.col-md-6:first-child {
    padding-right: 0
  }
  .accordion-ct .tabs.col-md-6:last-child {
    padding-left: 0;
    margin-bottom: 1rem
  }
}
.js .header-button {
  opacity: 0
}
.js.js-ready .header-button {
  opacity: 1
}
.header-button__wrapper {
  display: block;
  padding: 0 2rem
}
.header-button__wrapper:hover {
  text-decoration: none
}
.header-button__title {
  white-space: normal;
  word-break: break-word;
  margin-right: 2rem;
  width: 40%
}
.header-button__title > span {
  font-weight: 400;
  font-size: 2rem;
  line-height: 1.3;
  word-break: break-word;
  margin-bottom: 1rem
}
.header-button__block {
  display: flex;
  justify-content: space-between;
  align-items: center;
  background-color: #7e072a;
  color: #fff !important;
  padding: 2rem
}
.header-button__button {
  display: flex;
  align-items: center;
  justify-content: flex-end;
  width: calc(60% - 2rem);
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase
}
.header-button__button > span {
  display: inline-block
}
.header-button__button .btn-text {
  text-align: right;
  width: calc(100% - 48px - 1rem)
}
.header-button__button .btn-arrow-icon {
  position: relative;
  width: 48px;
  height: 48px;
  padding: .75rem;
  margin-left: 1rem;
  background-color: #fff
}
.header-button__button .btn-arrow-icon:before {
  position: absolute;
  content: "";
  display: block;
  width: 0;
  height: 0;
  pointer-events: none;
  top: 1.05rem;
  left: 45%;
  border: 7px solid hsla(0, 0%, 100%, 0);
  border-left-color: #7e072a
}
@media (max-width:991px) {
  .header-button__title {
    margin-bottom: 1.5rem;
    margin-right: 0;
    width: auto
  }
  .header-button__block {
    display: block
  }
  .header-button__button {
    width: auto
  }
}
.js .list-featured-img {
  opacity: 0
}
.js.js-ready .list-featured-img {
  opacity: 1
}
.list-featured-img {
  background-color: #FFFFFF;
  color: #333 !important;
  padding: 2rem
}
.list-featured-img__title {
  white-space: normal;
  word-break: break-word
}
.list-featured-img__title > span {
  font-weight: 400;
  font-family: owners-wide, sans-serif;
  font-size: 2rem;
  line-height: 1.3;
  letter-spacing: .15rem;
  word-break: break-word;
  text-transform: uppercase;
  margin-bottom: 1rem
}
.list-featured-img__block {
  margin-top: 2rem;
  margin-right: 5rem
}
.list-featured-img__block__list {
  margin-top: 2rem
}
.list-featured-img__item {
  border-top: 2px solid var(--Red, #DD3224)
}
.list-featured-img__item:last-child {
  border-bottom: 2px solid var(--Red, #DD3224)
}
.list-featured-img__link {
  display: flex;
  justify-content: space-between;
  align-items: center;
  padding: 1rem 0;
  font-weight: 600
}
.list-featured-img__link:hover {
  color: #7e072a !important;
  text-decoration: none
}
.list-featured-img__link:focus .list-featured-img__link__text, .list-featured-img__link:hover .list-featured-img__link__text {
  text-decoration: underline
}
.list-featured-img__link:hover .list-featured-img__link__caption {
  text-decoration: none
}
.list-featured-img__link__text {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase;
  margin-right: .5rem
}
.list-featured-img__link__caption {
  font-weight: 400;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  color: #333 !important;
  display: block;
  margin-top: .25rem
}
.list-featured-img__link > svg {
  fill: #7e072a;
  margin-left: 1rem
}
.list-featured-img__img-block {
  margin-top: 2rem;
  display: flex
}
.list-featured-img__img {
  width: 100%;
  position: relative
}
.list-featured-img__img:first-child {
  margin-right: 2rem
}
.list-featured-img__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.list-featured-img__img__link {
  background-color: #7e072a;
  color: #fff !important;
  font-weight: 600;
  display: block;
  width: 100%;
  position: absolute;
  left: 0;
  bottom: 0;
  padding: .75rem 1rem;
  text-align: center
}
@media (max-width:1199px) {
  .list-featured-img__block {
    margin-right: 0
  }
  .list-featured-img__list--col:first-child {
    padding-right: 3rem
  }
  .list-featured-img__list--col:last-child {
    padding-left: 3rem
  }
  .list-featured-img__img-block {
    margin-top: 2rem
  }
  .list-featured-img__img:first-child {
    margin-right: 6rem
  }
}
@media (max-width:767px) {
  .list-featured-img__list--col:first-child {
    padding-right: 1rem;
    margin-bottom: 0
  }
  .list-featured-img__list--col:first-child > li:last-child {
    border-bottom: none
  }
  .list-featured-img__list--col:last-child {
    padding-left: 1rem
  }
  .list-featured-img__img-block {
    display: block
  }
  .list-featured-img__img {
    height: 300px
  }
  .list-featured-img__img:first-child {
    margin-right: 0;
    margin-bottom: 2rem
  }
}
@media (max-width:575px) {
  .list-featured-img__img {
    height: auto
  }
}
.js .cta-box {
  opacity: 0
}
.js.js-ready .cta-box {
  opacity: 1
}
.cta-box__heading {
  width: 100%;
  margin-bottom: 3rem;
  position: relative
}
.cta-box__heading__title {
  font-weight: 600;
  font-size: 1.25rem;
  line-height: 1.5;
  word-break: break-word;
  margin-bottom: 1rem;
  margin-bottom: 0 !important;
  width: 80%
}
.cta-box__heading > a {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase;
  position: absolute;
  top: .5rem;
  right: 0;
  display: none;
  text-align: right
}
.cta-box__col:last-child {
  border-right: none
}
.cta-box__col--3 {
  flex: 0 0 33.3333333333%;
  max-width: 33.3333333333%
}
.cta-box__col--3:not(:nth-child(3n+3)) {
  border-right: 1px solid #fff
}
.cta-box__col--3 .cta-box__img {
  height: 375px
}
.cta-box__col--5 {
  flex: 0 0 20%;
  max-width: 20%
}
.cta-box__col--5:not(:nth-child(5n+5)) {
  border-right: 1px solid #fff
}
.cta-box__col--5 .cta-box__img {
  height: 225px
}
.cta-box__img {
  width: 100%
}
.cta-box__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.cta-box__block {
  display: block;
  padding: 2rem
}
.cta-box__block:hover {
  text-decoration: none
}
.cta-box__block:hover .cta-box__block__link {
  text-decoration: underline
}
.cta-box__block__title {
  margin-bottom: 1rem;
  white-space: normal;
  word-break: break-word
}
.cta-box__block__title::before {
  content: "";
  display: block;
  margin-bottom: 10px;
  top: 15px;
  left: 30px;
  width: 50px;
  height: 3px;
  background-color: #dd3224
}
.cta-box__block__title > span {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  line-height: 1.25
}
.cta-box__block__link {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase;
  display: flex;
  align-items: center
}
.cta-box__block.bg-primary:focus, .cta-box__block.bg-primary:hover {
  background-color: #7e072a !important
}
.cta-box__block.bg-primary .cta-box__block__link {
  color: #fff !important
}
.cta-box__block.bg-primary .cta-box__block__link > svg {
  fill: #fff
}
.cta-box__block.bg-secondary-grey-10:focus, .cta-box__block.bg-secondary-grey-10:hover {
  background-color: #e7ebe7 !important
}
.cta-box__block.bg-secondary-grey-10 .cta-box__block__link {
  color: #7e072a !important
}
.cta-box__block.bg-secondary-grey-10 .cta-box__block__link > svg {
  fill: #7e072a
}
@media (max-width:1280px) {
  .cta-box__heading > a {
    right: 2rem
  }
}
@media (min-width:992px) {
  .cta-box__container {
    position: relative
  }
  .cta-box__heading__title {
    position: absolute
  }
  .cta-box__center {
    justify-content: center
  }
  .cta-box__mobile > a {
    font-weight: 600;
    font-size: .94rem;
    line-height: 1.4;
    letter-spacing: .03rem;
    text-transform: uppercase;
    position: absolute;
    top: .5rem;
    right: 0;
    display: block;
    text-align: right
  }
}
@media (max-width:991px) {
  .cta-box__heading {
    position: static;
    margin-bottom: 0
  }
  .cta-box__heading__title {
    width: 100%
  }
  .cta-box__heading > a {
    display: none
  }
  .cta-box__col {
    display: flex;
    flex-direction: row;
    padding: 1.5rem 2rem;
    border-right: none !important;
    border-bottom: 1px solid #e7ebe7
  }
  .cta-box__col--3, .cta-box__col--5 {
    flex: none;
    width: 100%;
    max-width: 100%
  }
  .cta-box__col--3 .cta-box__img, .cta-box__col--5 .cta-box__img {
    height: auto
  }
  .cta-box__col.cta-box-mobile-bg-primary {
    background-color: #7e072a;
    border-bottom-color: #fff
  }
  .cta-box__col.cta-box-mobile-bg-primary .cta-box__block {
    background-color: #7e072a !important;
    color: #fff !important
  }
  .cta-box__col.cta-box-mobile-bg-primary .cta-box__block__link {
    color: #fff !important
  }
  .cta-box__col.cta-box-mobile-bg-primary .cta-box__block__link > svg {
    fill: #fff
  }
  .cta-box__col.cta-box-mobile-bg-secondary-grey-10 {
    background-color: #e7ebe7;
    border-bottom-color: #fff
  }
  .cta-box__col.cta-box-mobile-bg-secondary-grey-10 .cta-box__block {
    background-color: #e7ebe7 !important;
    color: #333 !important
  }
  .cta-box__img {
    width: auto
  }
  .cta-box__img img {
    width: 150px !important;
    height: 150px !important
  }
  .cta-box__block {
    padding: 0 1rem;
    width: 100%;
    height: auto !important;
    background-image: none;
    background-color: #fff !important;
    color: #333 !important
  }
  .cta-box__block.bg-primary .cta-box__block__link {
    color: #fff !important
  }
  .cta-box__block.bg-primary .cta-box__block__link > svg {
    fill: #fff
  }
  .cta-box__block.bg-secondary-grey-10 .cta-box__block__link {
    color: #7e072a !important
  }
  .cta-box__block.bg-secondary-grey-10 .cta-box__block__link > svg {
    fill: #7e072a
  }
  .cta-box__block.bg-primary:focus, .cta-box__block.bg-primary:hover, .cta-box__block.bg-secondary-grey-10:focus, .cta-box__block.bg-secondary-grey-10:hover {
    background-color: transparent !important
  }
  .cta-box__mobile {
    justify-content: flex-end
  }
  .cta-box__mobile > a {
    font-weight: 600;
    font-size: .94rem;
    line-height: 1.4;
    letter-spacing: .03rem;
    text-transform: uppercase;
    display: inline-block;
    text-align: right;
    margin-top: 1.5rem;
    margin-right: 2rem
  }
}
.js .video-panel {
  opacity: 0
}
.js.js-ready .video-panel {
  opacity: 1
}
.video-panel__wrapper {
  display: flex;
  flex-wrap: wrap;
  margin-bottom: -1px
}
.video-panel__block {
  background-repeat: no-repeat;
  background-position: 50%;
  background-size: cover;
  display: flex;
  flex-direction: column;
  justify-content: center;
  width: 30%;
  padding: 3rem
}
.video-panel__block:hover {
  text-decoration: none
}
.video-panel__block:hover .video-panel__block__link {
  text-decoration: underline
}
.video-panel__block__title {
  position: relative;
  z-index: 1;
  white-space: normal;
  word-break: break-word;
  margin-bottom: 1rem
}
.video-panel__block__title::before {
    content: "";
    display: block;
    margin-bottom: 10px;
    top: 15px;
    left: 30px;
    width: 50px;
    height: 3px;
    background-color: #dd3224;
}
.video-panel__block__title > span {
  font-size: 2rem;
  line-height: 1.2;
  letter-spacing: -.03rem
}
.video-panel__block__content {
  position: relative;
  z-index: 1
}
.video-panel__block__link {
  font-weight: 600;
  margin-bottom: 0
}
.video-panel__block__link > span {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase
}
.video-panel__block.bg-primary {
  position: relative
}
.video-panel__block.bg-primary:before {
  content: "";
  position: absolute;
  top: 0;
  left: 0;
  right: 0;
  bottom: 0;
  width: 100%;
  height: 100%;
  background-color: rgba(144, 0, 40, .9);
  margin: auto
}
.video-panel__block.bg-primary .video-panel__block__link {
  color: #fff !important
}
.video-panel__block.bg-primary .video-panel__block__link > svg {
  fill: #fff
}
.video-panel__block.bg-secondary-grey-10 {
  position: relative
}
.video-panel__block.bg-secondary-grey-10:before {
  content: "";
  position: absolute;
  top: 0;
  left: 0;
  right: 0;
  bottom: 0;
  width: 100%;
  height: 100%;
  background-color: hsla(120, 9%, 91%, .9);
  margin: auto
}
.video-panel__block.bg-secondary-grey-10 .video-panel__block__link {
  color: #7e072a
}
.video-panel__block.bg-secondary-grey-10 .video-panel__block__link > svg {
  fill: #7e072a
}
.video-panel__video {
  display: flex;
  width: 70%
}
.video-panel__video--youtube {
  overflow: hidden;
  padding-bottom: 29.6%;
  height: auto;
  position: relative
}
.video-panel__video--youtube iframe {
  position: absolute;
  right: 0;
  top: 0;
  height: 100%;
  width: 100%
}
.video-panel__video--mp4 {
  position: relative;
  height: 100%
}
.video-panel__video--mp4 video {
  position: relative;
  display: block;
  max-width: 100%;
  cursor: pointer;
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.video-panel__video--vimeo {
  overflow: hidden;
  padding-bottom: 39.6%;
  height: auto;
  position: relative
}
.video-panel__video--vimeo iframe {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%
}
@media (max-width:1279px) {
  .video-panel__wrapper.left-block-right-video {
    flex-direction: column-reverse
  }
  .video-panel__wrapper.right-block-left-video {
    flex-direction: column
  }
  .video-panel__block {
    width: 100%
  }
  .video-panel__video {
    width: 100%;
    margin-bottom: -1px
  }
  .video-panel__video--youtube {
    padding-bottom: 42%
  }
  .video-panel__video--mp4 {
    height: auto
  }
  .video-panel__video--vimeo {
    padding-bottom: 57%
  }
}
.js .video-content {
  opacity: 0
}
.js.js-ready .video-content {
  opacity: 1
}
.video-content__wrapper:after {
  content: "";
  clear: both;
  display: table
}
.video-content__wrapper.right-video .video-content__video {
  float: right;
  margin-left: 2rem !important;
  margin-bottom: 1rem !important
}
.video-content__wrapper.right-video .video-content__video--youtube {
  height: 100%
}
.video-content__wrapper.right-video .video-content__content {
  margin-top: 0
}
.video-content__wrapper.left-video .video-content__video {
  float: left;
  margin-right: 2rem !important;
  margin-bottom: 1rem !important
}
.video-content__wrapper.left-video .video-content__video--youtube {
  height: 100%
}
.video-content__wrapper.left-video .video-content__content {
  margin-top: 0
}
.video-content__wrapper.left-video.sm-video .video-content__video, .video-content__wrapper.right-video.sm-video .video-content__video {
  width: 30%
}
.video-content__wrapper.left-video.sm-video .video-content__video--youtube, .video-content__wrapper.right-video.sm-video .video-content__video--youtube {
  padding-bottom: 15%
}
.video-content__wrapper.left-video.sm-video .video-content__video--vimeo, .video-content__wrapper.right-video.sm-video .video-content__video--vimeo {
  padding-bottom: 17.5%
}
.video-content__wrapper.left-video.md-video .video-content__video, .video-content__wrapper.right-video.md-video .video-content__video {
  width: 40%
}
.video-content__wrapper.left-video.md-video .video-content__video--vimeo, .video-content__wrapper.left-video.md-video .video-content__video--youtube, .video-content__wrapper.right-video.md-video .video-content__video--vimeo, .video-content__wrapper.right-video.md-video .video-content__video--youtube {
  padding-bottom: 22.5%
}
.video-content__wrapper.left-video.lg-video .video-content__video, .video-content__wrapper.right-video.lg-video .video-content__video {
  width: 50%
}
.video-content__wrapper.left-video.lg-video .video-content__video--youtube, .video-content__wrapper.right-video.lg-video .video-content__video--youtube {
  padding-bottom: 27.5%
}
.video-content__wrapper.left-video.lg-video .video-content__video--vimeo, .video-content__wrapper.right-video.lg-video .video-content__video--vimeo {
  padding-bottom: 28%
}
.video-content__wrapper.left-video.full-video .video-content__video, .video-content__wrapper.right-video.full-video .video-content__video {
  width: 60%
}
.video-content__wrapper.left-video.full-video .video-content__video--youtube, .video-content__wrapper.right-video.full-video .video-content__video--youtube {
  padding-bottom: 29.6%
}
.video-content__wrapper.left-video.full-video .video-content__video--vimeo, .video-content__wrapper.right-video.full-video .video-content__video--vimeo {
  padding-bottom: 33.5%
}
.video-content__wrapper.sm-video .video-content__video {
  width: 40%;
  margin: 0 auto
}
.video-content__wrapper.sm-video .video-content__video--vimeo, .video-content__wrapper.sm-video .video-content__video--youtube {
  padding-bottom: 22.5%
}
.video-content__wrapper.md-video .video-content__video {
  width: 60%;
  margin: 0 auto
}
.video-content__wrapper.md-video .video-content__video--vimeo, .video-content__wrapper.md-video .video-content__video--youtube {
  padding-bottom: 30%
}
.video-content__wrapper.lg-video .video-content__video {
  width: 80%;
  margin: 0 auto
}
.video-content__wrapper.lg-video .video-content__video--vimeo, .video-content__wrapper.lg-video .video-content__video--youtube {
  padding-bottom: 45%
}
.video-content__wrapper.full-video .video-content__video {
  width: 100%
}
.video-content__video {
  display: flex
}
.video-content__video--youtube {
  overflow: hidden;
  padding-bottom: 56.25%;
  height: auto;
  position: relative
}
.video-content__video--youtube iframe {
  position: absolute;
  right: 0;
  top: 0;
  height: 100%;
  width: 100%
}
.video-content__video--vimeo {
  overflow: hidden;
  padding-bottom: 57%;
  height: auto;
  position: relative
}
.video-content__video--vimeo iframe {
  position: absolute;
  top: 0;
  left: 0;
  width: 100%;
  height: 100%
}
.video-content__video--mp4 {
  position: relative;
  height: 100%
}
.video-content__video--mp4 video {
  position: relative;
  display: block;
  max-width: 100%;
  cursor: pointer;
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.video-content__content {
  margin-top: 2rem
}
.video-content__content.general-content {
  padding: 0
}
@media (max-width:1279px) {
  .video-content__wrapper {
    padding: 0 2rem
  }
}
@media (max-width:991px) {
  .video-content__wrapper:after {
    content: none
  }
  .video-content__wrapper.right-video .video-content__video {
    float: none;
    margin-left: auto !important;
    margin-bottom: 0 !important
  }
  .video-content__wrapper.right-video .video-content__content {
    margin-top: 2rem
  }
  .video-content__wrapper.left-video .video-content__video {
    float: none;
    margin-right: auto !important;
    margin-bottom: 0 !important
  }
  .video-content__wrapper.left-video .video-content__content {
    margin-top: 2rem
  }
  .video-content__wrapper.left-video.full-video .video-content__video, .video-content__wrapper.left-video.lg-video .video-content__video, .video-content__wrapper.left-video.md-video .video-content__video, .video-content__wrapper.left-video.sm-video .video-content__video, .video-content__wrapper.right-video.full-video .video-content__video, .video-content__wrapper.right-video.lg-video .video-content__video, .video-content__wrapper.right-video.md-video .video-content__video, .video-content__wrapper.right-video.sm-video .video-content__video {
    width: 100%
  }
  .video-content__wrapper.left-video.full-video .video-content__video--youtube, .video-content__wrapper.left-video.lg-video .video-content__video--youtube, .video-content__wrapper.left-video.md-video .video-content__video--youtube, .video-content__wrapper.left-video.sm-video .video-content__video--youtube, .video-content__wrapper.right-video.full-video .video-content__video--youtube, .video-content__wrapper.right-video.lg-video .video-content__video--youtube, .video-content__wrapper.right-video.md-video .video-content__video--youtube, .video-content__wrapper.right-video.sm-video .video-content__video--youtube {
    padding-bottom: 56.25%
  }
  .video-content__wrapper.left-video.full-video .video-content__video--vimeo, .video-content__wrapper.left-video.lg-video .video-content__video--vimeo, .video-content__wrapper.left-video.md-video .video-content__video--vimeo, .video-content__wrapper.left-video.sm-video .video-content__video--vimeo, .video-content__wrapper.right-video.full-video .video-content__video--vimeo, .video-content__wrapper.right-video.lg-video .video-content__video--vimeo, .video-content__wrapper.right-video.md-video .video-content__video--vimeo, .video-content__wrapper.right-video.sm-video .video-content__video--vimeo {
    padding-bottom: 57%
  }
  .video-content__wrapper.left-video.full-video .video-content__content, .video-content__wrapper.left-video.lg-video .video-content__content, .video-content__wrapper.left-video.md-video .video-content__content, .video-content__wrapper.left-video.sm-video .video-content__content, .video-content__wrapper.right-video.full-video .video-content__content, .video-content__wrapper.right-video.lg-video .video-content__content, .video-content__wrapper.right-video.md-video .video-content__content, .video-content__wrapper.right-video.sm-video .video-content__content {
    width: 100%;
    padding: 0
  }
  .video-content__wrapper.full-video .video-content__video, .video-content__wrapper.lg-video .video-content__video, .video-content__wrapper.md-video .video-content__video, .video-content__wrapper.sm-video .video-content__video {
    width: 100%
  }
  .video-content__wrapper.full-video .video-content__video--youtube, .video-content__wrapper.lg-video .video-content__video--youtube, .video-content__wrapper.md-video .video-content__video--youtube, .video-content__wrapper.sm-video .video-content__video--youtube {
    padding-bottom: 56.25%
  }
  .video-content__wrapper.full-video .video-content__video--vimeo, .video-content__wrapper.lg-video .video-content__video--vimeo, .video-content__wrapper.md-video .video-content__video--vimeo, .video-content__wrapper.sm-video .video-content__video--vimeo {
    padding-bottom: 57%
  }
}
.js .site-wide-notice {
  opacity: 0
}
.js.js-ready .site-wide-notice {
  opacity: 1
}
.site-wide-notice {
  background-color: #ffdf00;
  color: #333 !important
}
.site-wide-notice__wrapper {
  padding: 1.5rem 1rem
}
.site-wide-notice__date {
  font-weight: 700;
  margin-right: .5rem
}
.site-wide-notice__message {
  margin-right: .5rem
}
.site-wide-notice__link {
  font-weight: 700;
  color: #333 !important
}
.js .general-content {
  opacity: 0
}
.js.js-ready .general-content {
  opacity: 1
}
.general-content .tabs > li, .general-content .tabs button.tabs__nav-link {
  margin: 0
}
.general-content__title {
  white-space: normal;
  word-break: break-word;
  margin-top: 2rem;
  margin-bottom: 2rem;
  color: #7e072a;
  font-weight: 300 !important;
  font-size: 3.125rem !important;
  line-height: 1.2 !important;
  letter-spacing: -.03rem !important
}
.general-content__block {
  margin-bottom: 2rem
}
.general-content__block:after {
  content: "";
  clear: both;
  display: table
}
.general-content__block > img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.general-content__img-auto:after {
  content: "";
  clear: both;
  display: block
}
.general-content__img-left-auto-mg, .general-content__img-right-auto-mg {
  margin-bottom: 1rem
}
.general-content__img-left-auto-mg p, .general-content__img-right-auto-mg p {
  width: 100%;
  background-color: #7e072a;
  color: #fff !important;
  padding: 1.5rem;
  margin-top: -1rem !important;
  margin-bottom: 1rem
}
.general-content__img-block {
  min-width: 30%;
  max-width: 30%
}
.general-content__img-block--left {
  float: left;
  margin-right: 2rem
}
.general-content__img-block--right {
  float: right;
  margin-left: 2rem
}
.general-content__img-block--fullwidth {
  float: none;
  min-width: 90%;
  max-width: 90%;
  display: block;
  margin: 0 auto
}
.general-content__img-block img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.general-content__img-block-caption, .general-content__img-caption {
  width: 100%;
  background-color: #7e072a;
  color: #fff !important;
  padding: 1.5rem;
  margin-top: -1rem;
  margin-bottom: 1rem
}
.general-content img {
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;";
  max-width: 100%;
  margin-bottom: 1rem
}
.general-content h1 {
  font-size: 3.125rem;
  letter-spacing: -.03rem
}
.general-content h1, .general-content h2 {
  font-weight: 700;
  line-height: 1.2;
  word-break: break-word;
  margin-bottom: 1rem
}
.general-content h2 {
  font-size: 2.5rem;
  letter-spacing: -.01rem
}
.general-content h3 {
  font-size: 2rem;
  line-height: 1.3
}
.general-content h3, .general-content h4 {
  font-weight: 400;
  word-break: break-word;
  margin-bottom: 1rem
}
.general-content h4 {
  font-size: 1.625rem;
  line-height: 1.5
}
.general-content h5 {
  font-size: 1.25rem;
  line-height: 1.5
}
.general-content h5, .general-content h6 {
  font-weight: 600;
  word-break: break-word;
  margin-bottom: 1rem
}
.general-content h6 {
  letter-spacing: .01rem
}
.general-content .body-regular-font {
  font-size: 1rem;
  line-height: 1.6;
  letter-spacing: 0;
  padding: 0;
  margin-bottom: 1.25rem !important
}
.general-content .body-lead-font {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5
}
.general-content .body-small-font {
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem
}
.general-content .overline-font {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase
}
.general-content .caption-font {
  font-weight: 400;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem
}
.general-content .button-font {
  font-weight: 600;
  font-size: 1.125rem;
  line-height: 1.25rem
}
.general-content .cta-link-font {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase
}
.general-content .h1-font {
  font-size: 3.125rem;
  letter-spacing: -.03rem
}
.general-content .h1-font, .general-content .h2-font {
  font-weight: 300;
  line-height: 1.2;
  word-break: break-word;
  margin-top: 0;
  margin-bottom: 1rem
}
.general-content .h2-font {
  font-size: 2.5rem;
  letter-spacing: -.01rem
}
.general-content .h3-font {
  font-size: 2rem;
  line-height: 1.3
}
.general-content .h3-font, .general-content .h4-font {
  font-weight: 400;
  word-break: break-word;
  margin-top: 0;
  margin-bottom: 1rem
}
.general-content .h4-font {
  font-size: 1.625rem;
  line-height: 1.5
}
.general-content .h5-font {
  font-size: 1.25rem;
  line-height: 1.5
}
.general-content .h5-font, .general-content .h6-font {
  font-weight: 600;
  word-break: break-word;
  margin-top: 0;
  margin-bottom: 1rem
}
.general-content .h6-font {
  letter-spacing: .01rem
}
.general-content .italic {
  font-style: italic
}
.general-content .italic-bold {
  font-style: italic;
  font-weight: 600
}
.general-content .bold {
  font-weight: 600
}
.general-content .text-white {
  color: #fff
}
.general-content .text-primary {
  color: #7e072a
}
.general-content .text-dark-grey {
  color: #707070
}
.general-content p > span {
  text-decoration: none !important
}
.general-content p.link-icon {
  color: #7e072a
}
.general-content p.link-icon a {
  color: #7e072a;
  border-bottom: none !important
}
.general-content p.link-icon a:hover {
  text-decoration: underline;
  color: inherit
}
.general-content p.link-icon a > svg {
  transform: scale(.9)
}
.general-content .timepicker .timepicker-picker p.btn-primary, .general-content p.btn-left-add-icon-primary, .general-content p.btn-left-add-icon-secondary, .general-content p.btn-primary, .general-content p.btn-right-arrow-icon-primary, .general-content p.btn-right-arrow-icon-secondary, .general-content p.btn-secondary, .timepicker .timepicker-picker .general-content p.btn-primary {
  cursor: pointer;
  padding: 0;
  margin-right: .75rem
}
.general-content .timepicker .timepicker-picker p.btn-primary a, .general-content p.btn-left-add-icon-primary a, .general-content p.btn-left-add-icon-secondary a, .general-content p.btn-primary a, .general-content p.btn-right-arrow-icon-primary a, .general-content p.btn-right-arrow-icon-secondary a, .general-content p.btn-secondary a, .timepicker .timepicker-picker .general-content p.btn-primary a {
  display: inline-block;
  padding: .5rem 1.5rem;
  border-bottom: none !important
}
.general-content p.btn-left-add-icon-primary a:hover, .general-content p.btn-left-add-icon-secondary a:hover, .general-content p.btn-primary a:hover, .general-content p.btn-right-arrow-icon-primary a:hover, .general-content p.btn-right-arrow-icon-secondary a:hover, .general-content p.btn-secondary a:hover {
  text-decoration: none;
  color: inherit
}
.general-content p.btn-left-add-icon-primary a:last-child, .general-content p.btn-left-add-icon-secondary a:last-child, .general-content p.btn-primary a:last-child, .general-content p.btn-right-arrow-icon-primary a:last-child, .general-content p.btn-right-arrow-icon-secondary a:last-child, .general-content p.btn-secondary a:last-child {
  margin-right: 0
}
.general-content .timepicker .timepicker-picker p.btn-primary a > svg, .general-content p.btn-left-add-icon-primary a > svg, .general-content p.btn-left-add-icon-secondary a > svg, .general-content p.btn-primary a > svg, .general-content p.btn-right-arrow-icon-primary a > svg, .general-content p.btn-right-arrow-icon-secondary a > svg, .general-content p.btn-secondary a > svg, .timepicker .timepicker-picker .general-content p.btn-primary a > svg {
  transform: scale(.9)
}
.general-content .timepicker .timepicker-picker p.btn-primary, .general-content .timepicker .timepicker-picker p.btn-primary a, .general-content p.btn-left-add-icon-primary, .general-content p.btn-left-add-icon-primary a, .general-content p.btn-primary, .general-content p.btn-primary a, .general-content p.btn-right-arrow-icon-primary, .general-content p.btn-right-arrow-icon-primary a, .timepicker .timepicker-picker .general-content p.btn-primary, .timepicker .timepicker-picker .general-content p.btn-primary a {
  color: #fff
}
.general-content p.btn-left-add-icon-secondary, .general-content p.btn-left-add-icon-secondary a, .general-content p.btn-right-arrow-icon-secondary, .general-content p.btn-right-arrow-icon-secondary a, .general-content p.btn-secondary, .general-content p.btn-secondary a {
  color: #333
}
.general-content a {
  color: #006e97;
  font-weight: 600;
  border-bottom: 1px solid #e7ebe7
}
.general-content a:hover {
  color: #006e97;
  border-bottom: 1px solid #006e97;
  text-decoration: none
}
.general-content a:visited {
  color: #006b93
}
.general-content .button {
  margin-bottom: 1.25rem;
  margin-right: .75rem;
  border-bottom: none
}
.general-content .button:hover {
  border-bottom: none
}
.general-content .button:last-child {
  margin-right: 0
}
.general-content button {
  margin-right: .75rem;
  margin-bottom: 1rem
}
.general-content button:last-child {
  margin-right: 0
}
.general-content ul {
  list-style: disc inside;
  margin: 0 0 1.25rem;
  padding: 0 0 0 2.5rem
}
.general-content ul li {
  margin: 0 0 .5rem
}
.general-content ul li ul {
  margin-top: .75rem
}
.general-content ol {
  margin: 0 0 1.25rem;
  padding: 0 0 0 2.5rem;
  list-style: decimal inside
}
.general-content ol li {
  margin: 0 0 .5rem
}
.general-content ol li ol {
  margin-top: .75rem
}
.general-content .table-responsive {
  display: block;
  overflow-x: auto
}
.general-content .table-responsive table {
  width: 100%;
  display: table !important;
  overflow: inherit !important
}
.general-content blockquote {
  border-left: 5px solid #7e072a;
  padding: 2rem;
  margin-bottom: 1.25rem
}
.general-content blockquote footer {
  font-style: italic
}
.general-content pre code {
  display: block;
  padding: 1rem;
  white-space: pre
}
.general-content dl {
  margin-bottom: 1.25rem
}
.general-content dl dt {
  margin-bottom: 1rem
}
.general-content dl dd {
  margin-left: 1rem;
  margin-bottom: 1rem
}
@media (max-width:575px) {
  .general-content__img-left-auto-mg, .general-content__img-right-auto-mg {
    margin-bottom: 2rem
  }
  .general-content__img-block {
    max-width: none
  }
  .general-content__img-block--left {
    float: none;
    margin-right: 0
  }
  .general-content__img-block--right {
    float: none;
    margin-left: 0
  }
  .general-content__img-block--fullwidth {
    width: 100%
  }
  .general-content__img-block img {
    margin-bottom: 0 !important
  }
  .general-content__img-block-caption {
    margin-top: 0
  }
}
@media (max-width:480px) {
  .general-content__img-block img {
    width: 100%;
    height: 100%
  }
}
.js .button-ct {
  opacity: 0
}
.js.js-ready .button-ct {
  opacity: 1
}
.button-ct__link {
  display: block !important;
  margin: 2rem 0;
  padding: 1.25rem !important
}
.button-ct__link:first-child {
  margin-top: 0
}
.js .statistics-blocks {
  opacity: 0
}
.js.js-ready .statistics-blocks {
  opacity: 1
}
.statistics-blocks__block__inner {
  text-align: center;
  display: flex;
  flex-direction: column;
  justify-content: center;
  align-items: center;
  height: 100%;
  overflow: hidden;
  padding: 2rem
}
.statistics-blocks__block span {
  display: block;
  width: 100%
}
.statistics-blocks__block__number {
  font-weight: 300;
  font-size: 2.5rem;
  line-height: 1.2;
  letter-spacing: -.01rem;
  word-break: break-word;
  margin-bottom: 1rem;
  margin-bottom: .5rem
}
.statistics-blocks__block__title {
  font-weight: 600;
  font-size: 1.25rem;
  line-height: 1.5;
  word-break: break-word;
  margin-bottom: 1rem;
  opacity: .8;
  margin-bottom: .5rem
}
.statistics-blocks__block__caption {
  font-size: .9rem;
  opacity: .8
}
@media (max-width:350px) {
  .statistics-blocks__block__number {
    font-weight: 600;
    font-size: 1.25rem;
    line-height: 1.5
  }
  .statistics-blocks__block__title {
    font-weight: 600;
    font-size: .94rem;
    line-height: 1.4;
    letter-spacing: .03rem
  }
  .statistics-blocks__block__caption {
    font-weight: 400;
    font-size: .75rem;
    line-height: 1.4;
    letter-spacing: .07rem
  }
}
.js .side-contact {
  opacity: 0
}
.js.js-ready .side-contact {
  opacity: 1
}
.side-contact {
  text-align: right
}
.side-contact img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;";
  margin-bottom: 1rem;
  width: 200px;
  height: 200px
}
.side-contact > span {
  display: block;
  margin-bottom: .5rem
}
.side-contact ul {
  list-style: disc inside
}
.side-contact__title {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  color: #707070
}
.side-contact__email a:hover {
  color: #7e072a
}
@media (max-width:991px) {
  .side-contact {
    padding: 0 2rem
  }
  .side-contact__title {
    color: #707070;
    font-weight: 400;
    font-size: 1.625rem;
    line-height: 1.5;
    word-break: break-word;
    margin-bottom: 1rem
  }
  .side-contact__desc {
    max-width: 25ch;
    margin-left: auto
  }
}
@media (max-width:300px) {
  .side-contact img {
    width: 100%;
    height: auto
  }
}
.js .side-content {
  opacity: 0
}
.js.js-ready .side-content {
  opacity: 1
}
.side-content.general-content {
  padding: 0
}
.side-content.general-content .body-lead-font {
  color: #707070
}
.side-content.general-content p.btn-left-add-icon-primary, .side-content.general-content p.btn-left-add-icon-secondary, .side-content.general-content p.btn-primary, .side-content.general-content p.btn-right-arrow-icon-primary, .side-content.general-content p.btn-right-arrow-icon-secondary, .side-content.general-content p.btn-secondary {
  display: block;
  margin-right: 0
}
.side-content.general-content ul {
  text-align: left;
  margin: 0 0 1.25rem;
  padding: 0 0 0 1rem
}
.side-content.general-content ul li {
  margin: 0 0 .25rem
}
.side-content.general-content ul li ul {
  margin-top: .5rem;
  margin-bottom: .5rem
}
.side-content.general-content ol {
  text-align: left;
  margin: 0 0 1.25rem;
  padding: 0 0 0 1rem
}
.side-content.general-content ol li {
  margin: 0 0 .25rem
}
.side-content.general-content ol li ol {
  margin-top: .5rem;
  margin-bottom: .5rem
}
.side-content.general-content img {
  margin-bottom: 1rem;
  max-width: 100%;
  width: 100%
}
.side-content .item-list ol, .side-content .item-list ul {
  list-style: none;
  text-align: right
}
.side-content .item-list ol li, .side-content .item-list ul li {
  margin-bottom: 1rem
}
@media (max-width:991px) {
  .side-content.general-content {
    padding: 0 2rem
  }
  .side-content.general-content ul {
    margin: 0 0 1.25rem
  }
  .side-content.general-content ul li {
    margin: 0 0 .5rem
  }
  .side-content.general-content ul li ul {
    margin-top: .75rem;
    margin-bottom: 1.25rem
  }
  .side-content.general-content ol {
    margin: 0 0 1.25rem
  }
  .side-content.general-content ol li {
    margin: 0 0 .5rem
  }
  .side-content.general-content ol li ol {
    margin-top: .75rem;
    margin-bottom: 1.25rem
  }
  .side-content.general-content img {
    width: auto;
    height: auto
  }
}
.js .side-social {
  opacity: 0
}
.js.js-ready .side-social {
  opacity: 1
}
@media (max-width:991px) {
  .side-social {
    padding: 0 2rem
  }
}
.js .infographic {
  opacity: 0
}
.js.js-ready .infographic {
  opacity: 1
}
.infographic__widget {
  padding: 0 2rem
}
.infographic__title {
  white-space: normal;
  margin-right: auto;
  text-align: center
}
.infographic__title > span {
  font-weight: 400;
  font-size: 2rem;
  line-height: 1.3;
  word-break: break-word;
  margin-bottom: 1rem
}
.infographic__slides {
  display: flex;
  flex-wrap: wrap
}
.infographic__slide {
  position: relative;
  display: flex;
  justify-content: center;
  flex-direction: column;
  align-items: center;
  text-align: center;
  padding: 3rem;
  flex: 0 0 33.3%;
  max-width: 33.3%;
  border-bottom: 1px solid #7e072a
}
.infographic__slide:before {
  content: "";
  position: absolute;
  right: 0;
  top: 50%;
  transform: translateY(-50%);
  width: 1px;
  height: 70%
}
.infographic__slide:not(:nth-child(3n+3)):before {
  background-color: #7e072a
}
.infographic__slide:nth-last-child(-n+3) {
  border-bottom: none
}
.infographic__slide__font-type-1 {
  font-size: 2rem;
  line-height: 1.3;
  color: #7e072a;
  white-space: normal
}
.infographic__slide__font-type-1, .infographic__slide__font-type-2 {
  font-weight: 400;
  margin-bottom: 1rem;
  font-weight: 700;
  word-break: break-word;
  margin-bottom: .5rem
}
.infographic__slide__font-type-2 {
  font-size: 1.625rem;
  line-height: 1.5;
  text-transform: uppercase
}
.infographic__slide__font-type-3 {
  font-weight: 600;
  font-size: 1.25rem;
  line-height: 1.5;
  word-break: break-word;
  margin-bottom: 1rem;
  margin-bottom: .5rem
}
.infographic__slide__font-type-4 {
  font-weight: 600;
  letter-spacing: .01rem;
  word-break: break-word;
  margin-bottom: 1rem;
  text-transform: uppercase;
  margin-top: .5rem
}
.infographic__slide__img {
  display: inline-block;
  margin-right: auto;
  margin-left: auto
}
.infographic__slide__img:hover {
  text-decoration: none
}
.infographic__slide__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.infographic__slide__img--top {
  width: 100px;
  height: 100px;
  margin-bottom: 1rem
}
.infographic__slide__img--bottom {
  width: 80px;
  height: 80px;
  margin-top: 1rem;
  margin-bottom: 1rem
}
.infographic__arrows {
  display: none
}
@media (max-width:991px) {
  .infographic__title {
    text-align: left
  }
  .infographic__track {
    border-bottom: 1px solid #e7ebe7
  }
  .infographic__slides {
    flex-wrap: nowrap
  }
  .infographic__slide {
    border-bottom: none;
    flex: none
  }
  .infographic__slide:before {
    height: 100%;
    background-color: #e7ebe7 !important
  }
  .infographic__widget {
    padding-bottom: 2rem;
    display: flex;
    align-items: center;
    border-bottom: 1px solid #e7ebe7
  }
  .infographic__arrows {
    display: block
  }
  .infographic__arrows > button {
    padding: 0
  }
  .infographic__arrows > button:first-child {
    margin-left: 0;
    margin-right: .25rem
  }
  .infographic__arrows > button:last-child {
    margin-left: .25rem;
    margin-right: 0
  }
  .infographic__arrows > button > svg {
    transform: scale(1.3);
    fill: #7e072a
  }
}
@media (max-width:767px) {
  .infographic__widget {
    border-bottom: none
  }
  .infographic__slide {
    padding: 2rem
  }
  .infographic__slide:before {
    content: none
  }
}
@media (max-width:575px) {
  .infographic__title {
    width: 80%
  }
}
@media (max-width:480px) {
  .infographic__title {
    width: 150px
  }
}
.js .gallery {
  opacity: 0
}
.js.js-ready .gallery {
  opacity: 1
}
.gallery__wrapper {
  margin-top: 2rem;
  margin-bottom: 2rem
}
.gallery .glide__slide {
  position: relative
}
.gallery .glide__slide:before {
  content: "";
  position: absolute;
  top: 0;
  left: 0;
  right: 0;
  bottom: 0;
  width: inherit;
  height: inherit;
  background-color: rgba(0, 0, 0, .7);
  z-index: 10;
  transition: background-color .3s ease-in-out
}
.gallery .glide__slide--active {
  margin-top: 0;
  transition: margin-top .25s ease-in-out
}
.gallery .glide__slide--active:before {
  background-color: transparent;
  transition: background-color .3s ease-in-out
}
.gallery__glide, .gallery__slide {
  position: relative
}
.gallery__slide {
  margin-top: 2rem;
  transition: margin-top .25s ease-in-out
}
.gallery__slide__img {
  width: 100%
}
.gallery__slide__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.gallery__slide__block {
  width: 100%;
  padding: .75rem 1.25rem
}
.gallery__slide__block__title {
  margin-bottom: 1rem;
  white-space: normal;
  word-break: break-word
}
.gallery__slide__block__title > span {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase
}
.gallery__slide__block__content p {
  font-weight: 400;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem
}
.gallery__block {
  width: 40vw;
  padding: 3rem 1rem;
  margin: 2rem auto 4rem;
  background-color: #fff;
  border-bottom: 3px solid #7e072a
}
.gallery__block__title {
  margin-bottom: 1rem;
  white-space: normal;
  word-break: break-word
}
.gallery__block__title > span {
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600
}
.gallery__block__link {
  font-weight: 600
}
.gallery__block__link:hover {
  color: #7e072a !important
}
.gallery__block__link > span {
  font-weight: 600;
  font-size: .94rem;
  line-height: 1.4;
  letter-spacing: .03rem;
  text-transform: uppercase
}
.gallery__block__link > svg {
  fill: #7e072a
}
@media (min-width:992px) {
  .gallery__arrows {
    width: 40vw;
    position: static;
    margin: 2rem auto 0;
    display: flex;
    justify-content: flex-end
  }
  .gallery__block {
    padding-top: 0
  }
}
@media (max-width:991px) {
  .gallery__arrows {
    position: absolute;
    bottom: -3.5rem;
    right: 20vw
  }
  .gallery__block {
    width: 60vw
  }
}
@media (max-width:767px) {
  .gallery__slide__img {
    width: 100%
  }
  .gallery__slide__img img {
    width: 100%;
    height: 100%;
    -o-object-fit: cover;
    object-fit: cover;
    font-family: "object-fit: cover; object-position: 50% 50%;"
  }
  .gallery__slide__block {
    position: static
  }
}
.js .program-search {
  opacity: 0
}
.js.js-ready .program-search {
  opacity: 1
}
.program-search {
  padding: 2rem;
  margin: 0 auto
}
.program-search__title {
  margin-bottom: 2rem;
  white-space: normal;
  word-break: break-word
}
.program-search__title > span {
  font-weight: 300;
  font-size: 3.125rem;
  line-height: 1.2;
  letter-spacing: -.03rem;
  word-break: break-word;
  margin-bottom: 1rem
}
.program-search__form {
  display: block;
  border-bottom: 2px solid #7e072a;
  border-top: 2px solid #7e072a;
  padding-top: 2.5rem;
  padding-bottom: 2rem
}
.program-search__form__controls {
  display: flex;
  align-items: center;
  justify-content: flex-start;
  margin-top: 2rem
}
.program-search__form__controls__label {
  font-weight: 600;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  font-weight: 700;
  margin-right: 2rem
}
@media (max-width:1399px) {
  .program-search__form__controls__label {
    display: block;
    margin-bottom: 1.5rem
  }
}
@media (max-width:1399px) {
  .program-search__form__controls {
    display: block
  }
}
@media (max-width:767px) {
  .program-search__form__controls {
    display: block
  }
}
.program-search__form__toggle {
  margin: .5rem 1rem .5rem 0;
  word-break: break-all
}
@media (max-width:767px) {
  .program-search__form__toggle {
    display: block;
    width: 100%;
    margin-top: 1rem;
    margin-bottom: 1rem
  }
}
.program-search__form__clear {
  word-break: break-all;
  margin: .5rem 0
}
@media (max-width:767px) {
  .program-search__form__clear {
    display: block;
    margin-top: 1rem;
    margin-bottom: .5rem
  }
}
.program-search__form__input {
  display: flex;
  align-items: center
}
.program-search__form__input input {
  width: 100%;
  height: 40px;
  padding-left: 1rem;
  padding-right: 1rem;
  border: 1px solid #e7ebe7
}
@media (max-width:480px) {
  .program-search__form__input button {
    display: block;
    width: 100%;
    height: auto;
    margin-top: 1rem;
    word-break: break-all
  }
}
@media (max-width:480px) {
  .program-search__form__input {
    display: block
  }
}
.program-search__form__filters {
  display: none;
  margin-top: 2rem
}
.program-search__form__filters.active {
  display: block
}
.program-search__form__filters__heading {
  font-weight: 400;
  font-size: 1.625rem;
  line-height: 1.5;
  word-break: break-word;
  margin-bottom: 1rem;
  display: inline-block;
  margin-bottom: 2rem;
  border-bottom: 2px solid #7e072a
}
.program-search__form__filters select {
  width: 100%;
  padding-left: 1rem
}
.program-search__form__filters .checkbox {
  width: 50%;
  float: left
}
@media (max-width:767px) {
  .program-search__form__filters .checkbox {
    width: 100%
  }
}
.program-search__form__filters .form-group {
  margin-bottom: 0 !important
}
.program-search__results {
  margin-top: 2rem
}
.program-search__results__item {
  box-sizing: border-box;
  position: relative;
  padding: 1rem;
  overflow: hidden;
  cursor: pointer
}
.program-search__results__item:hover img {
  transform: scale(1.1)
}
.program-search__results__item:hover .program-search__results__item__title {
  transition: border-color .3s ease-in-out
}
.program-search__results__item:hover .program-search__results__item__title.bg-primary {
  border-top: 4px solid #fff
}
.program-search__results__item:hover .program-search__results__item__title.bg-secondary-grey-10 {
  border-top: 4px solid #7e072a
}
.program-search__results__item:focus {
  box-shadow: 0 0 5px #006e97;
  outline: 1px solid rgba(229, 240, 244, .1) !important
}
.program-search__results__item img {
  position: relative;
  height: 180px !important;
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;";
  transition: all .3s;
  z-index: -2
}
@media (max-width:1400px) {
  .program-search__results__item img {
    height: 150px !important
  }
}
@media (max-width:1199px) {
  .program-search__results__item img {
    height: 180px !important
  }
}
@media (max-width:767px) {
  .program-search__results__item img {
    height: 250px !important
  }
}
@media (max-width:575px) {
  .program-search__results__item img {
    height: 200px !important
  }
}
@media (max-width:480px) {
  .program-search__results__item img {
    height: 130px !important
  }
}
.program-search__results__item__title {
  position: relative;
  z-index: 1;
  display: block;
  padding: .5rem 1.5rem;
  height: 100%;
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  font-weight: 600
}
.program-search__results__item__title.bg-primary {
  border-top: 4px solid #7e072a
}
.program-search__results__item__title.bg-secondary-grey-10 {
  color: #7e072a !important;
  border-top: 4px solid #e7ebe7
}
.program-search__results__info {
  height: 100%;
  overflow: hidden;
  padding: 0 0 .5rem
}
.program-search__pagination, .program-search__pagination-wrapper {
  width: 100%;
  text-align: center
}
.program-search__pagination {
  margin-top: 1rem;
  background-color: #fff;
  padding: .5rem 1rem;
  text-decoration: none;
  color: #7e072a;
  display: inline-block;
  box-sizing: border-box
}
.program-search__pagination li {
  margin: 0 auto;
  display: inline-block;
  width: auto
}
.program-search__pagination li a {
  display: block;
  font-weight: 400;
  font-size: 1.25rem;
  line-height: 1.5;
  border: 1px solid #7e072a;
  background-color: #7e072a;
  color: #fff;
  padding: .25rem .85rem;
  margin-right: .25rem
}
.program-search__pagination li a:hover {
  text-decoration: underline
}
.program-search__pagination li a.active {
  background-color: #fff;
  color: #7e072a;
  cursor: default
}
.program-search .popup-modal {
  height: auto;
  width: 650px;
  max-width: 90%;
  background-color: #fff;
  position: fixed;
  left: 50%;
  top: 50%;
  transform: translate(-50%, -50%);
  padding: 2rem;
  display: none;
  z-index: 1020
}
.program-search .popup-modal__title {
  font-weight: 400;
  font-size: 2rem;
  line-height: 1.3;
  word-break: break-word;
  margin-bottom: 1rem;
  margin-bottom: 1.5rem
}
.program-search .popup-modal__more {
  margin-top: 1.5rem
}
.program-search .popup-modal__close {
  background-color: #7e072a;
  position: absolute;
  right: -.75rem;
  top: -.75rem;
  cursor: pointer;
  padding: .35rem .5rem
}
.program-search .popup-modal__close svg {
  fill: #fff
}
@media (max-width:1199px) {
  .program-search {
    padding: 2rem
  }
}
.js .profile {
  opacity: 0
}
.js.js-ready .profile {
  opacity: 1
}
.profile__wrapper {
  display: flex;
  padding: 2rem;
  background-color: #fff;
  color: #333 !important;
  border-top: 1px solid #e7ebe7
}
.profile__wrapper.flex-row-left .profile__content {
  margin-left: 2rem
}
.profile__wrapper.flex-row-right .profile__content {
  margin-right: 2rem
}
.profile__img img {
  width: 240px !important;
  height: 240px !important;
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.profile__name {
  white-space: normal
}
.profile__name, .profile__name > span {
  margin-bottom: 1rem;
  word-break: break-word
}
.profile__name > span {
  font-weight: 400;
  font-size: 2rem;
  line-height: 1.3
}
.profile p {
  margin-bottom: .25rem
}
.profile__testimony {
  margin-top: 1.5rem
}
@media (max-width:767px) {
  .profile__wrapper {
    display: block
  }
  .profile__wrapper.flex-row-left .profile__content, .profile__wrapper.flex-row-right .profile__content {
    margin-left: 0
  }
  .profile__img {
    margin-bottom: 1.5rem
  }
  .profile__testimony {
    margin-bottom: 0
  }
}
@media (max-width:480px) {
  .profile__img {
    width: 200px;
    height: 200px;
    margin: 0 auto 1.5rem
  }
  .profile__img img {
    width: 200px !important;
    height: 200px !important
  }
}
.js .social-media {
  opacity: 0
}
.js.js-ready .social-media {
  opacity: 1
}
.social-media__wrapper {
  padding: 3rem 2rem;
  text-align: center
}
.social-media__wrapper.bg-black svg {
  fill: #fff
}
.social-media__wrapper.bg-white p {
  color: #7e072a
}
.social-media__wrapper.bg-white svg {
  fill: #7e072a
}
.social-media__list {
  display: flex;
  flex-wrap: wrap;
  align-items: center;
  justify-content: center
}
.social-media__item {
  margin: .75rem
}
.social-media__link {
  padding: .5rem
}
.social-media__link svg {
  width: 1.5rem
}
.social-media--alt .social-media__wrapper {
  width: 80%;
  margin-left: auto;
  margin-right: auto
}
@media (max-width:991px) {
  .social-media--alt .social-media__wrapper {
    width: auto
  }
}
.js .my-apps {
  opacity: 0
}
.js.js-ready .my-apps {
  opacity: 1
}
.my-apps__header {
  display: flex;
  align-items: center;
  justify-content: space-between;
  background: #7e072a;
  border-radius: 3px;
  color: #fff;
  padding: 11px 20px 10px;
  font-size: clamp(1rem, .9286rem + .3571vw, 1.25rem);
  line-height: 1.174;
  font-weight: 600;
  letter-spacing: .02em;
  z-index: 300
}
.my-apps__header h2 {
  margin: 0
}
.my-apps__header.bg-red {
  background-color: #c82832
}
.my-apps__header.is__active {
  border-radius: 3px 3px 0 0
}
@media (min-width:991px) {
  .my-apps__header {
    border-radius: 3px 3px 0 0
  }
}
.my-apps__widgets {
  position: relative;
  margin: 0 1.25rem 1.25rem;
  border-radius: 3px
}
.my-apps__widgets:before {
  content: "";
  position: absolute;
  top: 0;
  width: 100%;
  height: 100%;
  background-color: transparent;
  border: 1px solid rgba(51, 51, 51, .24);
  outline: 3px solid #fff;
  z-index: 200;
  border-radius: 3px
}
.my-apps__img {
  width: 36px;
  height: 36px;
  margin-right: 1rem;
  background-color: #fff
}
.my-apps__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;"
}
.my-apps__title {
  white-space: normal;
  word-break: break-word;
  margin-bottom: 0
}
.my-apps__title > span {
  font-weight: 300;
  font-size: 2.5rem;
  line-height: 1.2;
  letter-spacing: -.01rem;
  word-break: break-word;
  margin-bottom: 1rem
}
.my-apps__item {
  display: flex;
  align-items: center;
  margin: 1.5px;
  padding: 0;
  outline: 1.5px solid #eee;
  outline-offset: 1px;
  flex: 0 0 calc(100% - 4px + 0.5px);
  max-width: calc(100% - 4px + .5px)
}
.my-apps__item:first-child {
  margin-bottom: 1.5px
}
.my-apps__item__img {
  display: flex;
  align-items: center;
  justify-content: center;
  position: relative;
  padding: 0 .625rem;
  margin: 0 auto;
  width: 5rem;
  height: 100%;
  background: #fff
}
.my-apps__item__img a {
  z-index: 300
}
.my-apps__item__img img {
  width: 100%;
  height: 100%;
  -o-object-fit: cover;
  object-fit: cover;
  font-family: "object-fit: cover; object-position: 50% 50%;";
  height: auto;
  -o-object-fit: contain;
  object-fit: contain
}
.my-apps__item__img__wrapper {
  display: block
}
.my-apps__item__badge {
  position: absolute;
  right: -1rem;
  top: -1rem;
  cursor: pointer
}
.my-apps__item__badge:focus {
  outline: 3px solid #0dbdf2 !important
}
.my-apps__item__badge > svg {
  transform: scale(.8);
  fill: #7e072a
}
@media (min-width:640px) {
  .my-apps__item {
    flex: 0 0 calc(50% - 4px + 0.5px);
    max-width: calc(50% - 4px + .5px)
  }
}
@media (min-width:991px) {
  .my-apps__item {
    flex: 0 0 calc(25% - 4px + 0.5px);
    max-width: calc(25% - 4px + .5px)
  }
}
.my-apps__item-text {
  width: 100%;
  height: 100%;
  background-color: #fafafa;
  padding: 1.5rem 1.25rem 1.625rem .75rem;
  z-index: 300
}
.my-apps__item-text h3 {
  color: #7e072a;
  font-weight: 700;
  font-size: .875rem;
  margin-bottom: 6px;
  line-height: 1.14
}
.my-apps__item-text p {
  font-size: .75rem;
  letter-spacing: -.01em;
  font-weight: 500;
  line-height: 1.166
}
.my-apps__item-text p a {
  text-decoration: underline
}
.my-apps__item-favourite {
  position: absolute;
  top: 0;
  right: 0
}
.my-apps__item-favourite button {
  display: flex;
  align-items: center;
  justify-content: center;
  padding: 0;
  width: 2.5rem;
  height: 2.5rem
}
.my-apps__item-favourite button svg {
  width: 1.125rem;
  height: 1.031rem
}
.my-apps__item-favourite button svg:first-child {
  display: none
}
.my-apps__item-favourite button svg:first-child path {
  fill: #c82832
}
.my-apps__item-favourite button svg:last-child path {
  fill: #282220
}
.my-apps__item-favourite button.active svg:first-child {
  display: block
}
.my-apps__item-favourite button.active svg:last-child {
  display: none
}
.my-apps__lists {
  display: flex;
  justify-content: center;
  text-align: center;
  margin-top: .75rem;
  margin-bottom: 0
}
.my-apps__lists li {
  font-weight: 400;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  font-weight: 700
}
.my-apps__lists li + li:before {
  content: "|";
  color: #b0bcb0;
  margin: 0 .5rem
}
.my-apps__lists li a:hover {
  color: #7e072a
}
.my-apps__info-popup {
  display: none;
  position: absolute;
  top: 2em;
  left: 0;
  width: 288px;
  height: auto;
  max-height: 246px;
  box-shadow: 0 5px 10px rgba(0, 0, 0, .1);
  z-index: 1030;
  background-color: #fff;
  overflow-y: auto
}
.my-apps__info-popup__title {
  background-color: #7e072a;
  color: #fff !important;
  padding: .5rem 1rem
}
.my-apps__info-popup__title > span {
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem;
  font-weight: 600
}
.my-apps__info-popup__content {
  background-color: #fff;
  padding: 1.25rem;
  padding-bottom: .625rem
}
@media (min-width:991px) {
  .my-apps__info-popup__content {
    padding: 1.875rem;
    padding-bottom: .625rem
  }
}
.my-apps__info-popup__content a {
  color: #7e072a;
  font-size: .875rem;
  font-weight: 500;
  text-decoration: underline;
  text-underline-offset: 2px;
  letter-spacing: -.01em;
  line-height: 1.571
}
.my-apps__info-popup__content a:hover, .my-apps__info-popup__content a:visited {
  color: #7e072a
}
.my-apps__info-popup__content a:hover {
  text-decoration: underline;
  text-underline-offset: 2px;
  text-decoration-thickness: 1.5px;
  border: 0
}
.my-apps__info-popup__content li {
  font-weight: 400;
  font-size: .875rem;
  letter-spacing: .01rem
}
.my-apps__info-popup__content p {
  font-size: .875rem;
  font-weight: 500;
  letter-spacing: -.01em;
  line-height: 1.571
}
.my-apps__info-popup__content p:last-child {
  margin-bottom: 0
}
.my-apps__info-popup__content.general-content {
  margin-bottom: 0 !important
}
.my-apps__popup {
  max-height: 100vh
}
.my-apps__popup__title {
  margin-bottom: .75rem;
  text-align: center
}
@media (min-width:1440px) {
  .my-apps__popup__title {
    margin-bottom: 2rem
  }
}
.my-apps__popup__title > span {
  font-weight: 700;
  letter-spacing: -.025rem
}
.my-apps__popup__lists {
  display: flex;
  flex-wrap: wrap;
  justify-content: center;
  margin: 0;
  max-height: calc(100vh - 120px);
  overflow: auto
}
.my-apps__popup__img {
  display: flex;
  align-items: center;
  justify-content: center;
  max-width: 3.563rem;
  max-height: 3.563rem;
  width: 3.563rem;
  height: 3.563rem;
  padding: .25rem;
  margin-bottom: .625rem
}
.my-apps__popup__img img {
  -o-object-fit: contain;
  object-fit: contain
}
.my-apps__popup__link {
  display: flex;
  flex-direction: column;
  justify-content: center;
  align-items: center;
  margin: .5rem 1.25rem
}
@media (max-width:370px) {
  .my-apps__popup__link {
    margin: .5rem .75rem
  }
}
.my-apps__popup__link:hover {
  color: #7e072a
}
.my-apps__popup__link span {
  text-align: center;
  display: block;
  font-weight: 400;
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  font-weight: 700
}
.my-apps__body {
  display: flex;
  flex-wrap: wrap;
  width: 100%;
  border-radius: 0 0 3px 3px
}
@media (min-width:991px) {
  .my-apps__body.collapse:not(.show) {
    display: flex
  }
}
.my-apps__wrapper {
  width: calc(100% - 2.5rem);
  margin: 0 1.25rem;
  margin-left: auto;
  margin-right: auto
}
.my-apps__wrapper .my-apps__widgets {
  -moz-column-break-inside: avoid;
  break-inside: avoid-column;
  padding: 0;
  width: 100%;
  margin-left: auto;
  margin-right: auto
}
@media (min-width:991px) {
  .my-apps__wrapper .my-apps__widgets {
    width: calc(100% - .625rem);
    display: inline-block
  }
}
@media (min-width:991px) {
  .my-apps__wrapper .my-apps__widgets .col-lg-3 {
    flex: 0 0 calc(50% - 4px);
    max-width: calc(50% - 4px)
  }
}
@media (min-width:991px) {
  .my-apps__wrapper {
    columns: 2;
    width: calc(100% - 2.5rem + .625rem);
    overflow: visible
  }
}
.my-apps .popup-modal {
  height: auto;
  width: calc(100% - 8.75rem);
  background-color: #fff;
  position: fixed;
  left: 50%;
  top: 50%;
  transform: translate(-50%, -50%);
  padding: 2rem 1.25rem;
  display: none;
  z-index: 2300
}
@media (max-width:480px) {
  .my-apps .popup-modal {
    width: calc(100% - 3rem)
  }
}
@media (min-width:991px) {
  .my-apps .popup-modal {
    padding-top: 2.5rem;
    padding-bottom: 4.438rem
  }
}
@media (min-width:1440px) {
  .my-apps .popup-modal {
    max-width: 71.25rem
  }
}
.my-apps .popup-modal__close {
  background-color: #7e072a;
  position: absolute;
  right: 0;
  top: auto;
  bottom: calc(100% + 1.375rem);
  cursor: pointer;
  padding: .35rem .5rem
}
.my-apps .popup-modal__close:focus, .my-apps .popup-modal__close:focus-visible, .my-apps .popup-modal__close:focus-within {
  outline: 2px solid #0dbdf2
}
.my-apps .popup-modal__close svg {
  fill: #fff
}
.my-apps .right-position {
  left: auto !important
}
.my-apps .bottom-position {
  bottom: 5rem;
  top: auto !important
}
@media (max-width:575px) {
  .my-apps__info-popup {
    left: 0;
    width: 210px
  }
}
@media (max-width:424px) {
  .my-apps__header {
    display: flex
  }
  .my-apps__title {
    text-align: center
  }
  .my-apps__img {
    margin: 0 auto 1rem
  }
  .my-apps__info-popup {
    width: 180px
  }
}
.body-blackout.my-apps-modal {
  z-index: 2200 !important
}
.notification-trigger--open .notification-close {
  display: inline !important
}
.notification-trigger .notification-close {
  display: none
}
.notification-popup {
  height: 85%;
  width: 90%;
  background-color: #fff;
  position: fixed;
  left: 50%;
  top: 5rem;
  transform: translateX(-50%);
  padding: 2rem;
  display: none;
  z-index: 2300;
  transition: top .3s ease-in-out
}
.notification-popup.fade-in {
  animation: .25s d
}
.notification-popup.fade-out {
  animation: .25s e
}
.notification-popup--open {
  display: block
}
.notification-popup--up {
  top: 5rem;
  transition: top .3s ease-in-out
}
.notification-popup__close {
  background-color: #7e072a;
  position: absolute;
  right: -.75rem;
  top: -.75rem;
  cursor: pointer;
  padding: .35rem .5rem
}
.notification-popup__close svg {
  fill: #fff
}
.notification-popup .box-img-text-card-type {
  height: 100%;
  overflow-x: hidden;
  overflow-y: auto
}
.js .footer {
  opacity: 0
}
.js.js-ready .footer {
  opacity: 1
}
.footer {
  background-color: #7e072a;
  margin-top: 2rem
}
.footer__container {
  padding: 2rem 5rem
}
.footer__col--primary {
  display: flex;
  flex-direction: column;
  justify-content: space-between
}
.footer__col--tertiary {
  display: none
}
.footer__logo {
  display: block;
  min-width: 225px;
  max-width: 320px;
  height: auto;
  margin-top: .5rem;
  margin-bottom: 1rem;
  -webkit-backface-visibility: hidden;
  backface-visibility: hidden;
  overflow: hidden
}
.footer__logo > img {
  width: 100%;
  height: auto
}
.footer__social, .footer__tagline {
  color: #fff !important
}
.footer__social__list {
  display: flex;
  flex-wrap: wrap;
  align-items: center
}
.footer__social__item {
  margin-left: .75rem;
  margin-right: .75rem
}
.footer__social__item:first-child {
  margin-left: 0
}
.footer__social__item--show-more > a {
  padding-top: .25rem;
  padding-bottom: .25rem
}
.footer__social__link {
  padding: .5rem 0;
  color: #fff !important
}
.footer__social__link__text {
  font-size: .75rem;
  line-height: 1.4;
  letter-spacing: .07rem;
  text-transform: uppercase;
  font-weight: 600
}
.footer__social__link > img {
  width: 2rem
}
.footer__social__link > svg {
  fill: #fff
}
.footer__link-widget {
  color: #fff !important;
  display: flex
}
.footer__link-widget__col:first-child {
  margin-left: auto;
  margin-right: 5rem
}
.footer__link-widget__item {
  padding-top: .25rem;
  padding-bottom: .25rem
}
.footer__link-widget__item--title {
  border-bottom: 2px solid #DD3224;
  margin-bottom: 1rem
}
.footer__link-widget__link {
  color: #fff !important
}
.footer__link-widget__link-title {
  display: block;
  font-weight: 700;
  letter-spacing: -.025rem
}
@media (max-width:1199px) {
  .footer__container {
    padding: 2rem
  }
  .footer__logo {
    margin-top: 0
  }
  .footer__col--primary {
    display: block;
    flex-direction: row;
    justify-content: normal;
    margin-bottom: 1rem
  }
  .footer__col--tertiary {
    display: block
  }
  .footer__social--desktop {
    display: none
  }
  .footer__social--mobile {
    margin-top: 1rem
  }
  .footer__link-widget__col:first-child {
    margin-left: 0
  }
}
@media (max-width:575px) {
  .footer__logo {
    min-width: auto;
    max-width: 225px
  }
  .footer__link-widget {
    display: block
  }
  .footer__link-widget__col:first-child {
    margin-right: 0
  }
  .footer__social__item:nth-of-type(5) {
    margin-right: 3rem
  }
  .footer__social__item--show-more {
    margin-left: 0;
    margin-top: 2rem
  }
}
@media (max-width:480px) {
  .footer__social__item:nth-of-type(5) {
    margin-right: .75rem
  }
}

/* .header-nav__mobile--open {
  background-color: #7e072a !important
}*/

.header-nav__top__welcome-notice {
  font-weight: 400
}
.header-nav__top__list__my-pages {
  display: inline-block;
  color: #fff !important;
  font-size: .8rem;
  padding: .35rem .5rem
}
.header-nav__top__list__my-pages:hover {
  text-decoration: none;
  cursor: default
}
.header-nav__top__list__my-pages svg {
  fill: #fff;
  margin-top: -.3rem;
  margin-left: -.3rem
}
.header-nav__top__list__my-pages__dropdown {
  display: none;
  position: absolute;
  z-index: 9999;
  padding: 5px;
  text-align: center;
  border-radius: 6px;
  background: transparent;
  padding: 1rem;
  margin-left: -2.5rem;
  max-width: 10rem
}
.header-nav__top__list__my-pages__dropdown li {
  background: #7e072a;
  border-radius: 6px;
  margin-bottom: -10px
}
.header-nav__top__list__my-pages__dropdown li a {
  color: #fff;
  padding: .7rem 1rem;
  display: block
}
.header-nav__top__list__my-pages__dropdown li:first-child:before {
  content: "";
  display: block;
  width: 0;
  height: 0;
  border-left: 8px solid transparent;
  border-right: 8px solid transparent;
  border-bottom: 8px solid transparent;
  position: absolute;
  top: 1rem;
  left: 50%;
  transform: translate(-50%, -100%);
  border-bottom-color: #7e072a
}
.header-nav__top__list__my-pages .dropdown--open {
  display: block
}
.header-nav__top__list--secondary .information-for {
  padding: 0
}
.header-nav__top__list--secondary .information-for:hover a.header-nav__top__link {
  cursor: pointer;
  text-decoration: underline
}
.header-nav__top__list--secondary .information-for svg {
  fill: #fff;
  margin-top: -.3rem;
  margin-left: -.8rem
}
.header-nav__top__list--secondary .information-for:hover svg {
  text-decoration: none !important
}
.header-nav__top__list--secondary .information-for .dropdown--open {
  display: block !important
}
.header-nav__top__list--secondary .information-for__dropdown {
  display: none;
  position: absolute;
  z-index: 9999;
  padding: 5px;
  text-align: center;
  border-radius: 6px;
  background: transparent;
  padding: 1rem;
  margin-left: -1.5rem;
  margin-top: -.3rem;
  max-width: 10.4rem
}
.header-nav__top__list--secondary .information-for__dropdown li {
  background: #333;
  border-radius: 6px;
  margin-bottom: -10px
}
.header-nav__top__list--secondary .information-for__dropdown li a {
  color: #fff;
  padding: .7rem 1rem;
  display: block
}
.header-nav__top__list--secondary .information-for__dropdown li:first-child:before {
  content: "";
  display: block;
  width: 0;
  height: 0;
  border-left: 8px solid transparent;
  border-right: 8px solid transparent;
  border-bottom: 8px solid transparent;
  position: absolute;
  top: 1rem;
  left: 50%;
  transform: translate(-50%, -100%);
  border-bottom-color: #333
}
.header-nav__dropdown-menu__lists-widget--top--list {
  padding: 0 !important
}
.header-nav__dropdown-menu__lists-widget--top--list li a {
  color: #000 !important;
  padding: .5rem 0
}
.header-nav__bottom__my-pages-mobile svg {
  fill: #fff
}
.header-nav__bottom__my-pages-mobile .btn-back-nav svg {
  fill: #333
}
.header-nav__bottom__my-pages-mobile .header-nav__dropdown-menu__sibling-link:hover {
  background: #fff
}
.header-nav__bottom__my-pages-mobile .header-nav__dropdown-menu__sibling-link:hover a {
  background: transparent
}
.header-nav__bottom__my-pages-mobile .header-nav__dropdown-menu__item:hover a {
  background: transparent;
  color: #7e072a !important
}
.header-nav__bottom__information-for-mobile svg {
  fill: #fff
}
.header-nav__bottom__information-for-mobile .btn-back-nav svg {
  fill: #333
}
.header-nav__bottom__information-for-mobile .header-nav__dropdown-menu__sibling-link:hover {
  background: #fff
}
.header-nav__bottom__information-for-mobile .header-nav__dropdown-menu__sibling-link:hover a {
  background: transparent
}
.header-nav__bottom__information-for-mobile .header-nav__dropdown-menu__item:hover a {
  background: transparent;
  color: #7e072a !important
}
.header-nav .header-nav__bottom__outer-quick-list--primary.log-in-out--btn a {
  background-color: #fff;
  width: 100%;
  color: #7e072a !important;
  text-transform: uppercase
}
.header-nav .header-nav__bottom__outer-quick-list--primary.log-in-out--btn a:hover {
  opacity: .85;
  background-color: #fff !important
}
.header-nav__mobile__auth-user {
  padding: 2rem 2rem 0 2.5rem
}
.header-nav__mobile__direct-edit {
  display: none !important
}
.header-nav__mobile--open.slide-in-right.slide-overlay {
  overflow-y: visible !important
}
.header-nav__mobile--open.slide-in-right, .header-nav__mobile--open.slide-in-right.slide-overlay.safari-iphone {
  overflow-y: scroll !important
}
.masthead {
  background: #7e072a;
  color: #fff
}
.masthead__inner {
  width: calc(100% - 2.5rem);
  margin-left: auto;
  margin-right: auto;
  padding-top: 1.688rem;
  padding-bottom: 1.688rem;
  margin-bottom: 1.25rem
}
@media (min-width:991px) {
  .masthead__inner {
    width: calc(100% - 5rem);
    padding-bottom: 1rem
  }
}
@media (min-width:1200px) {
  .masthead__inner {
    padding-top: 1.688rem
  }
}
.masthead__title {
  display: flex;
  align-items: center;
  justify-content: space-between;
  font-size: clamp(1.625rem, 1.5179rem + .5357vw, 2rem);
  line-height: 1.174;
  letter-spacing: .01em;
  font-weight: 500;
  margin-bottom: 0
}
.masthead__text {
  font-size: 1rem;
  line-height: 1.173;
  font-weight: 300;
  margin-top: 6px
}
@media (min-width:991px) {
  .masthead__text {
    display: block;
    width: 83.3333333333%
  }
  .masthead__text.collapse:not(.show) {
    display: flex
  }
}
.masthead__tab svg {
  fill: #fff
}
@media (min-width:991px) {
  .masthead__tab {
    display: none
  }
}
.carousel-header {
  padding-top: 15px
}
.carousel-header .col-lg-9 {
  padding-right: 4px
}
.carousel-header .cta-container {
  display: flex;
  flex-direction: column
}
.carousel-header .cta-container .btn-primary {
  height: 24%;
  display: flex;
  align-items: center;
  background-color: transparent !important
}
.carousel-header .cta-container .btn-primary::hover {
  background-color: transparent !important
}
.carousel-header .cta-container .button-wrapper {
  border-bottom: 5px solid #7e072a;
  width: 100%;
  display: flex;
  align-items: center;
  padding-bottom: 20px
}
.carousel-header .cta-container a:hover p {
  color: #5a0414 !important;
  -webkit-text-decoration: underline 2px !important;
  text-decoration: underline 2px !important
}
.carousel-header .cta-container .cta-text {
  display: flex;
  align-items: center;
  text-align: left
}
.carousel-header .cta-container .cta-text p {
  font-size: 1.5rem;
  color: #000;
  margin: 0 !important;
  transition: .4s ease-in-out
}
.carousel-header .cta-container .cta-icon {
  width: 30%
}
.carousel-header .cta-container .cta-icon img {
  height: 90px;
  color: #7e072a;
  font-size: 3rem;
  margin-right: 25px
}
.carousel-header .img-container {
  display: flex;
  align-items: center;
  position: relative;
  width: 100%
}
.carousel-header .img-container:hover .carousel-arrow {
  opacity: .9
}
.carousel-header .img-container .content {
  position: absolute;
  bottom: 23px;
  left: 23px;
  max-width: 550px;
  padding: 15px;
  z-index: 2
}
.carousel-header .img-container .content h2 {
  font-weight: 600;
  font-size: 2rem;
  color: #000
}
.carousel-header .img-container .content p {
  color: #000;
  font-size: .9rem
}
.carousel-header .img-container .content .category {
  color: #333
}
.carousel-header .img-container .content a:hover {
  text-decoration: none
}
.carousel-header .img-container .content .overlay {
  position: absolute;
  top: 0;
  left: 0;
  right: 0;
  bottom: 0;
  background-color: #e1e1e1;
  border-radius: 2px;
  opacity: .93;
  z-index: -1
}
.carousel-header .img-container .content .btn {
  z-index: 3
}
.carousel-header .slide-container {
  display: flex;
  align-items: flex-start;
  justify-content: flex-start;
  scroll-behavior: smooth;
  -ms-scroll-snap-type: x mandatory;
  scroll-snap-type: x mandatory;
  overflow: hidden;
  width: 100%;
  height: 100%
}
.carousel-header .slide-container .slide {
  flex: 1 0 100%;
  height: 100%;
  scroll-snap-align: start;
  display: flex;
  justify-content: center;
  align-items: center
}
.carousel-header .slide-container .slide picture {
  width: 100%;
  height: 100%;
  display: block
}
.carousel-header .slide-container .slide img {
  width: 100%;
  height: 100%;
  display: block;
  -o-object-fit: cover;
  object-fit: cover;
  aspect-ratio: 16/9
}
.carousel-arrows {
  width: 500px;
  height: 400px;
  background-color: #000
}
.carousel-arrow {
  position: absolute;
  display: flex;
  top: 40%;
  bottom: 0;
  height: 4rem;
  background-color: #7e072a;
  color: #fff;
  border: none;
  width: 4rem;
  font-size: 3rem;
  line-height: 1.15em;
  padding: 0;
  cursor: pointer;
  opacity: 1;
  z-index: 1;
  transition: opacity .5s ease
}
.carousel-arrow:focus, .carousel-arrow:hover {
  opacity: 1
}
.carousel-arrow.prev {
  left: 0;
  padding-left: 1.5rem
}
.carousel-arrow.next {
  right: 0;
  padding-left: 1.5rem
}
@media only screen and (max-width:1830px) {
  .carousel-header .row {
    margin-right: 2px;
    margin-left: 2px
  }
}
@media only screen and (max-width:1380px) {
  .carousel-header .cta-container .btn img {
    height: 40px
  }
  .carousel-header .cta-container .btn p {
    font-size: 1.1rem;
    padding-top: 5px
  }
}
@media only screen and (max-width:991px) {
  .carousel-header {
    padding-top: 0
  }
  .carousel-header .row {
    margin-right: 0;
    margin-left: 0
  }
  .carousel-header .img-container {
    padding-bottom: 100px
  }
  .carousel-header .img-container .content {
    left: 5.5%;
    right: 5.5%;
    bottom: 5px;
    background-color: hsla(0, 0%, 88%, .8);
    z-index: 2;
    max-width: 1000px
  }
  .carousel-header .cta-container {
    margin-top: 20px;
    padding: 0 50px
  }
  .carousel-header .cta-container .button-wrapper {
    padding: 10px !important
  }
  .carousel-header .cta-container .btn-primary {
    height: 60px !important;
    margin-bottom: 10px;
    justify-content: center
  }
  .carousel-header .cta-container .btn-primary p {
    margin-bottom: 0 !important
  }
  .carousel-header .cta-container .cta-icon {
    width: 50px
  }
  .carousel-header .col-lg-9 {
    padding: 0
  }
  .carousel-arrow {
    top: 30%
  }
}
@media only screen and (max-width:768px) {
  .carousel-header .cta-container {
    margin-top: 20px
  }
  .carousel-header .img-container {
    flex-direction: column-reverse;
    padding-bottom: 0
  }
  .carousel-header .img-container .content {
    position: static;
    background-color: #e7e7e7;
    width: 100%
  }
  .carousel-header .img-container .content .overlay {
    display: none
  }
  .carousel-arrow {
    top: 20%
  }
}
@media only screen and (max-width:435px) {
  .carousel-header .cta-container {
    padding: 0 15px
  }
  .carousel-header .cta-container .btn {
    justify-content: left
  }
  .carousel-header .img-container .content h2 {
    font-size: 1.5rem
  }
  .carousel-header .img-container .content .button-text {
    font-size: 1rem
  }
  .carousel-arrow {
    top: 19%;
    height: 3rem;
    width: 3rem;
    font-size: 2.2rem
  }
  .carousel-arrow.prev {
    padding-left: 1rem
  }
  .carousel-arrow.next {
    padding-left: 1.2rem
  }
}
.featured-stories .carousel-arrows {
  display: flex;
  justify-content: space-between;
  position: relative;
  height: 0;
  top: 80px;
  width: 100%
}
.featured-stories .carousel-arrow {
  position: static;
  opacity: .5;
  z-index: 99
}
.featured-stories .carousel-arrow:focus, .featured-stories .carousel-arrow:hover {
  opacity: 1
}
.featured-stories .carousel-arrow.next, .featured-stories .carousel-arrow.prev {
  margin: 31px
}
.featured-stories .title {
  display: flex;
  justify-content: space-between;
  align-items: center;
  flex-wrap: nowrap;
  padding: 15px
}
.featured-stories .title h2 {
  margin: auto;
  font-size: 2.5rem;
  color: #7e072a;
  font-family: "Modern Gothic", Arial, sans-serif;
  flex-shrink: 0;
  max-width: 100%
}
.featured-stories .title h2 span {
  color: #343a40
}
.featured-stories .slide-container {
  display: flex;
  flex-wrap: nowrap;
  overflow: scroll;
  justify-content: start;
  -ms-scroll-snap-type: x mandatory;
  scroll-snap-type: x mandatory;
  scrollbar-width: none;
  scroll-behavior: smooth;
  padding: 0;
  -ms-overflow-style: none;
  -webkit-overflow-scrolling: touch
}
.featured-stories .featured-stories-container::-webkit-scrollbar {
  display: none
}
.featured-stories .slide {
  flex: 3 0 33.33%;
  max-width: 50%;
  height: 100%;
  scroll-snap-align: start;
  text-align: center;
  margin-right: 0;
  padding: 0 30px
}
.featured-stories .slide .slide-inner > img {
  max-width: 100%;
  max-height: 100%;
  min-height: 50%;
  width: 100%;
  border: 1px solid #e2e2e2;
  height: auto;
  aspect-ratio: 16/9;
  -o-object-fit: cover;
  object-fit: cover
}
.featured-stories .slide h3 {
  font-family: "Modern Gothic", Arial, sans-serif;
  font-size: 1.4rem;
  text-align: left
}
.featured-stories .slide a {
  color: #000 !important
}
.featured-stories .slide a:after {
  content: "";
  position: absolute;
  z-index: 1;
  top: 0;
  left: 0;
  right: 0;
  height: 100%;
  background: hsla(0, 0%, 100%, 0)
}
.featured-stories .slide .category {
  margin: 8px 0 !important;
  text-transform: uppercase;
  font-size: .9rem;
  text-align: left
}
.featured-stories .slide .category span {
  color: #333
}
.featured-stories .slide-inner {
  position: relative
}
.featured-stories .fordham-logo {
  text-align: left
}
.featured-stories .fordham-logo img {
  width: 170px
}
@media only screen and (max-width:1480px) {
  .featured-stories .carousel-arrows {
    top: 60px
  }
}
@media only screen and (max-width:1320px) {
  .featured-stories .carousel-arrows {
    top: 40px
  }
}
@media only screen and (max-width:1120px) {
  .featured-stories .carousel-arrows {
    top: 20px
  }
}
@media only screen and (min-width:992px) {
  .featured-stories .carousel-arrow {
    display: block
  }
}
@media only screen and (max-width:991px) {
  .featured-stories .featured-stories-container {
    position: relative;
    flex-direction: row
  }
  .featured-stories .featured-stories-container::-webkit-scrollbar {
    display: none
  }
  .featured-stories .slide-container {
    flex-wrap: nowrap;
    overflow: hidden;
    justify-content: start;
    -ms-scroll-snap-type: x mandatory;
    scroll-snap-type: x mandatory;
    scrollbar-width: none;
    scroll-behavior: smooth;
    padding: 0;
    -ms-overflow-style: none;
    -webkit-overflow-scrolling: touch
  }
  .featured-stories .slide {
    flex: 0 0 100%;
    max-width: 100%;
    height: 100%;
    scroll-snap-align: start;
    text-align: center;
    margin-right: 0;
    padding: 0 30px
  }
  .featured-stories .slide .slide-inner > img {
    width: 100%
  }
  .featured-stories .carousel-arrows {
    top: 160px
  }
  .featured-stories .carousel-arrow {
    display: flex
  }
  .featured-stories .carousel-arrow.prev {
    margin-left: 31px
  }
  .featured-stories .carousel-arrow.next {
    margin-right: 31px
  }
}
@media only screen and (max-width:840px) {
  .featured-stories .carousel-arrows {
    top: 130px
  }
}
@media only screen and (max-width:768px) {
  .featured-stories .carousel-arrows {
    top: 110px
  }
}
@media only screen and (max-width:620px) {
  .featured-stories .title h2 {
    border-bottom: 4px solid #e2e2e2;
    width: 100%;
    text-align: center
  }
  .featured-stories .title h2:after {
    display: none
  }
  .featured-stories .slide h3 {
    font-size: 1.2rem
  }
  .featured-stories .carousel-arrows {
    top: 90px
  }
}
@media only screen and (max-width:520px) {
  .featured-stories .carousel-arrows {
    top: 70px
  }
  .featured-stories .carousel-arrow {
    font-size: 2rem;
    height: 3rem;
    width: 3.5rem
  }
  .featured-stories .carousel-arrow.next, .featured-stories .carousel-arrow.prev {
    padding-top: 3px
  }
}
@media only screen and (max-width:435px) {
  .featured-stories .carousel-arrows {
    top: 50px
  }
}
@media only screen and (max-width:320px) {
  .featured-stories .carousel-arrows {
    top: 20px
  }
}
.video-embed-background .video-embed-background-wrapper {
  display: flex;
  flex-direction: column;
  text-align: center;
  align-items: center;
  background-size: cover !important;
  background-position: top !important;
  background-repeat: no-repeat !important;
  padding-bottom: 10px
}
.video-embed-background .title {
  font-size: 2.5rem;
  font-weight: 400
}
.video-embed-background .title h2 span {
  color: #7e072a
}
.video-embed-background .content {
  width: 70%
}
.video-embed-background .content p {
  font-size: 1.25rem
}
.video-embed-background .video-embed {
  width: 60%
}
.video-embed-background .video-embed.video-content__video--youtube {
  padding-bottom: 34.55%
}
.video-embed-background .link {
  margin: .5rem 0;
  font-weight: 300;
  line-height: 1.5
}
.video-embed-background.side-divider .video-embed {
  padding-bottom: 33.35%
}
@media only screen and (max-width:1280px) {
  .video-embed-background.side-divider .video-embed, .video-embed-background .video-embed .video-embed {
    width: 70%
  }
  .video-embed-background.side-divider .video-embed.video-content__video--youtube, .video-embed-background .video-embed .video-embed.video-content__video--youtube {
    padding-bottom: 44.55%
  }
}
@media only screen and (max-width:991px) {
  .video-embed-background.side-divider .video-embed, .video-embed-background .video-embed .video-embed {
    width: 80%
  }
  .video-embed-background.side-divider .video-embed.video-content__video--youtube, .video-embed-background .video-embed .video-embed.video-content__video--youtube {
    padding-bottom: 44.55%
  }
}
@media only screen and (max-width:768px) {
  .video-embed-background.side-divider .video-embed, .video-embed-background .video-embed .video-embed {
    width: 80%
  }
  .video-embed-background.side-divider .video-embed.video-content__video--youtube, .video-embed-background .video-embed .video-embed.video-content__video--youtube {
    padding-bottom: 45.55%
  }
}
.block-quote-embed .block-quote-column {
  display: flex !important;
  align-items: center !important
}
.block-quote-embed .slide-container, .block-quote-embed .social-embed-column, .block-quote-embed .social-embed-column-2, .block-quote-embed .social-embed-column-3 {
  display: flex;
  justify-content: center
}
.block-quote-embed .slide-container {
  width: 100%
}
.block-quote-embed .block-quote {
  display: flex;
  position: relative;
  padding-top: 60px
}
.block-quote-embed .block-quote .profile {
  padding: 0 20px
}
.block-quote-embed .block-quote .quote {
  font-size: 1.8rem;
  padding-top: 20px;
  letter-spacing: -.5px;
  align-self: center;
  text-align: center
}
.block-quote-embed .block-quote .opening-quote {
  align-self: start
}
.block-quote-embed .block-quote .closing-quote {
  align-self: end
}
.block-quote-embed .block-quote .author {
  font-size: 1.6rem;
  text-align: center
}
.block-quote-embed .block-quote .link {
  text-align: center
}
.block-quote-embed .block-quote .link .cta-link-font {
  font-size: 1.1rem
}
.block-quote-embed .block-quote:after {
  position: absolute;
  content: "";
  top: 20px;
  left: 50%;
  margin-left: -100px;
  border-bottom: 3px solid #7e072a;
  height: 3px;
  width: 200px
}
.block-quote-embed .block-quote img {
  height: 180px;
  background-position: 50%;
  background-repeat: no-repeat;
  background-size: cover;
  border-radius: 180px;
  width: 180px;
  margin: 0 auto;
  aspect-ratio: 16/9;
  -o-object-fit: cover;
  object-fit: cover
}
.block-quote-embed .block-quote__container {
  display: flex;
  width: 100%;
  justify-content: center;
  text-align: center
}
.block-quote-embed .carousel-arrows {
  display: flex;
  justify-content: space-between;
  position: relative;
  height: 0;
  width: 100%
}
.block-quote-embed .carousel-arrow {
  position: static;
  opacity: .5;
  visibility: hidden
}
.block-quote-embed .carousel-arrow:focus, .block-quote-embed .carousel-arrow:hover {
  opacity: 1
}
@media only screen and (max-width:991px) {
  .block-quote-embed .row {
    position: relative;
    flex-direction: row
  }
  .block-quote-embed .carousel-arrows {
    width: 568px;
    margin: auto;
    padding: 0 16px;
    top: 350px
  }
  .block-quote-embed .slide-container {
    flex-wrap: nowrap;
    overflow: hidden;
    justify-content: start;
    -ms-scroll-snap-type: x mandatory;
    scroll-snap-type: x mandatory;
    scrollbar-width: none;
    scroll-behavior: smooth;
    padding: 0;
    -ms-overflow-style: none;
    -webkit-overflow-scrolling: touch
  }
  .block-quote-embed .row::-webkit-scrollbar {
    display: none
  }
  .block-quote-embed .social-embed-column-2.slide, .block-quote-embed .social-embed-column-3.slide {
    flex: 0 0 100%;
    max-width: 100%;
    height: 100%;
    scroll-snap-align: start;
    text-align: center;
    margin-right: 0;
    padding: 0 30px
  }
  .block-quote-embed .block-quote__container svg {
    height: 50px
  }
  .block-quote-embed .block-quote .quote {
    font-size: 2rem;
    padding-left: 0 !important
  }
  .block-quote-embed .block-quote .quote .author {
    font-size: 1.4rem
  }
  .block-quote-embed .block-quote__container {
    padding: 0 120px
  }
}
@media only screen and (max-width:768px) {
  .block-quote-embed .block-quote__container {
    padding: 0 !important
  }
}
@media only screen and (max-width:570px) {
  .block-quote-embed .carousel-arrows {
    width: 99%
  }
}
@media only screen and (max-width:546px) {
  .block-quote-embed .row, .block-quote-embed .social-embed-column-2.slide, .block-quote-embed .social-embed-column-3.slide {
    padding: 0 15px
  }
  .block-quote-embed .block-quote__container svg {
    height: 35px
  }
  .block-quote-embed .block-quote .quote {
    font-size: 1.3rem
  }
  .block-quote-embed .block-quote .quote .author {
    font-size: 1.1rem
  }
  .block-quote-embed .block-quote .quote .link .cta-link-font {
    font-size: .94rem
  }
}
@media only screen and (max-width:495px) {
  .block-quote-embed .carousel-arrows {
    top: 300px
  }
}
@media only screen and (max-width:435px) {
  .block-quote-embed .carousel-arrows {
    top: 270px
  }
  .block-quote-embed .block-quote .profile {
    padding: 0 !important
  }
}
@media only screen and (max-width:356px) {
  .block-quote-embed .carousel-arrows {
    top: 220px
  }
}
.two-by-two.two-box .col-lg-6 {
  height: 600px
}
.two-by-two.two-box .col-lg-6 .title .title-header {
  font-size: 2.5rem !important;
  color: #fff
}
.two-by-two .content-container .title img {
  width: 90px !important
}
@media only screen and (max-width:991px) {
  .two-by-two.two-box .col-lg-6 {
    height: 400px
  }
  .two-by-two.single-three-box .col-lg-4 {
    height: 300px
  }
}
@media only screen and (max-width:486px) {
  .two-by-two.two-box .col-lg-6 .title .title-header {
    font-size: 1.8rem !important
  }
}
/*# sourceMappingURL=maps/style.css.map */